diff --git a/.gitignore b/.gitignore deleted file mode 100644 index 0f96d33..0000000 --- a/.gitignore +++ /dev/null @@ -1,34 +0,0 @@ -# See https://help.github.com/articles/ignoring-files/ for more about ignoring files. - -# dependencies -/node_modules -/.pnp -.pnp.js - -# testing -/coverage - -# next.js -/.next/ -/out/ - -# production -/build - -# misc -.DS_Store -*.pem - -# debug -npm-debug.log* -yarn-debug.log* -yarn-error.log* - -# local env files -.env.local -.env.development.local -.env.test.local -.env.production.local - -# vercel -.vercel diff --git a/README.md b/README.md deleted file mode 100644 index 218b5e6..0000000 --- a/README.md +++ /dev/null @@ -1,34 +0,0 @@ -This is a [Next.js](https://nextjs.org/) project bootstrapped with [`create-next-app`](https://github.com/vercel/next.js/tree/canary/packages/create-next-app). - -## Getting Started - -First, run the development server: - -```bash -npm run dev -# or -yarn dev -``` - -Open [http://localhost:3000](http://localhost:3000) with your browser to see the result. - -You can start editing the page by modifying `pages/index.js`. The page auto-updates as you edit the file. - -[API routes](https://nextjs.org/docs/api-routes/introduction) can be accessed on [http://localhost:3000/api/hello](http://localhost:3000/api/hello). This endpoint can be edited in `pages/api/hello.js`. - -The `pages/api` directory is mapped to `/api/*`. Files in this directory are treated as [API routes](https://nextjs.org/docs/api-routes/introduction) instead of React pages. - -## Learn More - -To learn more about Next.js, take a look at the following resources: - -- [Next.js Documentation](https://nextjs.org/docs) - learn about Next.js features and API. -- [Learn Next.js](https://nextjs.org/learn) - an interactive Next.js tutorial. - -You can check out [the Next.js GitHub repository](https://github.com/vercel/next.js/) - your feedback and contributions are welcome! - -## Deploy on Vercel - -The easiest way to deploy your Next.js app is to use the [Vercel Platform](https://vercel.com/import?utm_medium=default-template&filter=next.js&utm_source=create-next-app&utm_campaign=create-next-app-readme) from the creators of Next.js. - -Check out our [Next.js deployment documentation](https://nextjs.org/docs/deployment) for more details. diff --git a/assets/css/fontawesome.css b/assets/css/fontawesome.css new file mode 100644 index 0000000..8a62aac --- /dev/null +++ b/assets/css/fontawesome.css @@ -0,0 +1,6805 @@ +/*! + * Font Awesome Free 6.0.0-beta3 by @fontawesome - https://fontawesome.com + * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License) + * Copyright 2021 Fonticons, Inc. + */ + .fa { + font-family: var(--fa-style-family, "Font Awesome 6 Free"); + font-weight: var(--fa-style, 900); } + +.fa, +.fas, +.fa-solid, +.far, +.fa-regular, +.fal, +.fa-light, +.fat, +.fa-thin, +.fad, +.fa-duotone, +.fab, +.fa-brands { + -moz-osx-font-smoothing: grayscale; + -webkit-font-smoothing: antialiased; + display: var(--fa-display, inline-block); + font-style: normal; + font-variant: normal; + line-height: 1; + text-rendering: auto; } + +.fa-1x { + font-size: 1em; } + +.fa-2x { + font-size: 2em; } + +.fa-3x { + font-size: 3em; } + +.fa-4x { + font-size: 4em; } + +.fa-5x { + font-size: 5em; } + +.fa-6x { + font-size: 6em; } + +.fa-7x { + font-size: 7em; } + +.fa-8x { + font-size: 8em; } + +.fa-9x { + font-size: 9em; } + +.fa-10x { + font-size: 10em; } + +.fa-2xs { + font-size: 0.625em; + line-height: 0.1em; + vertical-align: 0.225em; } + +.fa-xs { + font-size: 0.75em; + line-height: 0.08333em; + vertical-align: 0.125em; } + +.fa-sm { + font-size: 0.875em; + line-height: 0.07143em; + vertical-align: 0.05357em; } + +.fa-lg { + font-size: 1.25em; + line-height: 0.05em; + vertical-align: -0.075em; } + +.fa-xl { + font-size: 1.5em; + line-height: 0.04167em; + vertical-align: -0.125em; } + +.fa-2xl { + font-size: 2em; + line-height: 0.03125em; + vertical-align: -0.1875em; } + +.fa-fw { + text-align: center; + width: 1.25em; } + +.fa-ul { + list-style-type: none; + margin-left: var(--fa-li-margin, 2.5em); + padding-left: 0; } + .fa-ul > li { + position: relative; } + +.fa-li { + left: calc(var(--fa-li-width, 2em) * -1); + position: absolute; + text-align: center; + width: var(--fa-li-width, 2em); + line-height: inherit; } + +.fa-border { + border-color: var(--fa-border-color, #eee); + border-radius: var(--fa-border-radius, 0.1em); + border-style: var(--fa-border-style, solid); + border-width: var(--fa-border-width, 0.08em); + padding: var(--fa-border-padding, 0.2em 0.25em 0.15em); } + +.fa-pull-left { + float: left; + margin-right: var(--fa-pull-margin, 0.3em); } + +.fa-pull-right { + float: right; + margin-left: var(--fa-pull-margin, 0.3em); } + +.fa-beat { + -webkit-animation-name: fa-beat; + animation-name: fa-beat; + -webkit-animation-delay: var(--fa-animation-delay, 0); + animation-delay: var(--fa-animation-delay, 0); + -webkit-animation-direction: var(--fa-animation-direction, normal); + animation-direction: var(--fa-animation-direction, normal); + -webkit-animation-duration: var(--fa-animation-duration, 1s); + animation-duration: var(--fa-animation-duration, 1s); + -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite); + animation-iteration-count: var(--fa-animation-iteration-count, infinite); + -webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out); + animation-timing-function: var(--fa-animation-timing, ease-in-out); } + +.fa-fade { + -webkit-animation-name: fa-fade; + animation-name: fa-fade; + -webkit-animation-delay: var(--fa-animation-delay, 0); + animation-delay: var(--fa-animation-delay, 0); + -webkit-animation-direction: var(--fa-animation-direction, normal); + animation-direction: var(--fa-animation-direction, normal); + -webkit-animation-duration: var(--fa-animation-duration, 1s); + animation-duration: var(--fa-animation-duration, 1s); + -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite); + animation-iteration-count: var(--fa-animation-iteration-count, infinite); + -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); + animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); } + +.fa-beat-fade { + -webkit-animation-name: fa-beat-fade; + animation-name: fa-beat-fade; + -webkit-animation-delay: var(--fa-animation-delay, 0); + animation-delay: var(--fa-animation-delay, 0); + -webkit-animation-direction: var(--fa-animation-direction, normal); + animation-direction: var(--fa-animation-direction, normal); + -webkit-animation-duration: var(--fa-animation-duration, 1s); + animation-duration: var(--fa-animation-duration, 1s); + -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite); + animation-iteration-count: var(--fa-animation-iteration-count, infinite); + -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); + animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); } + +.fa-flip { + -webkit-animation-name: fa-flip; + animation-name: fa-flip; + -webkit-animation-delay: var(--fa-animation-delay, 0); + animation-delay: var(--fa-animation-delay, 0); + -webkit-animation-direction: var(--fa-animation-direction, normal); + animation-direction: var(--fa-animation-direction, normal); + -webkit-animation-duration: var(--fa-animation-duration, 1s); + animation-duration: var(--fa-animation-duration, 1s); + -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite); + animation-iteration-count: var(--fa-animation-iteration-count, infinite); + -webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out); + animation-timing-function: var(--fa-animation-timing, ease-in-out); } + +.fa-spin { + -webkit-animation-name: fa-spin; + animation-name: fa-spin; + -webkit-animation-delay: var(--fa-animation-delay, 0); + animation-delay: var(--fa-animation-delay, 0); + -webkit-animation-direction: var(--fa-animation-direction, normal); + animation-direction: var(--fa-animation-direction, normal); + -webkit-animation-duration: var(--fa-animation-duration, 2s); + animation-duration: var(--fa-animation-duration, 2s); + -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite); + animation-iteration-count: var(--fa-animation-iteration-count, infinite); + -webkit-animation-timing-function: var(--fa-animation-timing, linear); + animation-timing-function: var(--fa-animation-timing, linear); } + +.fa-spin-reverse { + --fa-animation-direction: reverse; } + +.fa-pulse, +.fa-spin-pulse { + -webkit-animation-name: fa-spin; + animation-name: fa-spin; + -webkit-animation-direction: var(--fa-animation-direction, normal); + animation-direction: var(--fa-animation-direction, normal); + -webkit-animation-duration: var(--fa-animation-duration, 1s); + animation-duration: var(--fa-animation-duration, 1s); + -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite); + animation-iteration-count: var(--fa-animation-iteration-count, infinite); + -webkit-animation-timing-function: var(--fa-animation-timing, steps(8)); + animation-timing-function: var(--fa-animation-timing, steps(8)); } + +@media (prefers-reduced-motion: reduce) { + .fa-beat, + .fa-fade, + .fa-beat-fade, + .fa-flip, + .fa-pulse, + .fa-spin, + .fa-spin-pulse { + -webkit-animation-delay: -1ms; + animation-delay: -1ms; + -webkit-animation-duration: 1ms; + animation-duration: 1ms; + -webkit-animation-iteration-count: 1; + animation-iteration-count: 1; + -webkit-transition-delay: 0s; + transition-delay: 0s; + -webkit-transition-duration: 0s; + transition-duration: 0s; } } + +@-webkit-keyframes fa-beat { + 0%, 90% { + -webkit-transform: scale(1); + transform: scale(1); } + 45% { + -webkit-transform: scale(var(--fa-beat-scale, 1.25)); + transform: scale(var(--fa-beat-scale, 1.25)); } } + +@keyframes fa-beat { + 0%, 90% { + -webkit-transform: scale(1); + transform: scale(1); } + 45% { + -webkit-transform: scale(var(--fa-beat-scale, 1.25)); + transform: scale(var(--fa-beat-scale, 1.25)); } } + +@-webkit-keyframes fa-fade { + 50% { + opacity: var(--fa-fade-opacity, 0.4); } } + +@keyframes fa-fade { + 50% { + opacity: var(--fa-fade-opacity, 0.4); } } + +@-webkit-keyframes fa-beat-fade { + 0%, 100% { + opacity: var(--fa-beat-fade-opacity, 0.4); + -webkit-transform: scale(1); + transform: scale(1); } + 50% { + opacity: 1; + -webkit-transform: scale(var(--fa-beat-fade-scale, 1.125)); + transform: scale(var(--fa-beat-fade-scale, 1.125)); } } + +@keyframes fa-beat-fade { + 0%, 100% { + opacity: var(--fa-beat-fade-opacity, 0.4); + -webkit-transform: scale(1); + transform: scale(1); } + 50% { + opacity: 1; + -webkit-transform: scale(var(--fa-beat-fade-scale, 1.125)); + transform: scale(var(--fa-beat-fade-scale, 1.125)); } } + +@-webkit-keyframes fa-flip { + 50% { + -webkit-transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); + transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); } } + +@keyframes fa-flip { + 50% { + -webkit-transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); + transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); } } + +@-webkit-keyframes fa-spin { + 0% { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); } + 100% { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); } } + +@keyframes fa-spin { + 0% { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); } + 100% { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); } } + +.fa-rotate-90 { + -webkit-transform: rotate(90deg); + transform: rotate(90deg); } + +.fa-rotate-180 { + -webkit-transform: rotate(180deg); + transform: rotate(180deg); } + +.fa-rotate-270 { + -webkit-transform: rotate(270deg); + transform: rotate(270deg); } + +.fa-flip-horizontal { + -webkit-transform: scale(-1, 1); + transform: scale(-1, 1); } + +.fa-flip-vertical { + -webkit-transform: scale(1, -1); + transform: scale(1, -1); } + +.fa-flip-both, +.fa-flip-horizontal.fa-flip-vertical { + -webkit-transform: scale(-1, -1); + transform: scale(-1, -1); } + +.fa-rotate-by { + -webkit-transform: rotate(var(--fa-rotate-angle, none)); + transform: rotate(var(--fa-rotate-angle, none)); } + +.fa-stack { + display: inline-block; + height: 2em; + line-height: 2em; + position: relative; + vertical-align: middle; + width: 2.5em; } + +.fa-stack-1x, +.fa-stack-2x { + left: 0; + position: absolute; + text-align: center; + width: 100%; + z-index: var(--fa-stack-z-index, auto); } + +.fa-stack-1x { + line-height: inherit; } + +.fa-stack-2x { + font-size: 2em; } + +.fa-inverse { + color: var(--fa-inverse, #fff); } + +/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen +readers do not read off random characters that represent icons */ +.fa-0::before { + content: "\30"; } + +.fa-1::before { + content: "\31"; } + +.fa-2::before { + content: "\32"; } + +.fa-3::before { + content: "\33"; } + +.fa-4::before { + content: "\34"; } + +.fa-5::before { + content: "\35"; } + +.fa-6::before { + content: "\36"; } + +.fa-7::before { + content: "\37"; } + +.fa-8::before { + content: "\38"; } + +.fa-9::before { + content: "\39"; } + +.fa-a::before { + content: "\41"; } + +.fa-address-book::before { + content: "\f2b9"; } + +.fa-contact-book::before { + content: "\f2b9"; } + +.fa-address-card::before { + content: "\f2bb"; } + +.fa-contact-card::before { + content: "\f2bb"; } + +.fa-vcard::before { + content: "\f2bb"; } + +.fa-align-center::before { + content: "\f037"; } + +.fa-align-justify::before { + content: "\f039"; } + +.fa-align-left::before { + content: "\f036"; } + +.fa-align-right::before { + content: "\f038"; } + +.fa-anchor::before { + content: "\f13d"; } + +.fa-angle-down::before { + content: "\f107"; } + +.fa-angle-left::before { + content: "\f104"; } + +.fa-angle-right::before { + content: "\f105"; } + +.fa-angle-up::before { + content: "\f106"; } + +.fa-angles-down::before { + content: "\f103"; } + +.fa-angle-double-down::before { + content: "\f103"; } + +.fa-angles-left::before { + content: "\f100"; } + +.fa-angle-double-left::before { + content: "\f100"; } + +.fa-angles-right::before { + content: "\f101"; } + +.fa-angle-double-right::before { + content: "\f101"; } + +.fa-angles-up::before { + content: "\f102"; } + +.fa-angle-double-up::before { + content: "\f102"; } + +.fa-ankh::before { + content: "\f644"; } + +.fa-apple-whole::before { + content: "\f5d1"; } + +.fa-apple-alt::before { + content: "\f5d1"; } + +.fa-archway::before { + content: "\f557"; } + +.fa-arrow-down::before { + content: "\f063"; } + +.fa-arrow-down-1-9::before { + content: "\f162"; } + +.fa-sort-numeric-asc::before { + content: "\f162"; } + +.fa-sort-numeric-down::before { + content: "\f162"; } + +.fa-arrow-down-9-1::before { + content: "\f886"; } + +.fa-sort-numeric-desc::before { + content: "\f886"; } + +.fa-sort-numeric-down-alt::before { + content: "\f886"; } + +.fa-arrow-down-a-z::before { + content: "\f15d"; } + +.fa-sort-alpha-asc::before { + content: "\f15d"; } + +.fa-sort-alpha-down::before { + content: "\f15d"; } + +.fa-arrow-down-long::before { + content: "\f175"; } + +.fa-long-arrow-down::before { + content: "\f175"; } + +.fa-arrow-down-short-wide::before { + content: "\f884"; } + +.fa-sort-amount-desc::before { + content: "\f884"; } + +.fa-sort-amount-down-alt::before { + content: "\f884"; } + +.fa-arrow-down-wide-short::before { + content: "\f160"; } + +.fa-sort-amount-asc::before { + content: "\f160"; } + +.fa-sort-amount-down::before { + content: "\f160"; } + +.fa-arrow-down-z-a::before { + content: "\f881"; } + +.fa-sort-alpha-desc::before { + content: "\f881"; } + +.fa-sort-alpha-down-alt::before { + content: "\f881"; } + +.fa-arrow-left::before { + content: "\f060"; } + +.fa-arrow-left-long::before { + content: "\f177"; } + +.fa-long-arrow-left::before { + content: "\f177"; } + +.fa-arrow-pointer::before { + content: "\f245"; } + +.fa-mouse-pointer::before { + content: "\f245"; } + +.fa-arrow-right::before { + content: "\f061"; } + +.fa-arrow-right-arrow-left::before { + content: "\f0ec"; } + +.fa-exchange::before { + content: "\f0ec"; } + +.fa-arrow-right-from-bracket::before { + content: "\f08b"; } + +.fa-sign-out::before { + content: "\f08b"; } + +.fa-arrow-right-long::before { + content: "\f178"; } + +.fa-long-arrow-right::before { + content: "\f178"; } + +.fa-arrow-right-to-bracket::before { + content: "\f090"; } + +.fa-sign-in::before { + content: "\f090"; } + +.fa-arrow-rotate-left::before { + content: "\f0e2"; } + +.fa-arrow-left-rotate::before { + content: "\f0e2"; } + +.fa-arrow-rotate-back::before { + content: "\f0e2"; } + +.fa-arrow-rotate-backward::before { + content: "\f0e2"; } + +.fa-undo::before { + content: "\f0e2"; } + +.fa-arrow-rotate-right::before { + content: "\f01e"; } + +.fa-arrow-right-rotate::before { + content: "\f01e"; } + +.fa-arrow-rotate-forward::before { + content: "\f01e"; } + +.fa-redo::before { + content: "\f01e"; } + +.fa-arrow-trend-down::before { + content: "\e097"; } + +.fa-arrow-trend-up::before { + content: "\e098"; } + +.fa-arrow-turn-down::before { + content: "\f149"; } + +.fa-level-down::before { + content: "\f149"; } + +.fa-arrow-turn-up::before { + content: "\f148"; } + +.fa-level-up::before { + content: "\f148"; } + +.fa-arrow-up::before { + content: "\f062"; } + +.fa-arrow-up-1-9::before { + content: "\f163"; } + +.fa-sort-numeric-up::before { + content: "\f163"; } + +.fa-arrow-up-9-1::before { + content: "\f887"; } + +.fa-sort-numeric-up-alt::before { + content: "\f887"; } + +.fa-arrow-up-a-z::before { + content: "\f15e"; } + +.fa-sort-alpha-up::before { + content: "\f15e"; } + +.fa-arrow-up-from-bracket::before { + content: "\e09a"; } + +.fa-arrow-up-long::before { + content: "\f176"; } + +.fa-long-arrow-up::before { + content: "\f176"; } + +.fa-arrow-up-right-from-square::before { + content: "\f08e"; } + +.fa-external-link::before { + content: "\f08e"; } + +.fa-arrow-up-short-wide::before { + content: "\f885"; } + +.fa-sort-amount-up-alt::before { + content: "\f885"; } + +.fa-arrow-up-wide-short::before { + content: "\f161"; } + +.fa-sort-amount-up::before { + content: "\f161"; } + +.fa-arrow-up-z-a::before { + content: "\f882"; } + +.fa-sort-alpha-up-alt::before { + content: "\f882"; } + +.fa-arrows-left-right::before { + content: "\f07e"; } + +.fa-arrows-h::before { + content: "\f07e"; } + +.fa-arrows-rotate::before { + content: "\f021"; } + +.fa-refresh::before { + content: "\f021"; } + +.fa-sync::before { + content: "\f021"; } + +.fa-arrows-up-down::before { + content: "\f07d"; } + +.fa-arrows-v::before { + content: "\f07d"; } + +.fa-arrows-up-down-left-right::before { + content: "\f047"; } + +.fa-arrows::before { + content: "\f047"; } + +.fa-asterisk::before { + content: "\2a"; } + +.fa-at::before { + content: "\40"; } + +.fa-atom::before { + content: "\f5d2"; } + +.fa-audio-description::before { + content: "\f29e"; } + +.fa-austral-sign::before { + content: "\e0a9"; } + +.fa-award::before { + content: "\f559"; } + +.fa-b::before { + content: "\42"; } + +.fa-baby::before { + content: "\f77c"; } + +.fa-baby-carriage::before { + content: "\f77d"; } + +.fa-carriage-baby::before { + content: "\f77d"; } + +.fa-backward::before { + content: "\f04a"; } + +.fa-backward-fast::before { + content: "\f049"; } + +.fa-fast-backward::before { + content: "\f049"; } + +.fa-backward-step::before { + content: "\f048"; } + +.fa-step-backward::before { + content: "\f048"; } + +.fa-bacon::before { + content: "\f7e5"; } + +.fa-bacteria::before { + content: "\e059"; } + +.fa-bacterium::before { + content: "\e05a"; } + +.fa-bag-shopping::before { + content: "\f290"; } + +.fa-shopping-bag::before { + content: "\f290"; } + +.fa-bahai::before { + content: "\f666"; } + +.fa-baht-sign::before { + content: "\e0ac"; } + +.fa-ban::before { + content: "\f05e"; } + +.fa-cancel::before { + content: "\f05e"; } + +.fa-ban-smoking::before { + content: "\f54d"; } + +.fa-smoking-ban::before { + content: "\f54d"; } + +.fa-bandage::before { + content: "\f462"; } + +.fa-band-aid::before { + content: "\f462"; } + +.fa-bank::before { + content: "\f19c"; } + +.fa-institution::before { + content: "\f19c"; } + +.fa-university::before { + content: "\f19c"; } + +.fa-barcode::before { + content: "\f02a"; } + +.fa-bars::before { + content: "\f0c9"; } + +.fa-navicon::before { + content: "\f0c9"; } + +.fa-bars-progress::before { + content: "\f828"; } + +.fa-tasks-alt::before { + content: "\f828"; } + +.fa-bars-staggered::before { + content: "\f550"; } + +.fa-reorder::before { + content: "\f550"; } + +.fa-stream::before { + content: "\f550"; } + +.fa-baseball::before { + content: "\f433"; } + +.fa-baseball-ball::before { + content: "\f433"; } + +.fa-basket-shopping::before { + content: "\f291"; } + +.fa-shopping-basket::before { + content: "\f291"; } + +.fa-basketball::before { + content: "\f434"; } + +.fa-basketball-ball::before { + content: "\f434"; } + +.fa-bath::before { + content: "\f2cd"; } + +.fa-bathtub::before { + content: "\f2cd"; } + +.fa-battery-empty::before { + content: "\f244"; } + +.fa-battery-0::before { + content: "\f244"; } + +.fa-battery-full::before { + content: "\f240"; } + +.fa-battery::before { + content: "\f240"; } + +.fa-battery-5::before { + content: "\f240"; } + +.fa-battery-half::before { + content: "\f242"; } + +.fa-battery-3::before { + content: "\f242"; } + +.fa-battery-quarter::before { + content: "\f243"; } + +.fa-battery-2::before { + content: "\f243"; } + +.fa-battery-three-quarters::before { + content: "\f241"; } + +.fa-battery-4::before { + content: "\f241"; } + +.fa-bed::before { + content: "\f236"; } + +.fa-bed-pulse::before { + content: "\f487"; } + +.fa-procedures::before { + content: "\f487"; } + +.fa-beer-mug-empty::before { + content: "\f0fc"; } + +.fa-beer::before { + content: "\f0fc"; } + +.fa-bell::before { + content: "\f0f3"; } + +.fa-bell-concierge::before { + content: "\f562"; } + +.fa-concierge-bell::before { + content: "\f562"; } + +.fa-bell-slash::before { + content: "\f1f6"; } + +.fa-bezier-curve::before { + content: "\f55b"; } + +.fa-bicycle::before { + content: "\f206"; } + +.fa-binoculars::before { + content: "\f1e5"; } + +.fa-biohazard::before { + content: "\f780"; } + +.fa-bitcoin-sign::before { + content: "\e0b4"; } + +.fa-blender::before { + content: "\f517"; } + +.fa-blender-phone::before { + content: "\f6b6"; } + +.fa-blog::before { + content: "\f781"; } + +.fa-bold::before { + content: "\f032"; } + +.fa-bolt::before { + content: "\f0e7"; } + +.fa-zap::before { + content: "\f0e7"; } + +.fa-bomb::before { + content: "\f1e2"; } + +.fa-bone::before { + content: "\f5d7"; } + +.fa-bong::before { + content: "\f55c"; } + +.fa-book::before { + content: "\f02d"; } + +.fa-book-atlas::before { + content: "\f558"; } + +.fa-atlas::before { + content: "\f558"; } + +.fa-book-bible::before { + content: "\f647"; } + +.fa-bible::before { + content: "\f647"; } + +.fa-book-journal-whills::before { + content: "\f66a"; } + +.fa-journal-whills::before { + content: "\f66a"; } + +.fa-book-medical::before { + content: "\f7e6"; } + +.fa-book-open::before { + content: "\f518"; } + +.fa-book-open-reader::before { + content: "\f5da"; } + +.fa-book-reader::before { + content: "\f5da"; } + +.fa-book-quran::before { + content: "\f687"; } + +.fa-quran::before { + content: "\f687"; } + +.fa-book-skull::before { + content: "\f6b7"; } + +.fa-book-dead::before { + content: "\f6b7"; } + +.fa-bookmark::before { + content: "\f02e"; } + +.fa-border-all::before { + content: "\f84c"; } + +.fa-border-none::before { + content: "\f850"; } + +.fa-border-top-left::before { + content: "\f853"; } + +.fa-border-style::before { + content: "\f853"; } + +.fa-bowling-ball::before { + content: "\f436"; } + +.fa-box::before { + content: "\f466"; } + +.fa-box-archive::before { + content: "\f187"; } + +.fa-archive::before { + content: "\f187"; } + +.fa-box-open::before { + content: "\f49e"; } + +.fa-box-tissue::before { + content: "\e05b"; } + +.fa-boxes-stacked::before { + content: "\f468"; } + +.fa-boxes::before { + content: "\f468"; } + +.fa-boxes-alt::before { + content: "\f468"; } + +.fa-braille::before { + content: "\f2a1"; } + +.fa-brain::before { + content: "\f5dc"; } + +.fa-brazilian-real-sign::before { + content: "\e46c"; } + +.fa-bread-slice::before { + content: "\f7ec"; } + +.fa-briefcase::before { + content: "\f0b1"; } + +.fa-briefcase-medical::before { + content: "\f469"; } + +.fa-broom::before { + content: "\f51a"; } + +.fa-broom-ball::before { + content: "\f458"; } + +.fa-quidditch::before { + content: "\f458"; } + +.fa-quidditch-broom-ball::before { + content: "\f458"; } + +.fa-brush::before { + content: "\f55d"; } + +.fa-bug::before { + content: "\f188"; } + +.fa-building::before { + content: "\f1ad"; } + +.fa-bullhorn::before { + content: "\f0a1"; } + +.fa-bullseye::before { + content: "\f140"; } + +.fa-burger::before { + content: "\f805"; } + +.fa-hamburger::before { + content: "\f805"; } + +.fa-bus::before { + content: "\f207"; } + +.fa-bus-simple::before { + content: "\f55e"; } + +.fa-bus-alt::before { + content: "\f55e"; } + +.fa-business-time::before { + content: "\f64a"; } + +.fa-briefcase-clock::before { + content: "\f64a"; } + +.fa-c::before { + content: "\43"; } + +.fa-cake-candles::before { + content: "\f1fd"; } + +.fa-birthday-cake::before { + content: "\f1fd"; } + +.fa-cake::before { + content: "\f1fd"; } + +.fa-calculator::before { + content: "\f1ec"; } + +.fa-calendar::before { + content: "\f133"; } + +.fa-calendar-check::before { + content: "\f274"; } + +.fa-calendar-day::before { + content: "\f783"; } + +.fa-calendar-days::before { + content: "\f073"; } + +.fa-calendar-alt::before { + content: "\f073"; } + +.fa-calendar-minus::before { + content: "\f272"; } + +.fa-calendar-plus::before { + content: "\f271"; } + +.fa-calendar-week::before { + content: "\f784"; } + +.fa-calendar-xmark::before { + content: "\f273"; } + +.fa-calendar-times::before { + content: "\f273"; } + +.fa-camera::before { + content: "\f030"; } + +.fa-camera-alt::before { + content: "\f030"; } + +.fa-camera-retro::before { + content: "\f083"; } + +.fa-camera-rotate::before { + content: "\e0d8"; } + +.fa-campground::before { + content: "\f6bb"; } + +.fa-candy-cane::before { + content: "\f786"; } + +.fa-cannabis::before { + content: "\f55f"; } + +.fa-capsules::before { + content: "\f46b"; } + +.fa-car::before { + content: "\f1b9"; } + +.fa-automobile::before { + content: "\f1b9"; } + +.fa-car-battery::before { + content: "\f5df"; } + +.fa-battery-car::before { + content: "\f5df"; } + +.fa-car-crash::before { + content: "\f5e1"; } + +.fa-car-rear::before { + content: "\f5de"; } + +.fa-car-alt::before { + content: "\f5de"; } + +.fa-car-side::before { + content: "\f5e4"; } + +.fa-caravan::before { + content: "\f8ff"; } + +.fa-caret-down::before { + content: "\f0d7"; } + +.fa-caret-left::before { + content: "\f0d9"; } + +.fa-caret-right::before { + content: "\f0da"; } + +.fa-caret-up::before { + content: "\f0d8"; } + +.fa-carrot::before { + content: "\f787"; } + +.fa-cart-arrow-down::before { + content: "\f218"; } + +.fa-cart-flatbed::before { + content: "\f474"; } + +.fa-dolly-flatbed::before { + content: "\f474"; } + +.fa-cart-flatbed-suitcase::before { + content: "\f59d"; } + +.fa-luggage-cart::before { + content: "\f59d"; } + +.fa-cart-plus::before { + content: "\f217"; } + +.fa-cart-shopping::before { + content: "\f07a"; } + +.fa-shopping-cart::before { + content: "\f07a"; } + +.fa-cash-register::before { + content: "\f788"; } + +.fa-cat::before { + content: "\f6be"; } + +.fa-cedi-sign::before { + content: "\e0df"; } + +.fa-cent-sign::before { + content: "\e3f5"; } + +.fa-certificate::before { + content: "\f0a3"; } + +.fa-chair::before { + content: "\f6c0"; } + +.fa-chalkboard::before { + content: "\f51b"; } + +.fa-blackboard::before { + content: "\f51b"; } + +.fa-chalkboard-user::before { + content: "\f51c"; } + +.fa-chalkboard-teacher::before { + content: "\f51c"; } + +.fa-champagne-glasses::before { + content: "\f79f"; } + +.fa-glass-cheers::before { + content: "\f79f"; } + +.fa-charging-station::before { + content: "\f5e7"; } + +.fa-chart-area::before { + content: "\f1fe"; } + +.fa-area-chart::before { + content: "\f1fe"; } + +.fa-chart-bar::before { + content: "\f080"; } + +.fa-bar-chart::before { + content: "\f080"; } + +.fa-chart-column::before { + content: "\e0e3"; } + +.fa-chart-gantt::before { + content: "\e0e4"; } + +.fa-chart-line::before { + content: "\f201"; } + +.fa-line-chart::before { + content: "\f201"; } + +.fa-chart-pie::before { + content: "\f200"; } + +.fa-pie-chart::before { + content: "\f200"; } + +.fa-check::before { + content: "\f00c"; } + +.fa-check-double::before { + content: "\f560"; } + +.fa-check-to-slot::before { + content: "\f772"; } + +.fa-vote-yea::before { + content: "\f772"; } + +.fa-cheese::before { + content: "\f7ef"; } + +.fa-chess::before { + content: "\f439"; } + +.fa-chess-bishop::before { + content: "\f43a"; } + +.fa-chess-board::before { + content: "\f43c"; } + +.fa-chess-king::before { + content: "\f43f"; } + +.fa-chess-knight::before { + content: "\f441"; } + +.fa-chess-pawn::before { + content: "\f443"; } + +.fa-chess-queen::before { + content: "\f445"; } + +.fa-chess-rook::before { + content: "\f447"; } + +.fa-chevron-down::before { + content: "\f078"; } + +.fa-chevron-left::before { + content: "\f053"; } + +.fa-chevron-right::before { + content: "\f054"; } + +.fa-chevron-up::before { + content: "\f077"; } + +.fa-child::before { + content: "\f1ae"; } + +.fa-church::before { + content: "\f51d"; } + +.fa-circle::before { + content: "\f111"; } + +.fa-circle-arrow-down::before { + content: "\f0ab"; } + +.fa-arrow-circle-down::before { + content: "\f0ab"; } + +.fa-circle-arrow-left::before { + content: "\f0a8"; } + +.fa-arrow-circle-left::before { + content: "\f0a8"; } + +.fa-circle-arrow-right::before { + content: "\f0a9"; } + +.fa-arrow-circle-right::before { + content: "\f0a9"; } + +.fa-circle-arrow-up::before { + content: "\f0aa"; } + +.fa-arrow-circle-up::before { + content: "\f0aa"; } + +.fa-circle-check::before { + content: "\f058"; } + +.fa-check-circle::before { + content: "\f058"; } + +.fa-circle-chevron-down::before { + content: "\f13a"; } + +.fa-chevron-circle-down::before { + content: "\f13a"; } + +.fa-circle-chevron-left::before { + content: "\f137"; } + +.fa-chevron-circle-left::before { + content: "\f137"; } + +.fa-circle-chevron-right::before { + content: "\f138"; } + +.fa-chevron-circle-right::before { + content: "\f138"; } + +.fa-circle-chevron-up::before { + content: "\f139"; } + +.fa-chevron-circle-up::before { + content: "\f139"; } + +.fa-circle-dollar-to-slot::before { + content: "\f4b9"; } + +.fa-donate::before { + content: "\f4b9"; } + +.fa-circle-dot::before { + content: "\f192"; } + +.fa-dot-circle::before { + content: "\f192"; } + +.fa-circle-down::before { + content: "\f358"; } + +.fa-arrow-alt-circle-down::before { + content: "\f358"; } + +.fa-circle-exclamation::before { + content: "\f06a"; } + +.fa-exclamation-circle::before { + content: "\f06a"; } + +.fa-circle-h::before { + content: "\f47e"; } + +.fa-hospital-symbol::before { + content: "\f47e"; } + +.fa-circle-half-stroke::before { + content: "\f042"; } + +.fa-adjust::before { + content: "\f042"; } + +.fa-circle-info::before { + content: "\f05a"; } + +.fa-info-circle::before { + content: "\f05a"; } + +.fa-circle-left::before { + content: "\f359"; } + +.fa-arrow-alt-circle-left::before { + content: "\f359"; } + +.fa-circle-minus::before { + content: "\f056"; } + +.fa-minus-circle::before { + content: "\f056"; } + +.fa-circle-notch::before { + content: "\f1ce"; } + +.fa-circle-pause::before { + content: "\f28b"; } + +.fa-pause-circle::before { + content: "\f28b"; } + +.fa-circle-play::before { + content: "\f144"; } + +.fa-play-circle::before { + content: "\f144"; } + +.fa-circle-plus::before { + content: "\f055"; } + +.fa-plus-circle::before { + content: "\f055"; } + +.fa-circle-question::before { + content: "\f059"; } + +.fa-question-circle::before { + content: "\f059"; } + +.fa-circle-radiation::before { + content: "\f7ba"; } + +.fa-radiation-alt::before { + content: "\f7ba"; } + +.fa-circle-right::before { + content: "\f35a"; } + +.fa-arrow-alt-circle-right::before { + content: "\f35a"; } + +.fa-circle-stop::before { + content: "\f28d"; } + +.fa-stop-circle::before { + content: "\f28d"; } + +.fa-circle-up::before { + content: "\f35b"; } + +.fa-arrow-alt-circle-up::before { + content: "\f35b"; } + +.fa-circle-user::before { + content: "\f2bd"; } + +.fa-user-circle::before { + content: "\f2bd"; } + +.fa-circle-xmark::before { + content: "\f057"; } + +.fa-times-circle::before { + content: "\f057"; } + +.fa-xmark-circle::before { + content: "\f057"; } + +.fa-city::before { + content: "\f64f"; } + +.fa-clapperboard::before { + content: "\e131"; } + +.fa-clipboard::before { + content: "\f328"; } + +.fa-clipboard-check::before { + content: "\f46c"; } + +.fa-clipboard-list::before { + content: "\f46d"; } + +.fa-clock::before { + content: "\f017"; } + +.fa-clock-four::before { + content: "\f017"; } + +.fa-clock-rotate-left::before { + content: "\f1da"; } + +.fa-history::before { + content: "\f1da"; } + +.fa-clone::before { + content: "\f24d"; } + +.fa-closed-captioning::before { + content: "\f20a"; } + +.fa-cloud::before { + content: "\f0c2"; } + +.fa-cloud-arrow-down::before { + content: "\f0ed"; } + +.fa-cloud-download::before { + content: "\f0ed"; } + +.fa-cloud-download-alt::before { + content: "\f0ed"; } + +.fa-cloud-arrow-up::before { + content: "\f0ee"; } + +.fa-cloud-upload::before { + content: "\f0ee"; } + +.fa-cloud-upload-alt::before { + content: "\f0ee"; } + +.fa-cloud-meatball::before { + content: "\f73b"; } + +.fa-cloud-moon::before { + content: "\f6c3"; } + +.fa-cloud-moon-rain::before { + content: "\f73c"; } + +.fa-cloud-rain::before { + content: "\f73d"; } + +.fa-cloud-showers-heavy::before { + content: "\f740"; } + +.fa-cloud-sun::before { + content: "\f6c4"; } + +.fa-cloud-sun-rain::before { + content: "\f743"; } + +.fa-clover::before { + content: "\e139"; } + +.fa-code::before { + content: "\f121"; } + +.fa-code-branch::before { + content: "\f126"; } + +.fa-code-commit::before { + content: "\f386"; } + +.fa-code-compare::before { + content: "\e13a"; } + +.fa-code-fork::before { + content: "\e13b"; } + +.fa-code-merge::before { + content: "\f387"; } + +.fa-code-pull-request::before { + content: "\e13c"; } + +.fa-coins::before { + content: "\f51e"; } + +.fa-colon-sign::before { + content: "\e140"; } + +.fa-comment::before { + content: "\f075"; } + +.fa-comment-dollar::before { + content: "\f651"; } + +.fa-comment-dots::before { + content: "\f4ad"; } + +.fa-commenting::before { + content: "\f4ad"; } + +.fa-comment-medical::before { + content: "\f7f5"; } + +.fa-comment-slash::before { + content: "\f4b3"; } + +.fa-comment-sms::before { + content: "\f7cd"; } + +.fa-sms::before { + content: "\f7cd"; } + +.fa-comments::before { + content: "\f086"; } + +.fa-comments-dollar::before { + content: "\f653"; } + +.fa-compact-disc::before { + content: "\f51f"; } + +.fa-compass::before { + content: "\f14e"; } + +.fa-compass-drafting::before { + content: "\f568"; } + +.fa-drafting-compass::before { + content: "\f568"; } + +.fa-compress::before { + content: "\f066"; } + +.fa-computer-mouse::before { + content: "\f8cc"; } + +.fa-mouse::before { + content: "\f8cc"; } + +.fa-cookie::before { + content: "\f563"; } + +.fa-cookie-bite::before { + content: "\f564"; } + +.fa-copy::before { + content: "\f0c5"; } + +.fa-copyright::before { + content: "\f1f9"; } + +.fa-couch::before { + content: "\f4b8"; } + +.fa-credit-card::before { + content: "\f09d"; } + +.fa-credit-card-alt::before { + content: "\f09d"; } + +.fa-crop::before { + content: "\f125"; } + +.fa-crop-simple::before { + content: "\f565"; } + +.fa-crop-alt::before { + content: "\f565"; } + +.fa-cross::before { + content: "\f654"; } + +.fa-crosshairs::before { + content: "\f05b"; } + +.fa-crow::before { + content: "\f520"; } + +.fa-crown::before { + content: "\f521"; } + +.fa-crutch::before { + content: "\f7f7"; } + +.fa-cruzeiro-sign::before { + content: "\e152"; } + +.fa-cube::before { + content: "\f1b2"; } + +.fa-cubes::before { + content: "\f1b3"; } + +.fa-d::before { + content: "\44"; } + +.fa-database::before { + content: "\f1c0"; } + +.fa-delete-left::before { + content: "\f55a"; } + +.fa-backspace::before { + content: "\f55a"; } + +.fa-democrat::before { + content: "\f747"; } + +.fa-desktop::before { + content: "\f390"; } + +.fa-desktop-alt::before { + content: "\f390"; } + +.fa-dharmachakra::before { + content: "\f655"; } + +.fa-diagram-project::before { + content: "\f542"; } + +.fa-project-diagram::before { + content: "\f542"; } + +.fa-diamond::before { + content: "\f219"; } + +.fa-diamond-turn-right::before { + content: "\f5eb"; } + +.fa-directions::before { + content: "\f5eb"; } + +.fa-dice::before { + content: "\f522"; } + +.fa-dice-d20::before { + content: "\f6cf"; } + +.fa-dice-d6::before { + content: "\f6d1"; } + +.fa-dice-five::before { + content: "\f523"; } + +.fa-dice-four::before { + content: "\f524"; } + +.fa-dice-one::before { + content: "\f525"; } + +.fa-dice-six::before { + content: "\f526"; } + +.fa-dice-three::before { + content: "\f527"; } + +.fa-dice-two::before { + content: "\f528"; } + +.fa-disease::before { + content: "\f7fa"; } + +.fa-divide::before { + content: "\f529"; } + +.fa-dna::before { + content: "\f471"; } + +.fa-dog::before { + content: "\f6d3"; } + +.fa-dollar-sign::before { + content: "\24"; } + +.fa-dollar::before { + content: "\24"; } + +.fa-usd::before { + content: "\24"; } + +.fa-dolly::before { + content: "\f472"; } + +.fa-dolly-box::before { + content: "\f472"; } + +.fa-dong-sign::before { + content: "\e169"; } + +.fa-door-closed::before { + content: "\f52a"; } + +.fa-door-open::before { + content: "\f52b"; } + +.fa-dove::before { + content: "\f4ba"; } + +.fa-down-left-and-up-right-to-center::before { + content: "\f422"; } + +.fa-compress-alt::before { + content: "\f422"; } + +.fa-down-long::before { + content: "\f309"; } + +.fa-long-arrow-alt-down::before { + content: "\f309"; } + +.fa-download::before { + content: "\f019"; } + +.fa-dragon::before { + content: "\f6d5"; } + +.fa-draw-polygon::before { + content: "\f5ee"; } + +.fa-droplet::before { + content: "\f043"; } + +.fa-tint::before { + content: "\f043"; } + +.fa-droplet-slash::before { + content: "\f5c7"; } + +.fa-tint-slash::before { + content: "\f5c7"; } + +.fa-drum::before { + content: "\f569"; } + +.fa-drum-steelpan::before { + content: "\f56a"; } + +.fa-drumstick-bite::before { + content: "\f6d7"; } + +.fa-dumbbell::before { + content: "\f44b"; } + +.fa-dumpster::before { + content: "\f793"; } + +.fa-dumpster-fire::before { + content: "\f794"; } + +.fa-dungeon::before { + content: "\f6d9"; } + +.fa-e::before { + content: "\45"; } + +.fa-ear-deaf::before { + content: "\f2a4"; } + +.fa-deaf::before { + content: "\f2a4"; } + +.fa-deafness::before { + content: "\f2a4"; } + +.fa-hard-of-hearing::before { + content: "\f2a4"; } + +.fa-ear-listen::before { + content: "\f2a2"; } + +.fa-assistive-listening-systems::before { + content: "\f2a2"; } + +.fa-earth-africa::before { + content: "\f57c"; } + +.fa-globe-africa::before { + content: "\f57c"; } + +.fa-earth-americas::before { + content: "\f57d"; } + +.fa-earth::before { + content: "\f57d"; } + +.fa-earth-america::before { + content: "\f57d"; } + +.fa-globe-americas::before { + content: "\f57d"; } + +.fa-earth-asia::before { + content: "\f57e"; } + +.fa-globe-asia::before { + content: "\f57e"; } + +.fa-earth-europe::before { + content: "\f7a2"; } + +.fa-globe-europe::before { + content: "\f7a2"; } + +.fa-earth-oceania::before { + content: "\e47b"; } + +.fa-globe-oceania::before { + content: "\e47b"; } + +.fa-egg::before { + content: "\f7fb"; } + +.fa-eject::before { + content: "\f052"; } + +.fa-elevator::before { + content: "\e16d"; } + +.fa-ellipsis::before { + content: "\f141"; } + +.fa-ellipsis-h::before { + content: "\f141"; } + +.fa-ellipsis-vertical::before { + content: "\f142"; } + +.fa-ellipsis-v::before { + content: "\f142"; } + +.fa-envelope::before { + content: "\f0e0"; } + +.fa-envelope-open::before { + content: "\f2b6"; } + +.fa-envelope-open-text::before { + content: "\f658"; } + +.fa-envelopes-bulk::before { + content: "\f674"; } + +.fa-mail-bulk::before { + content: "\f674"; } + +.fa-equals::before { + content: "\3d"; } + +.fa-eraser::before { + content: "\f12d"; } + +.fa-ethernet::before { + content: "\f796"; } + +.fa-euro-sign::before { + content: "\f153"; } + +.fa-eur::before { + content: "\f153"; } + +.fa-euro::before { + content: "\f153"; } + +.fa-exclamation::before { + content: "\21"; } + +.fa-expand::before { + content: "\f065"; } + +.fa-eye::before { + content: "\f06e"; } + +.fa-eye-dropper::before { + content: "\f1fb"; } + +.fa-eye-dropper-empty::before { + content: "\f1fb"; } + +.fa-eyedropper::before { + content: "\f1fb"; } + +.fa-eye-low-vision::before { + content: "\f2a8"; } + +.fa-low-vision::before { + content: "\f2a8"; } + +.fa-eye-slash::before { + content: "\f070"; } + +.fa-f::before { + content: "\46"; } + +.fa-face-angry::before { + content: "\f556"; } + +.fa-angry::before { + content: "\f556"; } + +.fa-face-dizzy::before { + content: "\f567"; } + +.fa-dizzy::before { + content: "\f567"; } + +.fa-face-flushed::before { + content: "\f579"; } + +.fa-flushed::before { + content: "\f579"; } + +.fa-face-frown::before { + content: "\f119"; } + +.fa-frown::before { + content: "\f119"; } + +.fa-face-frown-open::before { + content: "\f57a"; } + +.fa-frown-open::before { + content: "\f57a"; } + +.fa-face-grimace::before { + content: "\f57f"; } + +.fa-grimace::before { + content: "\f57f"; } + +.fa-face-grin::before { + content: "\f580"; } + +.fa-grin::before { + content: "\f580"; } + +.fa-face-grin-beam::before { + content: "\f582"; } + +.fa-grin-beam::before { + content: "\f582"; } + +.fa-face-grin-beam-sweat::before { + content: "\f583"; } + +.fa-grin-beam-sweat::before { + content: "\f583"; } + +.fa-face-grin-hearts::before { + content: "\f584"; } + +.fa-grin-hearts::before { + content: "\f584"; } + +.fa-face-grin-squint::before { + content: "\f585"; } + +.fa-grin-squint::before { + content: "\f585"; } + +.fa-face-grin-squint-tears::before { + content: "\f586"; } + +.fa-grin-squint-tears::before { + content: "\f586"; } + +.fa-face-grin-stars::before { + content: "\f587"; } + +.fa-grin-stars::before { + content: "\f587"; } + +.fa-face-grin-tears::before { + content: "\f588"; } + +.fa-grin-tears::before { + content: "\f588"; } + +.fa-face-grin-tongue::before { + content: "\f589"; } + +.fa-grin-tongue::before { + content: "\f589"; } + +.fa-face-grin-tongue-squint::before { + content: "\f58a"; } + +.fa-grin-tongue-squint::before { + content: "\f58a"; } + +.fa-face-grin-tongue-wink::before { + content: "\f58b"; } + +.fa-grin-tongue-wink::before { + content: "\f58b"; } + +.fa-face-grin-wide::before { + content: "\f581"; } + +.fa-grin-alt::before { + content: "\f581"; } + +.fa-face-grin-wink::before { + content: "\f58c"; } + +.fa-grin-wink::before { + content: "\f58c"; } + +.fa-face-kiss::before { + content: "\f596"; } + +.fa-kiss::before { + content: "\f596"; } + +.fa-face-kiss-beam::before { + content: "\f597"; } + +.fa-kiss-beam::before { + content: "\f597"; } + +.fa-face-kiss-wink-heart::before { + content: "\f598"; } + +.fa-kiss-wink-heart::before { + content: "\f598"; } + +.fa-face-laugh::before { + content: "\f599"; } + +.fa-laugh::before { + content: "\f599"; } + +.fa-face-laugh-beam::before { + content: "\f59a"; } + +.fa-laugh-beam::before { + content: "\f59a"; } + +.fa-face-laugh-squint::before { + content: "\f59b"; } + +.fa-laugh-squint::before { + content: "\f59b"; } + +.fa-face-laugh-wink::before { + content: "\f59c"; } + +.fa-laugh-wink::before { + content: "\f59c"; } + +.fa-face-meh::before { + content: "\f11a"; } + +.fa-meh::before { + content: "\f11a"; } + +.fa-face-meh-blank::before { + content: "\f5a4"; } + +.fa-meh-blank::before { + content: "\f5a4"; } + +.fa-face-rolling-eyes::before { + content: "\f5a5"; } + +.fa-meh-rolling-eyes::before { + content: "\f5a5"; } + +.fa-face-sad-cry::before { + content: "\f5b3"; } + +.fa-sad-cry::before { + content: "\f5b3"; } + +.fa-face-sad-tear::before { + content: "\f5b4"; } + +.fa-sad-tear::before { + content: "\f5b4"; } + +.fa-face-smile::before { + content: "\f118"; } + +.fa-smile::before { + content: "\f118"; } + +.fa-face-smile-beam::before { + content: "\f5b8"; } + +.fa-smile-beam::before { + content: "\f5b8"; } + +.fa-face-smile-wink::before { + content: "\f4da"; } + +.fa-smile-wink::before { + content: "\f4da"; } + +.fa-face-surprise::before { + content: "\f5c2"; } + +.fa-surprise::before { + content: "\f5c2"; } + +.fa-face-tired::before { + content: "\f5c8"; } + +.fa-tired::before { + content: "\f5c8"; } + +.fa-fan::before { + content: "\f863"; } + +.fa-faucet::before { + content: "\e005"; } + +.fa-fax::before { + content: "\f1ac"; } + +.fa-feather::before { + content: "\f52d"; } + +.fa-feather-pointed::before { + content: "\f56b"; } + +.fa-feather-alt::before { + content: "\f56b"; } + +.fa-file::before { + content: "\f15b"; } + +.fa-file-arrow-down::before { + content: "\f56d"; } + +.fa-file-download::before { + content: "\f56d"; } + +.fa-file-arrow-up::before { + content: "\f574"; } + +.fa-file-upload::before { + content: "\f574"; } + +.fa-file-audio::before { + content: "\f1c7"; } + +.fa-file-code::before { + content: "\f1c9"; } + +.fa-file-contract::before { + content: "\f56c"; } + +.fa-file-csv::before { + content: "\f6dd"; } + +.fa-file-excel::before { + content: "\f1c3"; } + +.fa-file-export::before { + content: "\f56e"; } + +.fa-arrow-right-from-file::before { + content: "\f56e"; } + +.fa-file-image::before { + content: "\f1c5"; } + +.fa-file-import::before { + content: "\f56f"; } + +.fa-arrow-right-to-file::before { + content: "\f56f"; } + +.fa-file-invoice::before { + content: "\f570"; } + +.fa-file-invoice-dollar::before { + content: "\f571"; } + +.fa-file-lines::before { + content: "\f15c"; } + +.fa-file-alt::before { + content: "\f15c"; } + +.fa-file-text::before { + content: "\f15c"; } + +.fa-file-medical::before { + content: "\f477"; } + +.fa-file-pdf::before { + content: "\f1c1"; } + +.fa-file-powerpoint::before { + content: "\f1c4"; } + +.fa-file-prescription::before { + content: "\f572"; } + +.fa-file-signature::before { + content: "\f573"; } + +.fa-file-video::before { + content: "\f1c8"; } + +.fa-file-waveform::before { + content: "\f478"; } + +.fa-file-medical-alt::before { + content: "\f478"; } + +.fa-file-word::before { + content: "\f1c2"; } + +.fa-file-zipper::before { + content: "\f1c6"; } + +.fa-file-archive::before { + content: "\f1c6"; } + +.fa-fill::before { + content: "\f575"; } + +.fa-fill-drip::before { + content: "\f576"; } + +.fa-film::before { + content: "\f008"; } + +.fa-filter::before { + content: "\f0b0"; } + +.fa-filter-circle-dollar::before { + content: "\f662"; } + +.fa-funnel-dollar::before { + content: "\f662"; } + +.fa-filter-circle-xmark::before { + content: "\e17b"; } + +.fa-fingerprint::before { + content: "\f577"; } + +.fa-fire::before { + content: "\f06d"; } + +.fa-fire-extinguisher::before { + content: "\f134"; } + +.fa-fire-flame-curved::before { + content: "\f7e4"; } + +.fa-fire-alt::before { + content: "\f7e4"; } + +.fa-fire-flame-simple::before { + content: "\f46a"; } + +.fa-burn::before { + content: "\f46a"; } + +.fa-fish::before { + content: "\f578"; } + +.fa-flag::before { + content: "\f024"; } + +.fa-flag-checkered::before { + content: "\f11e"; } + +.fa-flag-usa::before { + content: "\f74d"; } + +.fa-flask::before { + content: "\f0c3"; } + +.fa-floppy-disk::before { + content: "\f0c7"; } + +.fa-save::before { + content: "\f0c7"; } + +.fa-florin-sign::before { + content: "\e184"; } + +.fa-folder::before { + content: "\f07b"; } + +.fa-folder-minus::before { + content: "\f65d"; } + +.fa-folder-open::before { + content: "\f07c"; } + +.fa-folder-plus::before { + content: "\f65e"; } + +.fa-folder-tree::before { + content: "\f802"; } + +.fa-font::before { + content: "\f031"; } + +.fa-football::before { + content: "\f44e"; } + +.fa-football-ball::before { + content: "\f44e"; } + +.fa-forward::before { + content: "\f04e"; } + +.fa-forward-fast::before { + content: "\f050"; } + +.fa-fast-forward::before { + content: "\f050"; } + +.fa-forward-step::before { + content: "\f051"; } + +.fa-step-forward::before { + content: "\f051"; } + +.fa-franc-sign::before { + content: "\e18f"; } + +.fa-frog::before { + content: "\f52e"; } + +.fa-futbol::before { + content: "\f1e3"; } + +.fa-futbol-ball::before { + content: "\f1e3"; } + +.fa-soccer-ball::before { + content: "\f1e3"; } + +.fa-g::before { + content: "\47"; } + +.fa-gamepad::before { + content: "\f11b"; } + +.fa-gas-pump::before { + content: "\f52f"; } + +.fa-gauge::before { + content: "\f625"; } + +.fa-dashboard::before { + content: "\f625"; } + +.fa-gauge-high::before { + content: "\f625"; } + +.fa-tachometer-alt::before { + content: "\f625"; } + +.fa-tachometer-alt-fast::before { + content: "\f625"; } + +.fa-gauge-simple::before { + content: "\f62a"; } + +.fa-gauge-simple-high::before { + content: "\f62a"; } + +.fa-tachometer::before { + content: "\f62a"; } + +.fa-tachometer-fast::before { + content: "\f62a"; } + +.fa-gavel::before { + content: "\f0e3"; } + +.fa-legal::before { + content: "\f0e3"; } + +.fa-gear::before { + content: "\f013"; } + +.fa-cog::before { + content: "\f013"; } + +.fa-gears::before { + content: "\f085"; } + +.fa-cogs::before { + content: "\f085"; } + +.fa-gem::before { + content: "\f3a5"; } + +.fa-genderless::before { + content: "\f22d"; } + +.fa-ghost::before { + content: "\f6e2"; } + +.fa-gift::before { + content: "\f06b"; } + +.fa-gifts::before { + content: "\f79c"; } + +.fa-glasses::before { + content: "\f530"; } + +.fa-globe::before { + content: "\f0ac"; } + +.fa-golf-ball-tee::before { + content: "\f450"; } + +.fa-golf-ball::before { + content: "\f450"; } + +.fa-gopuram::before { + content: "\f664"; } + +.fa-graduation-cap::before { + content: "\f19d"; } + +.fa-mortar-board::before { + content: "\f19d"; } + +.fa-greater-than::before { + content: "\3e"; } + +.fa-greater-than-equal::before { + content: "\f532"; } + +.fa-grip::before { + content: "\f58d"; } + +.fa-grip-horizontal::before { + content: "\f58d"; } + +.fa-grip-lines::before { + content: "\f7a4"; } + +.fa-grip-lines-vertical::before { + content: "\f7a5"; } + +.fa-grip-vertical::before { + content: "\f58e"; } + +.fa-guarani-sign::before { + content: "\e19a"; } + +.fa-guitar::before { + content: "\f7a6"; } + +.fa-gun::before { + content: "\e19b"; } + +.fa-h::before { + content: "\48"; } + +.fa-hammer::before { + content: "\f6e3"; } + +.fa-hamsa::before { + content: "\f665"; } + +.fa-hand::before { + content: "\f256"; } + +.fa-hand-paper::before { + content: "\f256"; } + +.fa-hand-back-fist::before { + content: "\f255"; } + +.fa-hand-rock::before { + content: "\f255"; } + +.fa-hand-dots::before { + content: "\f461"; } + +.fa-allergies::before { + content: "\f461"; } + +.fa-hand-fist::before { + content: "\f6de"; } + +.fa-fist-raised::before { + content: "\f6de"; } + +.fa-hand-holding::before { + content: "\f4bd"; } + +.fa-hand-holding-dollar::before { + content: "\f4c0"; } + +.fa-hand-holding-usd::before { + content: "\f4c0"; } + +.fa-hand-holding-droplet::before { + content: "\f4c1"; } + +.fa-hand-holding-water::before { + content: "\f4c1"; } + +.fa-hand-holding-heart::before { + content: "\f4be"; } + +.fa-hand-holding-medical::before { + content: "\e05c"; } + +.fa-hand-lizard::before { + content: "\f258"; } + +.fa-hand-middle-finger::before { + content: "\f806"; } + +.fa-hand-peace::before { + content: "\f25b"; } + +.fa-hand-point-down::before { + content: "\f0a7"; } + +.fa-hand-point-left::before { + content: "\f0a5"; } + +.fa-hand-point-right::before { + content: "\f0a4"; } + +.fa-hand-point-up::before { + content: "\f0a6"; } + +.fa-hand-pointer::before { + content: "\f25a"; } + +.fa-hand-scissors::before { + content: "\f257"; } + +.fa-hand-sparkles::before { + content: "\e05d"; } + +.fa-hand-spock::before { + content: "\f259"; } + +.fa-hands::before { + content: "\f2a7"; } + +.fa-sign-language::before { + content: "\f2a7"; } + +.fa-signing::before { + content: "\f2a7"; } + +.fa-hands-asl-interpreting::before { + content: "\f2a3"; } + +.fa-american-sign-language-interpreting::before { + content: "\f2a3"; } + +.fa-asl-interpreting::before { + content: "\f2a3"; } + +.fa-hands-american-sign-language-interpreting::before { + content: "\f2a3"; } + +.fa-hands-bubbles::before { + content: "\e05e"; } + +.fa-hands-wash::before { + content: "\e05e"; } + +.fa-hands-clapping::before { + content: "\e1a8"; } + +.fa-hands-holding::before { + content: "\f4c2"; } + +.fa-hands-praying::before { + content: "\f684"; } + +.fa-praying-hands::before { + content: "\f684"; } + +.fa-handshake::before { + content: "\f2b5"; } + +.fa-handshake-angle::before { + content: "\f4c4"; } + +.fa-hands-helping::before { + content: "\f4c4"; } + +.fa-handshake-simple-slash::before { + content: "\e05f"; } + +.fa-handshake-alt-slash::before { + content: "\e05f"; } + +.fa-handshake-slash::before { + content: "\e060"; } + +.fa-hanukiah::before { + content: "\f6e6"; } + +.fa-hard-drive::before { + content: "\f0a0"; } + +.fa-hdd::before { + content: "\f0a0"; } + +.fa-hashtag::before { + content: "\23"; } + +.fa-hat-cowboy::before { + content: "\f8c0"; } + +.fa-hat-cowboy-side::before { + content: "\f8c1"; } + +.fa-hat-wizard::before { + content: "\f6e8"; } + +.fa-head-side-cough::before { + content: "\e061"; } + +.fa-head-side-cough-slash::before { + content: "\e062"; } + +.fa-head-side-mask::before { + content: "\e063"; } + +.fa-head-side-virus::before { + content: "\e064"; } + +.fa-heading::before { + content: "\f1dc"; } + +.fa-header::before { + content: "\f1dc"; } + +.fa-headphones::before { + content: "\f025"; } + +.fa-headphones-simple::before { + content: "\f58f"; } + +.fa-headphones-alt::before { + content: "\f58f"; } + +.fa-headset::before { + content: "\f590"; } + +.fa-heart::before { + content: "\f004"; } + +.fa-heart-crack::before { + content: "\f7a9"; } + +.fa-heart-broken::before { + content: "\f7a9"; } + +.fa-heart-pulse::before { + content: "\f21e"; } + +.fa-heartbeat::before { + content: "\f21e"; } + +.fa-helicopter::before { + content: "\f533"; } + +.fa-helmet-safety::before { + content: "\f807"; } + +.fa-hard-hat::before { + content: "\f807"; } + +.fa-hat-hard::before { + content: "\f807"; } + +.fa-highlighter::before { + content: "\f591"; } + +.fa-hippo::before { + content: "\f6ed"; } + +.fa-hockey-puck::before { + content: "\f453"; } + +.fa-holly-berry::before { + content: "\f7aa"; } + +.fa-horse::before { + content: "\f6f0"; } + +.fa-horse-head::before { + content: "\f7ab"; } + +.fa-hospital::before { + content: "\f0f8"; } + +.fa-hospital-alt::before { + content: "\f0f8"; } + +.fa-hospital-wide::before { + content: "\f0f8"; } + +.fa-hospital-user::before { + content: "\f80d"; } + +.fa-hot-tub-person::before { + content: "\f593"; } + +.fa-hot-tub::before { + content: "\f593"; } + +.fa-hotdog::before { + content: "\f80f"; } + +.fa-hotel::before { + content: "\f594"; } + +.fa-hourglass::before { + content: "\f254"; } + +.fa-hourglass-2::before { + content: "\f254"; } + +.fa-hourglass-half::before { + content: "\f254"; } + +.fa-hourglass-empty::before { + content: "\f252"; } + +.fa-hourglass-end::before { + content: "\f253"; } + +.fa-hourglass-3::before { + content: "\f253"; } + +.fa-hourglass-start::before { + content: "\f251"; } + +.fa-hourglass-1::before { + content: "\f251"; } + +.fa-house::before { + content: "\f015"; } + +.fa-home::before { + content: "\f015"; } + +.fa-home-alt::before { + content: "\f015"; } + +.fa-home-lg-alt::before { + content: "\f015"; } + +.fa-house-chimney::before { + content: "\e3af"; } + +.fa-home-lg::before { + content: "\e3af"; } + +.fa-house-chimney-crack::before { + content: "\f6f1"; } + +.fa-house-damage::before { + content: "\f6f1"; } + +.fa-house-chimney-medical::before { + content: "\f7f2"; } + +.fa-clinic-medical::before { + content: "\f7f2"; } + +.fa-house-chimney-user::before { + content: "\e065"; } + +.fa-house-crack::before { + content: "\e3b1"; } + +.fa-house-laptop::before { + content: "\e066"; } + +.fa-laptop-house::before { + content: "\e066"; } + +.fa-house-medical::before { + content: "\e3b2"; } + +.fa-house-user::before { + content: "\e1b0"; } + +.fa-home-user::before { + content: "\e1b0"; } + +.fa-hryvnia-sign::before { + content: "\f6f2"; } + +.fa-hryvnia::before { + content: "\f6f2"; } + +.fa-i::before { + content: "\49"; } + +.fa-i-cursor::before { + content: "\f246"; } + +.fa-ice-cream::before { + content: "\f810"; } + +.fa-icicles::before { + content: "\f7ad"; } + +.fa-icons::before { + content: "\f86d"; } + +.fa-heart-music-camera-bolt::before { + content: "\f86d"; } + +.fa-id-badge::before { + content: "\f2c1"; } + +.fa-id-card::before { + content: "\f2c2"; } + +.fa-drivers-license::before { + content: "\f2c2"; } + +.fa-id-card-clip::before { + content: "\f47f"; } + +.fa-id-card-alt::before { + content: "\f47f"; } + +.fa-igloo::before { + content: "\f7ae"; } + +.fa-image::before { + content: "\f03e"; } + +.fa-image-portrait::before { + content: "\f3e0"; } + +.fa-portrait::before { + content: "\f3e0"; } + +.fa-images::before { + content: "\f302"; } + +.fa-inbox::before { + content: "\f01c"; } + +.fa-indent::before { + content: "\f03c"; } + +.fa-indian-rupee-sign::before { + content: "\e1bc"; } + +.fa-indian-rupee::before { + content: "\e1bc"; } + +.fa-inr::before { + content: "\e1bc"; } + +.fa-industry::before { + content: "\f275"; } + +.fa-infinity::before { + content: "\f534"; } + +.fa-info::before { + content: "\f129"; } + +.fa-italic::before { + content: "\f033"; } + +.fa-j::before { + content: "\4a"; } + +.fa-jedi::before { + content: "\f669"; } + +.fa-jet-fighter::before { + content: "\f0fb"; } + +.fa-fighter-jet::before { + content: "\f0fb"; } + +.fa-joint::before { + content: "\f595"; } + +.fa-k::before { + content: "\4b"; } + +.fa-kaaba::before { + content: "\f66b"; } + +.fa-key::before { + content: "\f084"; } + +.fa-keyboard::before { + content: "\f11c"; } + +.fa-khanda::before { + content: "\f66d"; } + +.fa-kip-sign::before { + content: "\e1c4"; } + +.fa-kit-medical::before { + content: "\f479"; } + +.fa-first-aid::before { + content: "\f479"; } + +.fa-kiwi-bird::before { + content: "\f535"; } + +.fa-l::before { + content: "\4c"; } + +.fa-landmark::before { + content: "\f66f"; } + +.fa-language::before { + content: "\f1ab"; } + +.fa-laptop::before { + content: "\f109"; } + +.fa-laptop-code::before { + content: "\f5fc"; } + +.fa-laptop-medical::before { + content: "\f812"; } + +.fa-lari-sign::before { + content: "\e1c8"; } + +.fa-layer-group::before { + content: "\f5fd"; } + +.fa-leaf::before { + content: "\f06c"; } + +.fa-left-long::before { + content: "\f30a"; } + +.fa-long-arrow-alt-left::before { + content: "\f30a"; } + +.fa-left-right::before { + content: "\f337"; } + +.fa-arrows-alt-h::before { + content: "\f337"; } + +.fa-lemon::before { + content: "\f094"; } + +.fa-less-than::before { + content: "\3c"; } + +.fa-less-than-equal::before { + content: "\f537"; } + +.fa-life-ring::before { + content: "\f1cd"; } + +.fa-lightbulb::before { + content: "\f0eb"; } + +.fa-link::before { + content: "\f0c1"; } + +.fa-chain::before { + content: "\f0c1"; } + +.fa-link-slash::before { + content: "\f127"; } + +.fa-chain-broken::before { + content: "\f127"; } + +.fa-chain-slash::before { + content: "\f127"; } + +.fa-unlink::before { + content: "\f127"; } + +.fa-lira-sign::before { + content: "\f195"; } + +.fa-list::before { + content: "\f03a"; } + +.fa-list-squares::before { + content: "\f03a"; } + +.fa-list-check::before { + content: "\f0ae"; } + +.fa-tasks::before { + content: "\f0ae"; } + +.fa-list-ol::before { + content: "\f0cb"; } + +.fa-list-1-2::before { + content: "\f0cb"; } + +.fa-list-numeric::before { + content: "\f0cb"; } + +.fa-list-ul::before { + content: "\f0ca"; } + +.fa-list-dots::before { + content: "\f0ca"; } + +.fa-litecoin-sign::before { + content: "\e1d3"; } + +.fa-location-arrow::before { + content: "\f124"; } + +.fa-location-crosshairs::before { + content: "\f601"; } + +.fa-location::before { + content: "\f601"; } + +.fa-location-dot::before { + content: "\f3c5"; } + +.fa-map-marker-alt::before { + content: "\f3c5"; } + +.fa-location-pin::before { + content: "\f041"; } + +.fa-map-marker::before { + content: "\f041"; } + +.fa-lock::before { + content: "\f023"; } + +.fa-lock-open::before { + content: "\f3c1"; } + +.fa-lungs::before { + content: "\f604"; } + +.fa-lungs-virus::before { + content: "\e067"; } + +.fa-m::before { + content: "\4d"; } + +.fa-magnet::before { + content: "\f076"; } + +.fa-magnifying-glass::before { + content: "\f002"; } + +.fa-search::before { + content: "\f002"; } + +.fa-magnifying-glass-dollar::before { + content: "\f688"; } + +.fa-search-dollar::before { + content: "\f688"; } + +.fa-magnifying-glass-location::before { + content: "\f689"; } + +.fa-search-location::before { + content: "\f689"; } + +.fa-magnifying-glass-minus::before { + content: "\f010"; } + +.fa-search-minus::before { + content: "\f010"; } + +.fa-magnifying-glass-plus::before { + content: "\f00e"; } + +.fa-search-plus::before { + content: "\f00e"; } + +.fa-manat-sign::before { + content: "\e1d5"; } + +.fa-map::before { + content: "\f279"; } + +.fa-map-location::before { + content: "\f59f"; } + +.fa-map-marked::before { + content: "\f59f"; } + +.fa-map-location-dot::before { + content: "\f5a0"; } + +.fa-map-marked-alt::before { + content: "\f5a0"; } + +.fa-map-pin::before { + content: "\f276"; } + +.fa-marker::before { + content: "\f5a1"; } + +.fa-mars::before { + content: "\f222"; } + +.fa-mars-and-venus::before { + content: "\f224"; } + +.fa-mars-double::before { + content: "\f227"; } + +.fa-mars-stroke::before { + content: "\f229"; } + +.fa-mars-stroke-right::before { + content: "\f22b"; } + +.fa-mars-stroke-h::before { + content: "\f22b"; } + +.fa-mars-stroke-up::before { + content: "\f22a"; } + +.fa-mars-stroke-v::before { + content: "\f22a"; } + +.fa-martini-glass::before { + content: "\f57b"; } + +.fa-glass-martini-alt::before { + content: "\f57b"; } + +.fa-martini-glass-citrus::before { + content: "\f561"; } + +.fa-cocktail::before { + content: "\f561"; } + +.fa-martini-glass-empty::before { + content: "\f000"; } + +.fa-glass-martini::before { + content: "\f000"; } + +.fa-mask::before { + content: "\f6fa"; } + +.fa-mask-face::before { + content: "\e1d7"; } + +.fa-masks-theater::before { + content: "\f630"; } + +.fa-theater-masks::before { + content: "\f630"; } + +.fa-maximize::before { + content: "\f31e"; } + +.fa-expand-arrows-alt::before { + content: "\f31e"; } + +.fa-medal::before { + content: "\f5a2"; } + +.fa-memory::before { + content: "\f538"; } + +.fa-menorah::before { + content: "\f676"; } + +.fa-mercury::before { + content: "\f223"; } + +.fa-message::before { + content: "\f27a"; } + +.fa-comment-alt::before { + content: "\f27a"; } + +.fa-meteor::before { + content: "\f753"; } + +.fa-microchip::before { + content: "\f2db"; } + +.fa-microphone::before { + content: "\f130"; } + +.fa-microphone-lines::before { + content: "\f3c9"; } + +.fa-microphone-alt::before { + content: "\f3c9"; } + +.fa-microphone-lines-slash::before { + content: "\f539"; } + +.fa-microphone-alt-slash::before { + content: "\f539"; } + +.fa-microphone-slash::before { + content: "\f131"; } + +.fa-microscope::before { + content: "\f610"; } + +.fa-mill-sign::before { + content: "\e1ed"; } + +.fa-minimize::before { + content: "\f78c"; } + +.fa-compress-arrows-alt::before { + content: "\f78c"; } + +.fa-minus::before { + content: "\f068"; } + +.fa-subtract::before { + content: "\f068"; } + +.fa-mitten::before { + content: "\f7b5"; } + +.fa-mobile-button::before { + content: "\f10b"; } + +.fa-mobile-screen-button::before { + content: "\f3cd"; } + +.fa-mobile-alt::before { + content: "\f3cd"; } + +.fa-money-bill::before { + content: "\f0d6"; } + +.fa-money-bill-1::before { + content: "\f3d1"; } + +.fa-money-bill-alt::before { + content: "\f3d1"; } + +.fa-money-bill-1-wave::before { + content: "\f53b"; } + +.fa-money-bill-wave-alt::before { + content: "\f53b"; } + +.fa-money-bill-wave::before { + content: "\f53a"; } + +.fa-money-check::before { + content: "\f53c"; } + +.fa-money-check-dollar::before { + content: "\f53d"; } + +.fa-money-check-alt::before { + content: "\f53d"; } + +.fa-monument::before { + content: "\f5a6"; } + +.fa-moon::before { + content: "\f186"; } + +.fa-mortar-pestle::before { + content: "\f5a7"; } + +.fa-mosque::before { + content: "\f678"; } + +.fa-motorcycle::before { + content: "\f21c"; } + +.fa-mountain::before { + content: "\f6fc"; } + +.fa-mug-hot::before { + content: "\f7b6"; } + +.fa-mug-saucer::before { + content: "\f0f4"; } + +.fa-coffee::before { + content: "\f0f4"; } + +.fa-music::before { + content: "\f001"; } + +.fa-n::before { + content: "\4e"; } + +.fa-naira-sign::before { + content: "\e1f6"; } + +.fa-network-wired::before { + content: "\f6ff"; } + +.fa-neuter::before { + content: "\f22c"; } + +.fa-newspaper::before { + content: "\f1ea"; } + +.fa-not-equal::before { + content: "\f53e"; } + +.fa-note-sticky::before { + content: "\f249"; } + +.fa-sticky-note::before { + content: "\f249"; } + +.fa-notes-medical::before { + content: "\f481"; } + +.fa-o::before { + content: "\4f"; } + +.fa-object-group::before { + content: "\f247"; } + +.fa-object-ungroup::before { + content: "\f248"; } + +.fa-oil-can::before { + content: "\f613"; } + +.fa-om::before { + content: "\f679"; } + +.fa-otter::before { + content: "\f700"; } + +.fa-outdent::before { + content: "\f03b"; } + +.fa-dedent::before { + content: "\f03b"; } + +.fa-p::before { + content: "\50"; } + +.fa-pager::before { + content: "\f815"; } + +.fa-paint-brush::before { + content: "\f1fc"; } + +.fa-paint-roller::before { + content: "\f5aa"; } + +.fa-palette::before { + content: "\f53f"; } + +.fa-pallet::before { + content: "\f482"; } + +.fa-panorama::before { + content: "\e209"; } + +.fa-paper-plane::before { + content: "\f1d8"; } + +.fa-paperclip::before { + content: "\f0c6"; } + +.fa-parachute-box::before { + content: "\f4cd"; } + +.fa-paragraph::before { + content: "\f1dd"; } + +.fa-passport::before { + content: "\f5ab"; } + +.fa-paste::before { + content: "\f0ea"; } + +.fa-file-clipboard::before { + content: "\f0ea"; } + +.fa-pause::before { + content: "\f04c"; } + +.fa-paw::before { + content: "\f1b0"; } + +.fa-peace::before { + content: "\f67c"; } + +.fa-pen::before { + content: "\f304"; } + +.fa-pen-clip::before { + content: "\f305"; } + +.fa-pen-alt::before { + content: "\f305"; } + +.fa-pen-fancy::before { + content: "\f5ac"; } + +.fa-pen-nib::before { + content: "\f5ad"; } + +.fa-pen-ruler::before { + content: "\f5ae"; } + +.fa-pencil-ruler::before { + content: "\f5ae"; } + +.fa-pen-to-square::before { + content: "\f044"; } + +.fa-edit::before { + content: "\f044"; } + +.fa-pencil::before { + content: "\f303"; } + +.fa-pencil-alt::before { + content: "\f303"; } + +.fa-people-arrows-left-right::before { + content: "\e068"; } + +.fa-people-arrows::before { + content: "\e068"; } + +.fa-people-carry-box::before { + content: "\f4ce"; } + +.fa-people-carry::before { + content: "\f4ce"; } + +.fa-pepper-hot::before { + content: "\f816"; } + +.fa-percent::before { + content: "\25"; } + +.fa-percentage::before { + content: "\25"; } + +.fa-person::before { + content: "\f183"; } + +.fa-male::before { + content: "\f183"; } + +.fa-person-biking::before { + content: "\f84a"; } + +.fa-biking::before { + content: "\f84a"; } + +.fa-person-booth::before { + content: "\f756"; } + +.fa-person-dots-from-line::before { + content: "\f470"; } + +.fa-diagnoses::before { + content: "\f470"; } + +.fa-person-dress::before { + content: "\f182"; } + +.fa-female::before { + content: "\f182"; } + +.fa-person-hiking::before { + content: "\f6ec"; } + +.fa-hiking::before { + content: "\f6ec"; } + +.fa-person-praying::before { + content: "\f683"; } + +.fa-pray::before { + content: "\f683"; } + +.fa-person-running::before { + content: "\f70c"; } + +.fa-running::before { + content: "\f70c"; } + +.fa-person-skating::before { + content: "\f7c5"; } + +.fa-skating::before { + content: "\f7c5"; } + +.fa-person-skiing::before { + content: "\f7c9"; } + +.fa-skiing::before { + content: "\f7c9"; } + +.fa-person-skiing-nordic::before { + content: "\f7ca"; } + +.fa-skiing-nordic::before { + content: "\f7ca"; } + +.fa-person-snowboarding::before { + content: "\f7ce"; } + +.fa-snowboarding::before { + content: "\f7ce"; } + +.fa-person-swimming::before { + content: "\f5c4"; } + +.fa-swimmer::before { + content: "\f5c4"; } + +.fa-person-walking::before { + content: "\f554"; } + +.fa-walking::before { + content: "\f554"; } + +.fa-person-walking-with-cane::before { + content: "\f29d"; } + +.fa-blind::before { + content: "\f29d"; } + +.fa-peseta-sign::before { + content: "\e221"; } + +.fa-peso-sign::before { + content: "\e222"; } + +.fa-phone::before { + content: "\f095"; } + +.fa-phone-flip::before { + content: "\f879"; } + +.fa-phone-alt::before { + content: "\f879"; } + +.fa-phone-slash::before { + content: "\f3dd"; } + +.fa-phone-volume::before { + content: "\f2a0"; } + +.fa-volume-control-phone::before { + content: "\f2a0"; } + +.fa-photo-film::before { + content: "\f87c"; } + +.fa-photo-video::before { + content: "\f87c"; } + +.fa-piggy-bank::before { + content: "\f4d3"; } + +.fa-pills::before { + content: "\f484"; } + +.fa-pizza-slice::before { + content: "\f818"; } + +.fa-place-of-worship::before { + content: "\f67f"; } + +.fa-plane::before { + content: "\f072"; } + +.fa-plane-arrival::before { + content: "\f5af"; } + +.fa-plane-departure::before { + content: "\f5b0"; } + +.fa-plane-slash::before { + content: "\e069"; } + +.fa-play::before { + content: "\f04b"; } + +.fa-plug::before { + content: "\f1e6"; } + +.fa-plus::before { + content: "\2b"; } + +.fa-add::before { + content: "\2b"; } + +.fa-plus-minus::before { + content: "\e43c"; } + +.fa-podcast::before { + content: "\f2ce"; } + +.fa-poo::before { + content: "\f2fe"; } + +.fa-poo-storm::before { + content: "\f75a"; } + +.fa-poo-bolt::before { + content: "\f75a"; } + +.fa-poop::before { + content: "\f619"; } + +.fa-power-off::before { + content: "\f011"; } + +.fa-prescription::before { + content: "\f5b1"; } + +.fa-prescription-bottle::before { + content: "\f485"; } + +.fa-prescription-bottle-medical::before { + content: "\f486"; } + +.fa-prescription-bottle-alt::before { + content: "\f486"; } + +.fa-print::before { + content: "\f02f"; } + +.fa-pump-medical::before { + content: "\e06a"; } + +.fa-pump-soap::before { + content: "\e06b"; } + +.fa-puzzle-piece::before { + content: "\f12e"; } + +.fa-q::before { + content: "\51"; } + +.fa-qrcode::before { + content: "\f029"; } + +.fa-question::before { + content: "\3f"; } + +.fa-quote-left::before { + content: "\f10d"; } + +.fa-quote-left-alt::before { + content: "\f10d"; } + +.fa-quote-right::before { + content: "\f10e"; } + +.fa-quote-right-alt::before { + content: "\f10e"; } + +.fa-r::before { + content: "\52"; } + +.fa-radiation::before { + content: "\f7b9"; } + +.fa-rainbow::before { + content: "\f75b"; } + +.fa-receipt::before { + content: "\f543"; } + +.fa-record-vinyl::before { + content: "\f8d9"; } + +.fa-rectangle-ad::before { + content: "\f641"; } + +.fa-ad::before { + content: "\f641"; } + +.fa-rectangle-list::before { + content: "\f022"; } + +.fa-list-alt::before { + content: "\f022"; } + +.fa-rectangle-xmark::before { + content: "\f410"; } + +.fa-rectangle-times::before { + content: "\f410"; } + +.fa-times-rectangle::before { + content: "\f410"; } + +.fa-window-close::before { + content: "\f410"; } + +.fa-recycle::before { + content: "\f1b8"; } + +.fa-registered::before { + content: "\f25d"; } + +.fa-repeat::before { + content: "\f363"; } + +.fa-reply::before { + content: "\f3e5"; } + +.fa-mail-reply::before { + content: "\f3e5"; } + +.fa-reply-all::before { + content: "\f122"; } + +.fa-mail-reply-all::before { + content: "\f122"; } + +.fa-republican::before { + content: "\f75e"; } + +.fa-restroom::before { + content: "\f7bd"; } + +.fa-retweet::before { + content: "\f079"; } + +.fa-ribbon::before { + content: "\f4d6"; } + +.fa-right-from-bracket::before { + content: "\f2f5"; } + +.fa-sign-out-alt::before { + content: "\f2f5"; } + +.fa-right-left::before { + content: "\f362"; } + +.fa-exchange-alt::before { + content: "\f362"; } + +.fa-right-long::before { + content: "\f30b"; } + +.fa-long-arrow-alt-right::before { + content: "\f30b"; } + +.fa-right-to-bracket::before { + content: "\f2f6"; } + +.fa-sign-in-alt::before { + content: "\f2f6"; } + +.fa-ring::before { + content: "\f70b"; } + +.fa-road::before { + content: "\f018"; } + +.fa-robot::before { + content: "\f544"; } + +.fa-rocket::before { + content: "\f135"; } + +.fa-rotate::before { + content: "\f2f1"; } + +.fa-sync-alt::before { + content: "\f2f1"; } + +.fa-rotate-left::before { + content: "\f2ea"; } + +.fa-rotate-back::before { + content: "\f2ea"; } + +.fa-rotate-backward::before { + content: "\f2ea"; } + +.fa-undo-alt::before { + content: "\f2ea"; } + +.fa-rotate-right::before { + content: "\f2f9"; } + +.fa-redo-alt::before { + content: "\f2f9"; } + +.fa-rotate-forward::before { + content: "\f2f9"; } + +.fa-route::before { + content: "\f4d7"; } + +.fa-rss::before { + content: "\f09e"; } + +.fa-feed::before { + content: "\f09e"; } + +.fa-ruble-sign::before { + content: "\f158"; } + +.fa-rouble::before { + content: "\f158"; } + +.fa-rub::before { + content: "\f158"; } + +.fa-ruble::before { + content: "\f158"; } + +.fa-ruler::before { + content: "\f545"; } + +.fa-ruler-combined::before { + content: "\f546"; } + +.fa-ruler-horizontal::before { + content: "\f547"; } + +.fa-ruler-vertical::before { + content: "\f548"; } + +.fa-rupee-sign::before { + content: "\f156"; } + +.fa-rupee::before { + content: "\f156"; } + +.fa-rupiah-sign::before { + content: "\e23d"; } + +.fa-s::before { + content: "\53"; } + +.fa-sailboat::before { + content: "\e445"; } + +.fa-satellite::before { + content: "\f7bf"; } + +.fa-satellite-dish::before { + content: "\f7c0"; } + +.fa-scale-balanced::before { + content: "\f24e"; } + +.fa-balance-scale::before { + content: "\f24e"; } + +.fa-scale-unbalanced::before { + content: "\f515"; } + +.fa-balance-scale-left::before { + content: "\f515"; } + +.fa-scale-unbalanced-flip::before { + content: "\f516"; } + +.fa-balance-scale-right::before { + content: "\f516"; } + +.fa-school::before { + content: "\f549"; } + +.fa-scissors::before { + content: "\f0c4"; } + +.fa-cut::before { + content: "\f0c4"; } + +.fa-screwdriver::before { + content: "\f54a"; } + +.fa-screwdriver-wrench::before { + content: "\f7d9"; } + +.fa-tools::before { + content: "\f7d9"; } + +.fa-scroll::before { + content: "\f70e"; } + +.fa-scroll-torah::before { + content: "\f6a0"; } + +.fa-torah::before { + content: "\f6a0"; } + +.fa-sd-card::before { + content: "\f7c2"; } + +.fa-section::before { + content: "\e447"; } + +.fa-seedling::before { + content: "\f4d8"; } + +.fa-sprout::before { + content: "\f4d8"; } + +.fa-server::before { + content: "\f233"; } + +.fa-shapes::before { + content: "\f61f"; } + +.fa-triangle-circle-square::before { + content: "\f61f"; } + +.fa-share::before { + content: "\f064"; } + +.fa-arrow-turn-right::before { + content: "\f064"; } + +.fa-mail-forward::before { + content: "\f064"; } + +.fa-share-from-square::before { + content: "\f14d"; } + +.fa-share-square::before { + content: "\f14d"; } + +.fa-share-nodes::before { + content: "\f1e0"; } + +.fa-share-alt::before { + content: "\f1e0"; } + +.fa-shekel-sign::before { + content: "\f20b"; } + +.fa-ils::before { + content: "\f20b"; } + +.fa-shekel::before { + content: "\f20b"; } + +.fa-sheqel::before { + content: "\f20b"; } + +.fa-sheqel-sign::before { + content: "\f20b"; } + +.fa-shield::before { + content: "\f132"; } + +.fa-shield-blank::before { + content: "\f3ed"; } + +.fa-shield-alt::before { + content: "\f3ed"; } + +.fa-shield-virus::before { + content: "\e06c"; } + +.fa-ship::before { + content: "\f21a"; } + +.fa-shirt::before { + content: "\f553"; } + +.fa-t-shirt::before { + content: "\f553"; } + +.fa-tshirt::before { + content: "\f553"; } + +.fa-shoe-prints::before { + content: "\f54b"; } + +.fa-shop::before { + content: "\f54f"; } + +.fa-store-alt::before { + content: "\f54f"; } + +.fa-shop-slash::before { + content: "\e070"; } + +.fa-store-alt-slash::before { + content: "\e070"; } + +.fa-shower::before { + content: "\f2cc"; } + +.fa-shrimp::before { + content: "\e448"; } + +.fa-shuffle::before { + content: "\f074"; } + +.fa-random::before { + content: "\f074"; } + +.fa-shuttle-space::before { + content: "\f197"; } + +.fa-space-shuttle::before { + content: "\f197"; } + +.fa-sign-hanging::before { + content: "\f4d9"; } + +.fa-sign::before { + content: "\f4d9"; } + +.fa-signal::before { + content: "\f012"; } + +.fa-signal-5::before { + content: "\f012"; } + +.fa-signal-perfect::before { + content: "\f012"; } + +.fa-signature::before { + content: "\f5b7"; } + +.fa-signs-post::before { + content: "\f277"; } + +.fa-map-signs::before { + content: "\f277"; } + +.fa-sim-card::before { + content: "\f7c4"; } + +.fa-sink::before { + content: "\e06d"; } + +.fa-sitemap::before { + content: "\f0e8"; } + +.fa-skull::before { + content: "\f54c"; } + +.fa-skull-crossbones::before { + content: "\f714"; } + +.fa-slash::before { + content: "\f715"; } + +.fa-sleigh::before { + content: "\f7cc"; } + +.fa-sliders::before { + content: "\f1de"; } + +.fa-sliders-h::before { + content: "\f1de"; } + +.fa-smog::before { + content: "\f75f"; } + +.fa-smoking::before { + content: "\f48d"; } + +.fa-snowflake::before { + content: "\f2dc"; } + +.fa-snowman::before { + content: "\f7d0"; } + +.fa-snowplow::before { + content: "\f7d2"; } + +.fa-soap::before { + content: "\e06e"; } + +.fa-socks::before { + content: "\f696"; } + +.fa-solar-panel::before { + content: "\f5ba"; } + +.fa-sort::before { + content: "\f0dc"; } + +.fa-unsorted::before { + content: "\f0dc"; } + +.fa-sort-down::before { + content: "\f0dd"; } + +.fa-sort-desc::before { + content: "\f0dd"; } + +.fa-sort-up::before { + content: "\f0de"; } + +.fa-sort-asc::before { + content: "\f0de"; } + +.fa-spa::before { + content: "\f5bb"; } + +.fa-spaghetti-monster-flying::before { + content: "\f67b"; } + +.fa-pastafarianism::before { + content: "\f67b"; } + +.fa-spell-check::before { + content: "\f891"; } + +.fa-spider::before { + content: "\f717"; } + +.fa-spinner::before { + content: "\f110"; } + +.fa-splotch::before { + content: "\f5bc"; } + +.fa-spoon::before { + content: "\f2e5"; } + +.fa-utensil-spoon::before { + content: "\f2e5"; } + +.fa-spray-can::before { + content: "\f5bd"; } + +.fa-spray-can-sparkles::before { + content: "\f5d0"; } + +.fa-air-freshener::before { + content: "\f5d0"; } + +.fa-square::before { + content: "\f0c8"; } + +.fa-square-arrow-up-right::before { + content: "\f14c"; } + +.fa-external-link-square::before { + content: "\f14c"; } + +.fa-square-caret-down::before { + content: "\f150"; } + +.fa-caret-square-down::before { + content: "\f150"; } + +.fa-square-caret-left::before { + content: "\f191"; } + +.fa-caret-square-left::before { + content: "\f191"; } + +.fa-square-caret-right::before { + content: "\f152"; } + +.fa-caret-square-right::before { + content: "\f152"; } + +.fa-square-caret-up::before { + content: "\f151"; } + +.fa-caret-square-up::before { + content: "\f151"; } + +.fa-square-check::before { + content: "\f14a"; } + +.fa-check-square::before { + content: "\f14a"; } + +.fa-square-envelope::before { + content: "\f199"; } + +.fa-envelope-square::before { + content: "\f199"; } + +.fa-square-full::before { + content: "\f45c"; } + +.fa-square-h::before { + content: "\f0fd"; } + +.fa-h-square::before { + content: "\f0fd"; } + +.fa-square-minus::before { + content: "\f146"; } + +.fa-minus-square::before { + content: "\f146"; } + +.fa-square-parking::before { + content: "\f540"; } + +.fa-parking::before { + content: "\f540"; } + +.fa-square-pen::before { + content: "\f14b"; } + +.fa-pen-square::before { + content: "\f14b"; } + +.fa-pencil-square::before { + content: "\f14b"; } + +.fa-square-phone::before { + content: "\f098"; } + +.fa-phone-square::before { + content: "\f098"; } + +.fa-square-phone-flip::before { + content: "\f87b"; } + +.fa-phone-square-alt::before { + content: "\f87b"; } + +.fa-square-plus::before { + content: "\f0fe"; } + +.fa-plus-square::before { + content: "\f0fe"; } + +.fa-square-poll-horizontal::before { + content: "\f682"; } + +.fa-poll-h::before { + content: "\f682"; } + +.fa-square-poll-vertical::before { + content: "\f681"; } + +.fa-poll::before { + content: "\f681"; } + +.fa-square-root-variable::before { + content: "\f698"; } + +.fa-square-root-alt::before { + content: "\f698"; } + +.fa-square-rss::before { + content: "\f143"; } + +.fa-rss-square::before { + content: "\f143"; } + +.fa-square-share-nodes::before { + content: "\f1e1"; } + +.fa-share-alt-square::before { + content: "\f1e1"; } + +.fa-square-up-right::before { + content: "\f360"; } + +.fa-external-link-square-alt::before { + content: "\f360"; } + +.fa-square-xmark::before { + content: "\f2d3"; } + +.fa-times-square::before { + content: "\f2d3"; } + +.fa-xmark-square::before { + content: "\f2d3"; } + +.fa-stairs::before { + content: "\e289"; } + +.fa-stamp::before { + content: "\f5bf"; } + +.fa-star::before { + content: "\f005"; } + +.fa-star-and-crescent::before { + content: "\f699"; } + +.fa-star-half::before { + content: "\f089"; } + +.fa-star-half-stroke::before { + content: "\f5c0"; } + +.fa-star-half-alt::before { + content: "\f5c0"; } + +.fa-star-of-david::before { + content: "\f69a"; } + +.fa-star-of-life::before { + content: "\f621"; } + +.fa-sterling-sign::before { + content: "\f154"; } + +.fa-gbp::before { + content: "\f154"; } + +.fa-pound-sign::before { + content: "\f154"; } + +.fa-stethoscope::before { + content: "\f0f1"; } + +.fa-stop::before { + content: "\f04d"; } + +.fa-stopwatch::before { + content: "\f2f2"; } + +.fa-stopwatch-20::before { + content: "\e06f"; } + +.fa-store::before { + content: "\f54e"; } + +.fa-store-slash::before { + content: "\e071"; } + +.fa-street-view::before { + content: "\f21d"; } + +.fa-strikethrough::before { + content: "\f0cc"; } + +.fa-stroopwafel::before { + content: "\f551"; } + +.fa-subscript::before { + content: "\f12c"; } + +.fa-suitcase::before { + content: "\f0f2"; } + +.fa-suitcase-medical::before { + content: "\f0fa"; } + +.fa-medkit::before { + content: "\f0fa"; } + +.fa-suitcase-rolling::before { + content: "\f5c1"; } + +.fa-sun::before { + content: "\f185"; } + +.fa-superscript::before { + content: "\f12b"; } + +.fa-swatchbook::before { + content: "\f5c3"; } + +.fa-synagogue::before { + content: "\f69b"; } + +.fa-syringe::before { + content: "\f48e"; } + +.fa-t::before { + content: "\54"; } + +.fa-table::before { + content: "\f0ce"; } + +.fa-table-cells::before { + content: "\f00a"; } + +.fa-th::before { + content: "\f00a"; } + +.fa-table-cells-large::before { + content: "\f009"; } + +.fa-th-large::before { + content: "\f009"; } + +.fa-table-columns::before { + content: "\f0db"; } + +.fa-columns::before { + content: "\f0db"; } + +.fa-table-list::before { + content: "\f00b"; } + +.fa-th-list::before { + content: "\f00b"; } + +.fa-table-tennis-paddle-ball::before { + content: "\f45d"; } + +.fa-ping-pong-paddle-ball::before { + content: "\f45d"; } + +.fa-table-tennis::before { + content: "\f45d"; } + +.fa-tablet-button::before { + content: "\f10a"; } + +.fa-tablet-screen-button::before { + content: "\f3fa"; } + +.fa-tablet-alt::before { + content: "\f3fa"; } + +.fa-tablets::before { + content: "\f490"; } + +.fa-tachograph-digital::before { + content: "\f566"; } + +.fa-digital-tachograph::before { + content: "\f566"; } + +.fa-tag::before { + content: "\f02b"; } + +.fa-tags::before { + content: "\f02c"; } + +.fa-tape::before { + content: "\f4db"; } + +.fa-taxi::before { + content: "\f1ba"; } + +.fa-cab::before { + content: "\f1ba"; } + +.fa-teeth::before { + content: "\f62e"; } + +.fa-teeth-open::before { + content: "\f62f"; } + +.fa-temperature-empty::before { + content: "\f2cb"; } + +.fa-temperature-0::before { + content: "\f2cb"; } + +.fa-thermometer-0::before { + content: "\f2cb"; } + +.fa-thermometer-empty::before { + content: "\f2cb"; } + +.fa-temperature-full::before { + content: "\f2c7"; } + +.fa-temperature-4::before { + content: "\f2c7"; } + +.fa-thermometer-4::before { + content: "\f2c7"; } + +.fa-thermometer-full::before { + content: "\f2c7"; } + +.fa-temperature-half::before { + content: "\f2c9"; } + +.fa-temperature-2::before { + content: "\f2c9"; } + +.fa-thermometer-2::before { + content: "\f2c9"; } + +.fa-thermometer-half::before { + content: "\f2c9"; } + +.fa-temperature-high::before { + content: "\f769"; } + +.fa-temperature-low::before { + content: "\f76b"; } + +.fa-temperature-quarter::before { + content: "\f2ca"; } + +.fa-temperature-1::before { + content: "\f2ca"; } + +.fa-thermometer-1::before { + content: "\f2ca"; } + +.fa-thermometer-quarter::before { + content: "\f2ca"; } + +.fa-temperature-three-quarters::before { + content: "\f2c8"; } + +.fa-temperature-3::before { + content: "\f2c8"; } + +.fa-thermometer-3::before { + content: "\f2c8"; } + +.fa-thermometer-three-quarters::before { + content: "\f2c8"; } + +.fa-tenge-sign::before { + content: "\f7d7"; } + +.fa-tenge::before { + content: "\f7d7"; } + +.fa-terminal::before { + content: "\f120"; } + +.fa-text-height::before { + content: "\f034"; } + +.fa-text-slash::before { + content: "\f87d"; } + +.fa-remove-format::before { + content: "\f87d"; } + +.fa-text-width::before { + content: "\f035"; } + +.fa-thermometer::before { + content: "\f491"; } + +.fa-thumbs-down::before { + content: "\f165"; } + +.fa-thumbs-up::before { + content: "\f164"; } + +.fa-thumbtack::before { + content: "\f08d"; } + +.fa-thumb-tack::before { + content: "\f08d"; } + +.fa-ticket::before { + content: "\f145"; } + +.fa-ticket-simple::before { + content: "\f3ff"; } + +.fa-ticket-alt::before { + content: "\f3ff"; } + +.fa-timeline::before { + content: "\e29c"; } + +.fa-toggle-off::before { + content: "\f204"; } + +.fa-toggle-on::before { + content: "\f205"; } + +.fa-toilet::before { + content: "\f7d8"; } + +.fa-toilet-paper::before { + content: "\f71e"; } + +.fa-toilet-paper-slash::before { + content: "\e072"; } + +.fa-toolbox::before { + content: "\f552"; } + +.fa-tooth::before { + content: "\f5c9"; } + +.fa-torii-gate::before { + content: "\f6a1"; } + +.fa-tower-broadcast::before { + content: "\f519"; } + +.fa-broadcast-tower::before { + content: "\f519"; } + +.fa-tractor::before { + content: "\f722"; } + +.fa-trademark::before { + content: "\f25c"; } + +.fa-traffic-light::before { + content: "\f637"; } + +.fa-trailer::before { + content: "\e041"; } + +.fa-train::before { + content: "\f238"; } + +.fa-train-subway::before { + content: "\f239"; } + +.fa-subway::before { + content: "\f239"; } + +.fa-train-tram::before { + content: "\f7da"; } + +.fa-tram::before { + content: "\f7da"; } + +.fa-transgender::before { + content: "\f225"; } + +.fa-transgender-alt::before { + content: "\f225"; } + +.fa-trash::before { + content: "\f1f8"; } + +.fa-trash-arrow-up::before { + content: "\f829"; } + +.fa-trash-restore::before { + content: "\f829"; } + +.fa-trash-can::before { + content: "\f2ed"; } + +.fa-trash-alt::before { + content: "\f2ed"; } + +.fa-trash-can-arrow-up::before { + content: "\f82a"; } + +.fa-trash-restore-alt::before { + content: "\f82a"; } + +.fa-tree::before { + content: "\f1bb"; } + +.fa-triangle-exclamation::before { + content: "\f071"; } + +.fa-exclamation-triangle::before { + content: "\f071"; } + +.fa-warning::before { + content: "\f071"; } + +.fa-trophy::before { + content: "\f091"; } + +.fa-truck::before { + content: "\f0d1"; } + +.fa-truck-fast::before { + content: "\f48b"; } + +.fa-shipping-fast::before { + content: "\f48b"; } + +.fa-truck-medical::before { + content: "\f0f9"; } + +.fa-ambulance::before { + content: "\f0f9"; } + +.fa-truck-monster::before { + content: "\f63b"; } + +.fa-truck-moving::before { + content: "\f4df"; } + +.fa-truck-pickup::before { + content: "\f63c"; } + +.fa-truck-ramp-box::before { + content: "\f4de"; } + +.fa-truck-loading::before { + content: "\f4de"; } + +.fa-tty::before { + content: "\f1e4"; } + +.fa-teletype::before { + content: "\f1e4"; } + +.fa-turkish-lira-sign::before { + content: "\e2bb"; } + +.fa-try::before { + content: "\e2bb"; } + +.fa-turkish-lira::before { + content: "\e2bb"; } + +.fa-turn-down::before { + content: "\f3be"; } + +.fa-level-down-alt::before { + content: "\f3be"; } + +.fa-turn-up::before { + content: "\f3bf"; } + +.fa-level-up-alt::before { + content: "\f3bf"; } + +.fa-tv::before { + content: "\f26c"; } + +.fa-television::before { + content: "\f26c"; } + +.fa-tv-alt::before { + content: "\f26c"; } + +.fa-u::before { + content: "\55"; } + +.fa-umbrella::before { + content: "\f0e9"; } + +.fa-umbrella-beach::before { + content: "\f5ca"; } + +.fa-underline::before { + content: "\f0cd"; } + +.fa-universal-access::before { + content: "\f29a"; } + +.fa-unlock::before { + content: "\f09c"; } + +.fa-unlock-keyhole::before { + content: "\f13e"; } + +.fa-unlock-alt::before { + content: "\f13e"; } + +.fa-up-down::before { + content: "\f338"; } + +.fa-arrows-alt-v::before { + content: "\f338"; } + +.fa-up-down-left-right::before { + content: "\f0b2"; } + +.fa-arrows-alt::before { + content: "\f0b2"; } + +.fa-up-long::before { + content: "\f30c"; } + +.fa-long-arrow-alt-up::before { + content: "\f30c"; } + +.fa-up-right-and-down-left-from-center::before { + content: "\f424"; } + +.fa-expand-alt::before { + content: "\f424"; } + +.fa-up-right-from-square::before { + content: "\f35d"; } + +.fa-external-link-alt::before { + content: "\f35d"; } + +.fa-upload::before { + content: "\f093"; } + +.fa-user::before { + content: "\f007"; } + +.fa-user-astronaut::before { + content: "\f4fb"; } + +.fa-user-check::before { + content: "\f4fc"; } + +.fa-user-clock::before { + content: "\f4fd"; } + +.fa-user-doctor::before { + content: "\f0f0"; } + +.fa-user-md::before { + content: "\f0f0"; } + +.fa-user-gear::before { + content: "\f4fe"; } + +.fa-user-cog::before { + content: "\f4fe"; } + +.fa-user-graduate::before { + content: "\f501"; } + +.fa-user-group::before { + content: "\f500"; } + +.fa-user-friends::before { + content: "\f500"; } + +.fa-user-injured::before { + content: "\f728"; } + +.fa-user-large::before { + content: "\f406"; } + +.fa-user-alt::before { + content: "\f406"; } + +.fa-user-large-slash::before { + content: "\f4fa"; } + +.fa-user-alt-slash::before { + content: "\f4fa"; } + +.fa-user-lock::before { + content: "\f502"; } + +.fa-user-minus::before { + content: "\f503"; } + +.fa-user-ninja::before { + content: "\f504"; } + +.fa-user-nurse::before { + content: "\f82f"; } + +.fa-user-pen::before { + content: "\f4ff"; } + +.fa-user-edit::before { + content: "\f4ff"; } + +.fa-user-plus::before { + content: "\f234"; } + +.fa-user-secret::before { + content: "\f21b"; } + +.fa-user-shield::before { + content: "\f505"; } + +.fa-user-slash::before { + content: "\f506"; } + +.fa-user-tag::before { + content: "\f507"; } + +.fa-user-tie::before { + content: "\f508"; } + +.fa-user-xmark::before { + content: "\f235"; } + +.fa-user-times::before { + content: "\f235"; } + +.fa-users::before { + content: "\f0c0"; } + +.fa-users-gear::before { + content: "\f509"; } + +.fa-users-cog::before { + content: "\f509"; } + +.fa-users-slash::before { + content: "\e073"; } + +.fa-utensils::before { + content: "\f2e7"; } + +.fa-cutlery::before { + content: "\f2e7"; } + +.fa-v::before { + content: "\56"; } + +.fa-van-shuttle::before { + content: "\f5b6"; } + +.fa-shuttle-van::before { + content: "\f5b6"; } + +.fa-vault::before { + content: "\e2c5"; } + +.fa-vector-square::before { + content: "\f5cb"; } + +.fa-venus::before { + content: "\f221"; } + +.fa-venus-double::before { + content: "\f226"; } + +.fa-venus-mars::before { + content: "\f228"; } + +.fa-vest::before { + content: "\e085"; } + +.fa-vest-patches::before { + content: "\e086"; } + +.fa-vial::before { + content: "\f492"; } + +.fa-vials::before { + content: "\f493"; } + +.fa-video::before { + content: "\f03d"; } + +.fa-video-camera::before { + content: "\f03d"; } + +.fa-video-slash::before { + content: "\f4e2"; } + +.fa-vihara::before { + content: "\f6a7"; } + +.fa-virus::before { + content: "\e074"; } + +.fa-virus-slash::before { + content: "\e075"; } + +.fa-viruses::before { + content: "\e076"; } + +.fa-voicemail::before { + content: "\f897"; } + +.fa-volleyball::before { + content: "\f45f"; } + +.fa-volleyball-ball::before { + content: "\f45f"; } + +.fa-volume-high::before { + content: "\f028"; } + +.fa-volume-up::before { + content: "\f028"; } + +.fa-volume-low::before { + content: "\f027"; } + +.fa-volume-down::before { + content: "\f027"; } + +.fa-volume-off::before { + content: "\f026"; } + +.fa-volume-xmark::before { + content: "\f6a9"; } + +.fa-volume-mute::before { + content: "\f6a9"; } + +.fa-volume-times::before { + content: "\f6a9"; } + +.fa-vr-cardboard::before { + content: "\f729"; } + +.fa-w::before { + content: "\57"; } + +.fa-wallet::before { + content: "\f555"; } + +.fa-wand-magic::before { + content: "\f0d0"; } + +.fa-magic::before { + content: "\f0d0"; } + +.fa-wand-magic-sparkles::before { + content: "\e2ca"; } + +.fa-magic-wand-sparkles::before { + content: "\e2ca"; } + +.fa-warehouse::before { + content: "\f494"; } + +.fa-water::before { + content: "\f773"; } + +.fa-water-ladder::before { + content: "\f5c5"; } + +.fa-ladder-water::before { + content: "\f5c5"; } + +.fa-swimming-pool::before { + content: "\f5c5"; } + +.fa-wave-square::before { + content: "\f83e"; } + +.fa-weight-hanging::before { + content: "\f5cd"; } + +.fa-weight-scale::before { + content: "\f496"; } + +.fa-weight::before { + content: "\f496"; } + +.fa-wheelchair::before { + content: "\f193"; } + +.fa-whiskey-glass::before { + content: "\f7a0"; } + +.fa-glass-whiskey::before { + content: "\f7a0"; } + +.fa-wifi::before { + content: "\f1eb"; } + +.fa-wifi-3::before { + content: "\f1eb"; } + +.fa-wifi-strong::before { + content: "\f1eb"; } + +.fa-wind::before { + content: "\f72e"; } + +.fa-window-maximize::before { + content: "\f2d0"; } + +.fa-window-minimize::before { + content: "\f2d1"; } + +.fa-window-restore::before { + content: "\f2d2"; } + +.fa-wine-bottle::before { + content: "\f72f"; } + +.fa-wine-glass::before { + content: "\f4e3"; } + +.fa-wine-glass-empty::before { + content: "\f5ce"; } + +.fa-wine-glass-alt::before { + content: "\f5ce"; } + +.fa-won-sign::before { + content: "\f159"; } + +.fa-krw::before { + content: "\f159"; } + +.fa-won::before { + content: "\f159"; } + +.fa-wrench::before { + content: "\f0ad"; } + +.fa-x::before { + content: "\58"; } + +.fa-x-ray::before { + content: "\f497"; } + +.fa-xmark::before { + content: "\f00d"; } + +.fa-close::before { + content: "\f00d"; } + +.fa-multiply::before { + content: "\f00d"; } + +.fa-remove::before { + content: "\f00d"; } + +.fa-times::before { + content: "\f00d"; } + +.fa-y::before { + content: "\59"; } + +.fa-yen-sign::before { + content: "\f157"; } + +.fa-cny::before { + content: "\f157"; } + +.fa-jpy::before { + content: "\f157"; } + +.fa-rmb::before { + content: "\f157"; } + +.fa-yen::before { + content: "\f157"; } + +.fa-yin-yang::before { + content: "\f6ad"; } + +.fa-z::before { + content: "\5a"; } + +.sr-only, +.fa-sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border-width: 0; } + +.sr-only-focusable:not(:focus), +.fa-sr-only-focusable:not(:focus) { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + border-width: 0; } +:root, :host { + --fa-font-brands: normal 400 1em/1 "Font Awesome 6 Brands"; } + +@font-face { + font-family: 'Font Awesome 6 Brands'; + font-style: normal; + font-weight: 400; + font-display: block; + src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); } + +.fab, +.fa-brands { + font-family: 'Font Awesome 6 Brands'; + font-weight: 400; } + +.fa-42-group:before { + content: "\e080"; } + +.fa-innosoft:before { + content: "\e080"; } + +.fa-500px:before { + content: "\f26e"; } + +.fa-accessible-icon:before { + content: "\f368"; } + +.fa-accusoft:before { + content: "\f369"; } + +.fa-acquisitions-incorporated:before { + content: "\f6af"; } + +.fa-adn:before { + content: "\f170"; } + +.fa-adversal:before { + content: "\f36a"; } + +.fa-affiliatetheme:before { + content: "\f36b"; } + +.fa-airbnb:before { + content: "\f834"; } + +.fa-algolia:before { + content: "\f36c"; } + +.fa-alipay:before { + content: "\f642"; } + +.fa-amazon:before { + content: "\f270"; } + +.fa-amazon-pay:before { + content: "\f42c"; } + +.fa-amilia:before { + content: "\f36d"; } + +.fa-android:before { + content: "\f17b"; } + +.fa-angellist:before { + content: "\f209"; } + +.fa-angrycreative:before { + content: "\f36e"; } + +.fa-angular:before { + content: "\f420"; } + +.fa-app-store:before { + content: "\f36f"; } + +.fa-app-store-ios:before { + content: "\f370"; } + +.fa-apper:before { + content: "\f371"; } + +.fa-apple:before { + content: "\f179"; } + +.fa-apple-pay:before { + content: "\f415"; } + +.fa-artstation:before { + content: "\f77a"; } + +.fa-asymmetrik:before { + content: "\f372"; } + +.fa-atlassian:before { + content: "\f77b"; } + +.fa-audible:before { + content: "\f373"; } + +.fa-autoprefixer:before { + content: "\f41c"; } + +.fa-avianex:before { + content: "\f374"; } + +.fa-aviato:before { + content: "\f421"; } + +.fa-aws:before { + content: "\f375"; } + +.fa-bandcamp:before { + content: "\f2d5"; } + +.fa-battle-net:before { + content: "\f835"; } + +.fa-behance:before { + content: "\f1b4"; } + +.fa-behance-square:before { + content: "\f1b5"; } + +.fa-bilibili:before { + content: "\e3d9"; } + +.fa-bimobject:before { + content: "\f378"; } + +.fa-bitbucket:before { + content: "\f171"; } + +.fa-bitcoin:before { + content: "\f379"; } + +.fa-bity:before { + content: "\f37a"; } + +.fa-black-tie:before { + content: "\f27e"; } + +.fa-blackberry:before { + content: "\f37b"; } + +.fa-blogger:before { + content: "\f37c"; } + +.fa-blogger-b:before { + content: "\f37d"; } + +.fa-bluetooth:before { + content: "\f293"; } + +.fa-bluetooth-b:before { + content: "\f294"; } + +.fa-bootstrap:before { + content: "\f836"; } + +.fa-bots:before { + content: "\e340"; } + +.fa-btc:before { + content: "\f15a"; } + +.fa-buffer:before { + content: "\f837"; } + +.fa-buromobelexperte:before { + content: "\f37f"; } + +.fa-buy-n-large:before { + content: "\f8a6"; } + +.fa-buysellads:before { + content: "\f20d"; } + +.fa-canadian-maple-leaf:before { + content: "\f785"; } + +.fa-cc-amazon-pay:before { + content: "\f42d"; } + +.fa-cc-amex:before { + content: "\f1f3"; } + +.fa-cc-apple-pay:before { + content: "\f416"; } + +.fa-cc-diners-club:before { + content: "\f24c"; } + +.fa-cc-discover:before { + content: "\f1f2"; } + +.fa-cc-jcb:before { + content: "\f24b"; } + +.fa-cc-mastercard:before { + content: "\f1f1"; } + +.fa-cc-paypal:before { + content: "\f1f4"; } + +.fa-cc-stripe:before { + content: "\f1f5"; } + +.fa-cc-visa:before { + content: "\f1f0"; } + +.fa-centercode:before { + content: "\f380"; } + +.fa-centos:before { + content: "\f789"; } + +.fa-chrome:before { + content: "\f268"; } + +.fa-chromecast:before { + content: "\f838"; } + +.fa-cloudflare:before { + content: "\e07d"; } + +.fa-cloudscale:before { + content: "\f383"; } + +.fa-cloudsmith:before { + content: "\f384"; } + +.fa-cloudversify:before { + content: "\f385"; } + +.fa-cmplid:before { + content: "\e360"; } + +.fa-codepen:before { + content: "\f1cb"; } + +.fa-codiepie:before { + content: "\f284"; } + +.fa-confluence:before { + content: "\f78d"; } + +.fa-connectdevelop:before { + content: "\f20e"; } + +.fa-contao:before { + content: "\f26d"; } + +.fa-cotton-bureau:before { + content: "\f89e"; } + +.fa-cpanel:before { + content: "\f388"; } + +.fa-creative-commons:before { + content: "\f25e"; } + +.fa-creative-commons-by:before { + content: "\f4e7"; } + +.fa-creative-commons-nc:before { + content: "\f4e8"; } + +.fa-creative-commons-nc-eu:before { + content: "\f4e9"; } + +.fa-creative-commons-nc-jp:before { + content: "\f4ea"; } + +.fa-creative-commons-nd:before { + content: "\f4eb"; } + +.fa-creative-commons-pd:before { + content: "\f4ec"; } + +.fa-creative-commons-pd-alt:before { + content: "\f4ed"; } + +.fa-creative-commons-remix:before { + content: "\f4ee"; } + +.fa-creative-commons-sa:before { + content: "\f4ef"; } + +.fa-creative-commons-sampling:before { + content: "\f4f0"; } + +.fa-creative-commons-sampling-plus:before { + content: "\f4f1"; } + +.fa-creative-commons-share:before { + content: "\f4f2"; } + +.fa-creative-commons-zero:before { + content: "\f4f3"; } + +.fa-critical-role:before { + content: "\f6c9"; } + +.fa-css3:before { + content: "\f13c"; } + +.fa-css3-alt:before { + content: "\f38b"; } + +.fa-cuttlefish:before { + content: "\f38c"; } + +.fa-d-and-d:before { + content: "\f38d"; } + +.fa-d-and-d-beyond:before { + content: "\f6ca"; } + +.fa-dailymotion:before { + content: "\e052"; } + +.fa-dashcube:before { + content: "\f210"; } + +.fa-deezer:before { + content: "\e077"; } + +.fa-delicious:before { + content: "\f1a5"; } + +.fa-deploydog:before { + content: "\f38e"; } + +.fa-deskpro:before { + content: "\f38f"; } + +.fa-dev:before { + content: "\f6cc"; } + +.fa-deviantart:before { + content: "\f1bd"; } + +.fa-dhl:before { + content: "\f790"; } + +.fa-diaspora:before { + content: "\f791"; } + +.fa-digg:before { + content: "\f1a6"; } + +.fa-digital-ocean:before { + content: "\f391"; } + +.fa-discord:before { + content: "\f392"; } + +.fa-discourse:before { + content: "\f393"; } + +.fa-dochub:before { + content: "\f394"; } + +.fa-docker:before { + content: "\f395"; } + +.fa-draft2digital:before { + content: "\f396"; } + +.fa-dribbble:before { + content: "\f17d"; } + +.fa-dribbble-square:before { + content: "\f397"; } + +.fa-dropbox:before { + content: "\f16b"; } + +.fa-drupal:before { + content: "\f1a9"; } + +.fa-dyalog:before { + content: "\f399"; } + +.fa-earlybirds:before { + content: "\f39a"; } + +.fa-ebay:before { + content: "\f4f4"; } + +.fa-edge:before { + content: "\f282"; } + +.fa-edge-legacy:before { + content: "\e078"; } + +.fa-elementor:before { + content: "\f430"; } + +.fa-ello:before { + content: "\f5f1"; } + +.fa-ember:before { + content: "\f423"; } + +.fa-empire:before { + content: "\f1d1"; } + +.fa-envira:before { + content: "\f299"; } + +.fa-erlang:before { + content: "\f39d"; } + +.fa-ethereum:before { + content: "\f42e"; } + +.fa-etsy:before { + content: "\f2d7"; } + +.fa-evernote:before { + content: "\f839"; } + +.fa-expeditedssl:before { + content: "\f23e"; } + +.fa-facebook:before { + content: "\f09a"; } + +.fa-facebook-f:before { + content: "\f39e"; } + +.fa-facebook-messenger:before { + content: "\f39f"; } + +.fa-facebook-square:before { + content: "\f082"; } + +.fa-fantasy-flight-games:before { + content: "\f6dc"; } + +.fa-fedex:before { + content: "\f797"; } + +.fa-fedora:before { + content: "\f798"; } + +.fa-figma:before { + content: "\f799"; } + +.fa-firefox:before { + content: "\f269"; } + +.fa-firefox-browser:before { + content: "\e007"; } + +.fa-first-order:before { + content: "\f2b0"; } + +.fa-first-order-alt:before { + content: "\f50a"; } + +.fa-firstdraft:before { + content: "\f3a1"; } + +.fa-flickr:before { + content: "\f16e"; } + +.fa-flipboard:before { + content: "\f44d"; } + +.fa-fly:before { + content: "\f417"; } + +.fa-font-awesome:before { + content: "\f2b4"; } + +.fa-font-awesome-flag:before { + content: "\f2b4"; } + +.fa-font-awesome-logo-full:before { + content: "\f2b4"; } + +.fa-fonticons:before { + content: "\f280"; } + +.fa-fonticons-fi:before { + content: "\f3a2"; } + +.fa-fort-awesome:before { + content: "\f286"; } + +.fa-fort-awesome-alt:before { + content: "\f3a3"; } + +.fa-forumbee:before { + content: "\f211"; } + +.fa-foursquare:before { + content: "\f180"; } + +.fa-free-code-camp:before { + content: "\f2c5"; } + +.fa-freebsd:before { + content: "\f3a4"; } + +.fa-fulcrum:before { + content: "\f50b"; } + +.fa-galactic-republic:before { + content: "\f50c"; } + +.fa-galactic-senate:before { + content: "\f50d"; } + +.fa-get-pocket:before { + content: "\f265"; } + +.fa-gg:before { + content: "\f260"; } + +.fa-gg-circle:before { + content: "\f261"; } + +.fa-git:before { + content: "\f1d3"; } + +.fa-git-alt:before { + content: "\f841"; } + +.fa-git-square:before { + content: "\f1d2"; } + +.fa-github:before { + content: "\f09b"; } + +.fa-github-alt:before { + content: "\f113"; } + +.fa-github-square:before { + content: "\f092"; } + +.fa-gitkraken:before { + content: "\f3a6"; } + +.fa-gitlab:before { + content: "\f296"; } + +.fa-gitter:before { + content: "\f426"; } + +.fa-glide:before { + content: "\f2a5"; } + +.fa-glide-g:before { + content: "\f2a6"; } + +.fa-gofore:before { + content: "\f3a7"; } + +.fa-golang:before { + content: "\e40f"; } + +.fa-goodreads:before { + content: "\f3a8"; } + +.fa-goodreads-g:before { + content: "\f3a9"; } + +.fa-google:before { + content: "\f1a0"; } + +.fa-google-drive:before { + content: "\f3aa"; } + +.fa-google-pay:before { + content: "\e079"; } + +.fa-google-play:before { + content: "\f3ab"; } + +.fa-google-plus:before { + content: "\f2b3"; } + +.fa-google-plus-g:before { + content: "\f0d5"; } + +.fa-google-plus-square:before { + content: "\f0d4"; } + +.fa-google-wallet:before { + content: "\f1ee"; } + +.fa-gratipay:before { + content: "\f184"; } + +.fa-grav:before { + content: "\f2d6"; } + +.fa-gripfire:before { + content: "\f3ac"; } + +.fa-grunt:before { + content: "\f3ad"; } + +.fa-guilded:before { + content: "\e07e"; } + +.fa-gulp:before { + content: "\f3ae"; } + +.fa-hacker-news:before { + content: "\f1d4"; } + +.fa-hacker-news-square:before { + content: "\f3af"; } + +.fa-hackerrank:before { + content: "\f5f7"; } + +.fa-hips:before { + content: "\f452"; } + +.fa-hire-a-helper:before { + content: "\f3b0"; } + +.fa-hive:before { + content: "\e07f"; } + +.fa-hooli:before { + content: "\f427"; } + +.fa-hornbill:before { + content: "\f592"; } + +.fa-hotjar:before { + content: "\f3b1"; } + +.fa-houzz:before { + content: "\f27c"; } + +.fa-html5:before { + content: "\f13b"; } + +.fa-hubspot:before { + content: "\f3b2"; } + +.fa-ideal:before { + content: "\e013"; } + +.fa-imdb:before { + content: "\f2d8"; } + +.fa-instagram:before { + content: "\f16d"; } + +.fa-instagram-square:before { + content: "\e055"; } + +.fa-instalod:before { + content: "\e081"; } + +.fa-intercom:before { + content: "\f7af"; } + +.fa-internet-explorer:before { + content: "\f26b"; } + +.fa-invision:before { + content: "\f7b0"; } + +.fa-ioxhost:before { + content: "\f208"; } + +.fa-itch-io:before { + content: "\f83a"; } + +.fa-itunes:before { + content: "\f3b4"; } + +.fa-itunes-note:before { + content: "\f3b5"; } + +.fa-java:before { + content: "\f4e4"; } + +.fa-jedi-order:before { + content: "\f50e"; } + +.fa-jenkins:before { + content: "\f3b6"; } + +.fa-jira:before { + content: "\f7b1"; } + +.fa-joget:before { + content: "\f3b7"; } + +.fa-joomla:before { + content: "\f1aa"; } + +.fa-js:before { + content: "\f3b8"; } + +.fa-js-square:before { + content: "\f3b9"; } + +.fa-jsfiddle:before { + content: "\f1cc"; } + +.fa-kaggle:before { + content: "\f5fa"; } + +.fa-keybase:before { + content: "\f4f5"; } + +.fa-keycdn:before { + content: "\f3ba"; } + +.fa-kickstarter:before { + content: "\f3bb"; } + +.fa-kickstarter-k:before { + content: "\f3bc"; } + +.fa-korvue:before { + content: "\f42f"; } + +.fa-laravel:before { + content: "\f3bd"; } + +.fa-lastfm:before { + content: "\f202"; } + +.fa-lastfm-square:before { + content: "\f203"; } + +.fa-leanpub:before { + content: "\f212"; } + +.fa-less:before { + content: "\f41d"; } + +.fa-line:before { + content: "\f3c0"; } + +.fa-linkedin:before { + content: "\f08c"; } + +.fa-linkedin-in:before { + content: "\f0e1"; } + +.fa-linode:before { + content: "\f2b8"; } + +.fa-linux:before { + content: "\f17c"; } + +.fa-lyft:before { + content: "\f3c3"; } + +.fa-magento:before { + content: "\f3c4"; } + +.fa-mailchimp:before { + content: "\f59e"; } + +.fa-mandalorian:before { + content: "\f50f"; } + +.fa-markdown:before { + content: "\f60f"; } + +.fa-mastodon:before { + content: "\f4f6"; } + +.fa-maxcdn:before { + content: "\f136"; } + +.fa-mdb:before { + content: "\f8ca"; } + +.fa-medapps:before { + content: "\f3c6"; } + +.fa-medium:before { + content: "\f23a"; } + +.fa-medium-m:before { + content: "\f23a"; } + +.fa-medrt:before { + content: "\f3c8"; } + +.fa-meetup:before { + content: "\f2e0"; } + +.fa-megaport:before { + content: "\f5a3"; } + +.fa-mendeley:before { + content: "\f7b3"; } + +.fa-microblog:before { + content: "\e01a"; } + +.fa-microsoft:before { + content: "\f3ca"; } + +.fa-mix:before { + content: "\f3cb"; } + +.fa-mixcloud:before { + content: "\f289"; } + +.fa-mixer:before { + content: "\e056"; } + +.fa-mizuni:before { + content: "\f3cc"; } + +.fa-modx:before { + content: "\f285"; } + +.fa-monero:before { + content: "\f3d0"; } + +.fa-napster:before { + content: "\f3d2"; } + +.fa-neos:before { + content: "\f612"; } + +.fa-nimblr:before { + content: "\f5a8"; } + +.fa-node:before { + content: "\f419"; } + +.fa-node-js:before { + content: "\f3d3"; } + +.fa-npm:before { + content: "\f3d4"; } + +.fa-ns8:before { + content: "\f3d5"; } + +.fa-nutritionix:before { + content: "\f3d6"; } + +.fa-octopus-deploy:before { + content: "\e082"; } + +.fa-odnoklassniki:before { + content: "\f263"; } + +.fa-odnoklassniki-square:before { + content: "\f264"; } + +.fa-old-republic:before { + content: "\f510"; } + +.fa-opencart:before { + content: "\f23d"; } + +.fa-openid:before { + content: "\f19b"; } + +.fa-opera:before { + content: "\f26a"; } + +.fa-optin-monster:before { + content: "\f23c"; } + +.fa-orcid:before { + content: "\f8d2"; } + +.fa-osi:before { + content: "\f41a"; } + +.fa-page4:before { + content: "\f3d7"; } + +.fa-pagelines:before { + content: "\f18c"; } + +.fa-palfed:before { + content: "\f3d8"; } + +.fa-patreon:before { + content: "\f3d9"; } + +.fa-paypal:before { + content: "\f1ed"; } + +.fa-penny-arcade:before { + content: "\f704"; } + +.fa-perbyte:before { + content: "\e083"; } + +.fa-periscope:before { + content: "\f3da"; } + +.fa-phabricator:before { + content: "\f3db"; } + +.fa-phoenix-framework:before { + content: "\f3dc"; } + +.fa-phoenix-squadron:before { + content: "\f511"; } + +.fa-php:before { + content: "\f457"; } + +.fa-pied-piper:before { + content: "\f2ae"; } + +.fa-pied-piper-alt:before { + content: "\f1a8"; } + +.fa-pied-piper-hat:before { + content: "\f4e5"; } + +.fa-pied-piper-pp:before { + content: "\f1a7"; } + +.fa-pied-piper-square:before { + content: "\e01e"; } + +.fa-pinterest:before { + content: "\f0d2"; } + +.fa-pinterest-p:before { + content: "\f231"; } + +.fa-pinterest-square:before { + content: "\f0d3"; } + +.fa-pix:before { + content: "\e43a"; } + +.fa-playstation:before { + content: "\f3df"; } + +.fa-product-hunt:before { + content: "\f288"; } + +.fa-pushed:before { + content: "\f3e1"; } + +.fa-python:before { + content: "\f3e2"; } + +.fa-qq:before { + content: "\f1d6"; } + +.fa-quinscape:before { + content: "\f459"; } + +.fa-quora:before { + content: "\f2c4"; } + +.fa-r-project:before { + content: "\f4f7"; } + +.fa-raspberry-pi:before { + content: "\f7bb"; } + +.fa-ravelry:before { + content: "\f2d9"; } + +.fa-react:before { + content: "\f41b"; } + +.fa-reacteurope:before { + content: "\f75d"; } + +.fa-readme:before { + content: "\f4d5"; } + +.fa-rebel:before { + content: "\f1d0"; } + +.fa-red-river:before { + content: "\f3e3"; } + +.fa-reddit:before { + content: "\f1a1"; } + +.fa-reddit-alien:before { + content: "\f281"; } + +.fa-reddit-square:before { + content: "\f1a2"; } + +.fa-redhat:before { + content: "\f7bc"; } + +.fa-renren:before { + content: "\f18b"; } + +.fa-replyd:before { + content: "\f3e6"; } + +.fa-researchgate:before { + content: "\f4f8"; } + +.fa-resolving:before { + content: "\f3e7"; } + +.fa-rev:before { + content: "\f5b2"; } + +.fa-rocketchat:before { + content: "\f3e8"; } + +.fa-rockrms:before { + content: "\f3e9"; } + +.fa-rust:before { + content: "\e07a"; } + +.fa-safari:before { + content: "\f267"; } + +.fa-salesforce:before { + content: "\f83b"; } + +.fa-sass:before { + content: "\f41e"; } + +.fa-schlix:before { + content: "\f3ea"; } + +.fa-scribd:before { + content: "\f28a"; } + +.fa-searchengin:before { + content: "\f3eb"; } + +.fa-sellcast:before { + content: "\f2da"; } + +.fa-sellsy:before { + content: "\f213"; } + +.fa-servicestack:before { + content: "\f3ec"; } + +.fa-shirtsinbulk:before { + content: "\f214"; } + +.fa-shopify:before { + content: "\e057"; } + +.fa-shopware:before { + content: "\f5b5"; } + +.fa-simplybuilt:before { + content: "\f215"; } + +.fa-sistrix:before { + content: "\f3ee"; } + +.fa-sith:before { + content: "\f512"; } + +.fa-sitrox:before { + content: "\e44a"; } + +.fa-sketch:before { + content: "\f7c6"; } + +.fa-skyatlas:before { + content: "\f216"; } + +.fa-skype:before { + content: "\f17e"; } + +.fa-slack:before { + content: "\f198"; } + +.fa-slack-hash:before { + content: "\f198"; } + +.fa-slideshare:before { + content: "\f1e7"; } + +.fa-snapchat:before { + content: "\f2ab"; } + +.fa-snapchat-ghost:before { + content: "\f2ab"; } + +.fa-snapchat-square:before { + content: "\f2ad"; } + +.fa-soundcloud:before { + content: "\f1be"; } + +.fa-sourcetree:before { + content: "\f7d3"; } + +.fa-speakap:before { + content: "\f3f3"; } + +.fa-speaker-deck:before { + content: "\f83c"; } + +.fa-spotify:before { + content: "\f1bc"; } + +.fa-square-font-awesome:before { + content: "\f425"; } + +.fa-square-font-awesome-stroke:before { + content: "\f35c"; } + +.fa-font-awesome-alt:before { + content: "\f35c"; } + +.fa-squarespace:before { + content: "\f5be"; } + +.fa-stack-exchange:before { + content: "\f18d"; } + +.fa-stack-overflow:before { + content: "\f16c"; } + +.fa-stackpath:before { + content: "\f842"; } + +.fa-staylinked:before { + content: "\f3f5"; } + +.fa-steam:before { + content: "\f1b6"; } + +.fa-steam-square:before { + content: "\f1b7"; } + +.fa-steam-symbol:before { + content: "\f3f6"; } + +.fa-sticker-mule:before { + content: "\f3f7"; } + +.fa-strava:before { + content: "\f428"; } + +.fa-stripe:before { + content: "\f429"; } + +.fa-stripe-s:before { + content: "\f42a"; } + +.fa-studiovinari:before { + content: "\f3f8"; } + +.fa-stumbleupon:before { + content: "\f1a4"; } + +.fa-stumbleupon-circle:before { + content: "\f1a3"; } + +.fa-superpowers:before { + content: "\f2dd"; } + +.fa-supple:before { + content: "\f3f9"; } + +.fa-suse:before { + content: "\f7d6"; } + +.fa-swift:before { + content: "\f8e1"; } + +.fa-symfony:before { + content: "\f83d"; } + +.fa-teamspeak:before { + content: "\f4f9"; } + +.fa-telegram:before { + content: "\f2c6"; } + +.fa-telegram-plane:before { + content: "\f2c6"; } + +.fa-tencent-weibo:before { + content: "\f1d5"; } + +.fa-the-red-yeti:before { + content: "\f69d"; } + +.fa-themeco:before { + content: "\f5c6"; } + +.fa-themeisle:before { + content: "\f2b2"; } + +.fa-think-peaks:before { + content: "\f731"; } + +.fa-tiktok:before { + content: "\e07b"; } + +.fa-trade-federation:before { + content: "\f513"; } + +.fa-trello:before { + content: "\f181"; } + +.fa-tumblr:before { + content: "\f173"; } + +.fa-tumblr-square:before { + content: "\f174"; } + +.fa-twitch:before { + content: "\f1e8"; } + +.fa-twitter:before { + content: "\f099"; } + +.fa-twitter-square:before { + content: "\f081"; } + +.fa-typo3:before { + content: "\f42b"; } + +.fa-uber:before { + content: "\f402"; } + +.fa-ubuntu:before { + content: "\f7df"; } + +.fa-uikit:before { + content: "\f403"; } + +.fa-umbraco:before { + content: "\f8e8"; } + +.fa-uncharted:before { + content: "\e084"; } + +.fa-uniregistry:before { + content: "\f404"; } + +.fa-unity:before { + content: "\e049"; } + +.fa-unsplash:before { + content: "\e07c"; } + +.fa-untappd:before { + content: "\f405"; } + +.fa-ups:before { + content: "\f7e0"; } + +.fa-usb:before { + content: "\f287"; } + +.fa-usps:before { + content: "\f7e1"; } + +.fa-ussunnah:before { + content: "\f407"; } + +.fa-vaadin:before { + content: "\f408"; } + +.fa-viacoin:before { + content: "\f237"; } + +.fa-viadeo:before { + content: "\f2a9"; } + +.fa-viadeo-square:before { + content: "\f2aa"; } + +.fa-viber:before { + content: "\f409"; } + +.fa-vimeo:before { + content: "\f40a"; } + +.fa-vimeo-square:before { + content: "\f194"; } + +.fa-vimeo-v:before { + content: "\f27d"; } + +.fa-vine:before { + content: "\f1ca"; } + +.fa-vk:before { + content: "\f189"; } + +.fa-vnv:before { + content: "\f40b"; } + +.fa-vuejs:before { + content: "\f41f"; } + +.fa-watchman-monitoring:before { + content: "\e087"; } + +.fa-waze:before { + content: "\f83f"; } + +.fa-weebly:before { + content: "\f5cc"; } + +.fa-weibo:before { + content: "\f18a"; } + +.fa-weixin:before { + content: "\f1d7"; } + +.fa-whatsapp:before { + content: "\f232"; } + +.fa-whatsapp-square:before { + content: "\f40c"; } + +.fa-whmcs:before { + content: "\f40d"; } + +.fa-wikipedia-w:before { + content: "\f266"; } + +.fa-windows:before { + content: "\f17a"; } + +.fa-wirsindhandwerk:before { + content: "\e2d0"; } + +.fa-wsh:before { + content: "\e2d0"; } + +.fa-wix:before { + content: "\f5cf"; } + +.fa-wizards-of-the-coast:before { + content: "\f730"; } + +.fa-wodu:before { + content: "\e088"; } + +.fa-wolf-pack-battalion:before { + content: "\f514"; } + +.fa-wordpress:before { + content: "\f19a"; } + +.fa-wordpress-simple:before { + content: "\f411"; } + +.fa-wpbeginner:before { + content: "\f297"; } + +.fa-wpexplorer:before { + content: "\f2de"; } + +.fa-wpforms:before { + content: "\f298"; } + +.fa-wpressr:before { + content: "\f3e4"; } + +.fa-xbox:before { + content: "\f412"; } + +.fa-xing:before { + content: "\f168"; } + +.fa-xing-square:before { + content: "\f169"; } + +.fa-y-combinator:before { + content: "\f23b"; } + +.fa-yahoo:before { + content: "\f19e"; } + +.fa-yammer:before { + content: "\f840"; } + +.fa-yandex:before { + content: "\f413"; } + +.fa-yandex-international:before { + content: "\f414"; } + +.fa-yarn:before { + content: "\f7e3"; } + +.fa-yelp:before { + content: "\f1e9"; } + +.fa-yoast:before { + content: "\f2b1"; } + +.fa-youtube:before { + content: "\f167"; } + +.fa-youtube-square:before { + content: "\f431"; } + +.fa-zhihu:before { + content: "\f63f"; } +:root, :host { + --fa-font-regular: normal 400 1em/1 "Font Awesome 6 Free"; } + +@font-face { + font-family: 'Font Awesome 6 Free'; + font-style: normal; + font-weight: 400; + font-display: block; + src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); } + +.far, +.fa-regular { + font-family: 'Font Awesome 6 Free'; + font-weight: 400; } +:root, :host { + --fa-font-solid: normal 900 1em/1 "Font Awesome 6 Free"; } + +@font-face { + font-family: 'Font Awesome 6 Free'; + font-style: normal; + font-weight: 900; + font-display: block; + src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); } + +.fas, +.fa-solid { + font-family: 'Font Awesome 6 Free'; + font-weight: 900; } +@font-face { + font-family: "Font Awesome 5 Brands"; + font-display: block; + font-weight: 400; + src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); } + +@font-face { + font-family: "Font Awesome 5 Free"; + font-display: block; + font-weight: 900; + src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); } + +@font-face { + font-family: "Font Awesome 5 Free"; + font-display: block; + font-weight: 400; + src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); } +@font-face { + font-family: "FontAwesome"; + font-display: block; + src: url("../webfonts/fa-solid-900.woff2") format("woff2"), url("../webfonts/fa-solid-900.ttf") format("truetype"); } + +@font-face { + font-family: "FontAwesome"; + font-display: block; + src: url("../webfonts/fa-brands-400.woff2") format("woff2"), url("../webfonts/fa-brands-400.ttf") format("truetype"); } + +@font-face { + font-family: "FontAwesome"; + font-display: block; + src: url("../webfonts/fa-regular-400.woff2") format("woff2"), url("../webfonts/fa-regular-400.ttf") format("truetype"); + unicode-range: U+F003,U+F006,U+F014,U+F016-F017,U+F01A-F01B,U+F01D,U+F022,U+F03E,U+F044,U+F046,U+F05C-F05D,U+F06E,U+F070,U+F087-F088,U+F08A,U+F094,U+F096-F097,U+F09D,U+F0A0,U+F0A2,U+F0A4-F0A7,U+F0C5,U+F0C7,U+F0E5-F0E6,U+F0EB,U+F0F6-F0F8,U+F10C,U+F114-F115,U+F118-F11A,U+F11C-F11D,U+F133,U+F147,U+F14E,U+F150-F152,U+F185-F186,U+F18E,U+F190-F192,U+F196,U+F1C1-F1C9,U+F1D9,U+F1DB,U+F1E3,U+F1EA,U+F1F7,U+F1F9,U+F20A,U+F247-F248,U+F24A,U+F24D,U+F255-F25B,U+F25D,U+F271-F274,U+F278,U+F27B,U+F28C,U+F28E,U+F29C,U+F2B5,U+F2B7,U+F2BA,U+F2BC,U+F2BE,U+F2C0-F2C1,U+F2C3,U+F2D0,U+F2D2,U+F2D4,U+F2DC; } + +@font-face { + font-family: "FontAwesome"; + font-display: block; + src: url("../webfonts/fa-v4compatibility.woff2") format("woff2"), url("../webfonts/fa-v4compatibility.ttf") format("truetype"); + unicode-range: U+F041,U+F047,U+F065-F066,U+F07D-F07E,U+F080,U+F08B,U+F08E,U+F090,U+F09A,U+F0AC,U+F0AE,U+F0B2,U+F0D0,U+F0D6,U+F0E4,U+F0EC,U+F10A-F10B,U+F123,U+F13E,U+F148-F149,U+F14C,U+F156,U+F15E,U+F160-F161,U+F163,U+F175-F178,U+F195,U+F1F8,U+F219,U+F250,U+F252,U+F27A; } diff --git a/assets/css/invesvpo-style.css b/assets/css/invesvpo-style.css new file mode 100644 index 0000000..a3102f4 --- /dev/null +++ b/assets/css/invesvpo-style.css @@ -0,0 +1,248 @@ +/* --------------------------------------------- +Table of contents +------------------------------------------------ +01. font & reset css +02. reset +03. global styles +04. header +05. banner + +--------------------------------------------- */ +/* +--------------------------------------------- +font & reset css +--------------------------------------------- +*/ +@import url("https://fonts.googleapis.com/css2?family=Poppins:wght@100;200;300;400;500;600;700;800;900"); +/* +--------------------------------------------- +reset +--------------------------------------------- +*/ +html, body, div, span, h1, h2, h3, h4, h5, h6, p, div +a, font, img, center, header, nav{ + margin: 0; + padding: 0; + border: 0; + outline: 0; +} + +a { + color: #ec7090; + text-decoration: none !important; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0px; + margin-bottom: 0px; + color: #fff; + font-weight: 700; +} + + +img { + width: 100%; + overflow: hidden; +} + +/* +--------------------------------------------- +Global Styles +--------------------------------------------- +*/ +html, +body { + background: #141414; + font-family: 'Poppins', sans-serif; +} + +body .page-content { + margin-top: 110px; + background-color: #27292a; + padding: 60px; + border-radius: 23px; +} + +.main-button a { + font-size: 14px; + color: #fff; + background-color: #e75e8d; + padding: 12px 30px; + display: inline-block; + border-radius: 25px; + font-weight: 400; + text-transform: capitalize; + letter-spacing: 0.5px; + transition: all .3s; + position: relative; + overflow: hidden; +} + +.main-button a:hover { + background-color: #fff; + color: #e75e8d; +} + +.main-border-button a { + font-size: 14px; + color: #ec6090; + background-color: transparent; + border: 1px solid #ec6090; + padding: 12px 30px; + display: inline-block; + border-radius: 25px; + font-weight: 400; + text-transform: capitalize; + letter-spacing: 0.5px; + transition: all .3s; + position: relative; + overflow: hidden; +} + +.main-border-button a:hover { + border-color: #fff; + background-color: #fff; + color: #e75e8d; +} + +.heading-section h4 { + color: #ec6090; + font-size: 34px; + text-decoration: none; + margin-bottom: 30px; +} + +.heading-section h4 em { + color: #fff; + font-style: normal; + text-decoration: underline; +} + +/* +--------------------------------------------- +Banner Style +--------------------------------------------- +*/ + +.main-banner { + background-image: url(../images/banner-pic.jpg); + background-position: center center; + background-size: cover; + min-height: 380px; + border-radius: 23px; + padding: 80px 60px; + box-shadow: 0 0 10px rgba(140, 20, 252, 1); +} + +.main-banner h6 { + font-size: 20px; + color: #fff; + font-weight: 400; + margin-bottom: 25px; +} + +.main-banner h4 { + font-size: 45px; + text-transform: uppercase; + margin-bottom: 25px; +} + +.main-banner h4 em { + font-style: normal; + color: #ec6090; +} + +/* +--------------------------------------------- +Popular Style +--------------------------------------------- +*/ + +.most-popular { + margin-top: 60px; + padding: 30px; + background-color: #1f2122; + border-radius: 23px; + box-shadow: 0 0 10px rgba(140, 20, 252, 0.5); +} + +.most-popular .item { + background-color: #27292a; + padding: 30px 15px; + border-radius: 23px; + margin-bottom: 30px; +} + +.most-popular .item .item { + padding: 0px; + border-radius: 0px; + background-color: transparent; + margin-bottom: 0px; +} + +.most-popular .item img { + border-radius: 23px; +} + +.most-popular .item h4 { + font-size: 15px; + margin-top: 20px; + margin-bottom: 0px; + display: inline-block; +} + +.most-popular .item span { + color: #666; + display: block; + margin-top: 7px; + font-weight: 400; +} + +.most-popular .item ul { + float: right; + margin-top: 20px; +} + +.most-popular .item ul li { + text-align: right; + color: #fff; + font-size: 14px; +} + +.most-popular .item ul li:first-child i { + color: yellow; +} + +.most-popular .item ul li:last-child i { + color: #ec6090; +} + +.most-popular .main-button { + text-align: center; + margin-bottom: -53px; +} + + +.social-links { + display: flex; + justify-content: center; + align-items: center; + flex-wrap: wrap; +} + +.social-links a { + display: flex; + flex-direction: column; + align-items: center; + text-align: center; + margin: 10px; +} + +.social-links a i { + font-size: 50px; + margin-bottom: 5px; +} + +.social-links a span { + font-size: 14px; +} \ No newline at end of file diff --git a/assets/css/invesvpo-style.css.bak b/assets/css/invesvpo-style.css.bak new file mode 100644 index 0000000..a3c002e --- /dev/null +++ b/assets/css/invesvpo-style.css.bak @@ -0,0 +1,235 @@ +/* --------------------------------------------- +Table of contents +------------------------------------------------ +01. font & reset css +02. reset +03. global styles +04. header +05. banner + +--------------------------------------------- */ +/* +--------------------------------------------- +font & reset css +--------------------------------------------- +*/ +@import url("https://fonts.googleapis.com/css2?family=Poppins:wght@100;200;300;400;500;600;700;800;900"); +/* +--------------------------------------------- +reset +--------------------------------------------- +*/ +html, body, div, span, h1, h2, h3, h4, h5, h6, p, div +a, font, img, center, header, nav{ + margin: 0; + padding: 0; + border: 0; + outline: 0; +} + +a { + color: #ec7090; + text-decoration: none !important; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0px; + margin-bottom: 0px; + color: #fff; + font-weight: 700; +} + + +img { + width: 100%; + overflow: hidden; +} + +/* +--------------------------------------------- +Global Styles +--------------------------------------------- +*/ +html, +body { + background: #141414; + font-family: 'Poppins', sans-serif; +} + +body .page-content { + margin-top: 110px; + background-color: #27292a; + padding: 60px; + border-radius: 23px; +} + +.main-button a { + font-size: 14px; + color: #fff; + background-color: #e75e8d; + padding: 12px 30px; + display: inline-block; + border-radius: 25px; + font-weight: 400; + text-transform: capitalize; + letter-spacing: 0.5px; + transition: all .3s; + position: relative; + overflow: hidden; +} + +.main-button a:hover { + background-color: #fff; + color: #e75e8d; +} + +.main-border-button a { + font-size: 14px; + color: #ec6090; + background-color: transparent; + border: 1px solid #ec6090; + padding: 12px 30px; + display: inline-block; + border-radius: 25px; + font-weight: 400; + text-transform: capitalize; + letter-spacing: 0.5px; + transition: all .3s; + position: relative; + overflow: hidden; +} + +.main-border-button a:hover { + border-color: #fff; + background-color: #fff; + color: #e75e8d; +} + +/* +--------------------------------------------- +Banner Style +--------------------------------------------- +*/ + +.main-banner { + background-image: url(../images/banner-pic.jpg); + background-position: center center; + background-size: cover; + min-height: 380px; + border-radius: 23px; + padding: 80px 60px; + box-shadow: 0 0 10px rgba(140, 20, 252, 1); +} + +.main-banner h6 { + font-size: 20px; + color: #fff; + font-weight: 400; + margin-bottom: 25px; +} + +.main-banner h4 { + font-size: 45px; + text-transform: uppercase; + margin-bottom: 25px; +} + +.main-banner h4 em { + font-style: normal; + color: #ec6090; +} + +/* +--------------------------------------------- +Popular Style +--------------------------------------------- +*/ + +.most-popular { + margin-top: 60px; + padding: 30px; + background-color: #1f2122; + border-radius: 23px; + box-shadow: 0 0 10px rgba(140, 20, 252, 0.5); +} + +.most-popular .item { + background-color: #27292a; + padding: 30px 15px; + border-radius: 23px; + margin-bottom: 30px; +} + +.most-popular .item .item { + padding: 0px; + border-radius: 0px; + background-color: transparent; + margin-bottom: 0px; +} + +.most-popular .item img { + border-radius: 23px; +} + +.most-popular .item h4 { + font-size: 15px; + margin-top: 20px; + margin-bottom: 0px; + display: inline-block; +} + +.most-popular .item span { + color: #666; + display: block; + margin-top: 7px; + font-weight: 400; +} + +.most-popular .item ul { + float: right; + margin-top: 20px; +} + +.most-popular .item ul li { + text-align: right; + color: #fff; + font-size: 14px; +} + +.most-popular .item ul li:first-child i { + color: yellow; +} + +.most-popular .item ul li:last-child i { + color: #ec6090; +} + +.most-popular .main-button { + text-align: center; + margin-bottom: -53px; +} + + +.social-links { + display: flex; + justify-content: center; + align-items: center; + flex-wrap: wrap; +} + +.social-links a { + display: flex; + flex-direction: column; + align-items: center; + text-align: center; + margin: 10px; +} + +.social-links a i { + font-size: 50px; + margin-bottom: 5px; +} + +.social-links a span { + font-size: 14px; +} \ No newline at end of file diff --git a/assets/images/LOST.jpg b/assets/images/LOST.jpg new file mode 100644 index 0000000..7741e14 Binary files /dev/null and b/assets/images/LOST.jpg differ diff --git a/assets/images/SyrupSauce.jpg b/assets/images/SyrupSauce.jpg new file mode 100644 index 0000000..41c1a87 Binary files /dev/null and b/assets/images/SyrupSauce.jpg differ diff --git a/assets/images/TTS.jpg b/assets/images/TTS.jpg new file mode 100644 index 0000000..e813eed Binary files /dev/null and b/assets/images/TTS.jpg differ diff --git a/assets/images/WASTEDTIME.jpg b/assets/images/WASTEDTIME.jpg new file mode 100644 index 0000000..d02986b Binary files /dev/null and b/assets/images/WASTEDTIME.jpg differ diff --git a/assets/images/background-pic.jpg b/assets/images/background-pic.jpg new file mode 100644 index 0000000..214e73d Binary files /dev/null and b/assets/images/background-pic.jpg differ diff --git a/assets/images/banner-pic 1.jpg b/assets/images/banner-pic 1.jpg new file mode 100644 index 0000000..5f34219 Binary files /dev/null and b/assets/images/banner-pic 1.jpg differ diff --git a/assets/images/banner-pic.jpg b/assets/images/banner-pic.jpg new file mode 100644 index 0000000..448bafc Binary files /dev/null and b/assets/images/banner-pic.jpg differ diff --git a/assets/images/invesvpo-logo.jpg b/assets/images/invesvpo-logo.jpg new file mode 100644 index 0000000..5e24920 Binary files /dev/null and b/assets/images/invesvpo-logo.jpg differ diff --git a/assets/images/socials-avatar.jpg b/assets/images/socials-avatar.jpg new file mode 100644 index 0000000..b567c44 Binary files /dev/null and b/assets/images/socials-avatar.jpg differ diff --git a/assets/webfonts/fa-brands-400.ttf b/assets/webfonts/fa-brands-400.ttf new file mode 100644 index 0000000..50210eb Binary files /dev/null and b/assets/webfonts/fa-brands-400.ttf differ diff --git a/assets/webfonts/fa-brands-400.woff2 b/assets/webfonts/fa-brands-400.woff2 new file mode 100644 index 0000000..0619fc1 Binary files /dev/null and b/assets/webfonts/fa-brands-400.woff2 differ diff --git a/assets/webfonts/fa-regular-400.ttf b/assets/webfonts/fa-regular-400.ttf new file mode 100644 index 0000000..544d28d Binary files /dev/null and b/assets/webfonts/fa-regular-400.ttf differ diff --git a/assets/webfonts/fa-regular-400.woff2 b/assets/webfonts/fa-regular-400.woff2 new file mode 100644 index 0000000..1f8ddab Binary files /dev/null and b/assets/webfonts/fa-regular-400.woff2 differ diff --git a/assets/webfonts/fa-solid-900.ttf b/assets/webfonts/fa-solid-900.ttf new file mode 100644 index 0000000..4763647 Binary files /dev/null and b/assets/webfonts/fa-solid-900.ttf differ diff --git a/assets/webfonts/fa-solid-900.woff2 b/assets/webfonts/fa-solid-900.woff2 new file mode 100644 index 0000000..b421518 Binary files /dev/null and b/assets/webfonts/fa-solid-900.woff2 differ diff --git a/assets/webfonts/fa-v4compatibility.ttf b/assets/webfonts/fa-v4compatibility.ttf new file mode 100644 index 0000000..49cd436 Binary files /dev/null and b/assets/webfonts/fa-v4compatibility.ttf differ diff --git a/assets/webfonts/fa-v4compatibility.woff2 b/assets/webfonts/fa-v4compatibility.woff2 new file mode 100644 index 0000000..1f2ef7c Binary files /dev/null and b/assets/webfonts/fa-v4compatibility.woff2 differ diff --git a/components/head.js b/components/head.js deleted file mode 100644 index ec4f674..0000000 --- a/components/head.js +++ /dev/null @@ -1,11 +0,0 @@ -import Head from 'next/head' - -export default function HeadComponent() { - return ( -
- - - -
- ) -} \ No newline at end of file diff --git a/components/menu.js b/components/menu.js deleted file mode 100644 index dcb5b0a..0000000 --- a/components/menu.js +++ /dev/null @@ -1,21 +0,0 @@ -export default function Menu() { - return ( -
- - -
- Home - // - Music Feed {`<>`} - // - Models {`<>`} -
-
- ) -} \ No newline at end of file diff --git a/index.html b/index.html new file mode 100644 index 0000000..56447cd --- /dev/null +++ b/index.html @@ -0,0 +1,122 @@ + + + + + + + + + + + Invesvpo | Website + + + + + + + + + + +
+
+
+
+
+
+
Welcome to
+

Invesvpo's website

+
+
+ + + +
+
+
+
+ + + + + + + diff --git a/package-lock.json b/package-lock.json deleted file mode 100644 index 1557aec..0000000 --- a/package-lock.json +++ /dev/null @@ -1,4817 +0,0 @@ -{ - "name": "nextjs", - "version": "0.1.0", - "lockfileVersion": 2, - "requires": true, - "packages": { - "": { - "name": "nextjs", - "version": "0.1.0", - "dependencies": { - "@fortawesome/fontawesome-free": "^5.15.3", - "@fortawesome/fontawesome-svg-core": "^1.2.35", - "@fortawesome/free-brands-svg-icons": "^5.15.3", - "@fortawesome/free-solid-svg-icons": "^5.15.3", - "@fortawesome/react-fontawesome": "^0.1.14", - "next": "10.x", - "react": "17.x", - "react-dom": "17.x" - } - }, - "node_modules/@babel/code-frame": { - "version": "7.12.11", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.12.11.tgz", - "integrity": "sha512-Zt1yodBx1UcyiePMSkWnU4hPqhwq7hGi2nFL1LeA3EUl+q2LQx16MISgJ0+z7dnmgvP9QtIleuETGOiOH1RcIw==", - "dependencies": { - "@babel/highlight": "^7.10.4" - } - }, - "node_modules/@babel/helper-validator-identifier": { - "version": "7.14.5", - "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.14.5.tgz", - "integrity": "sha512-5lsetuxCLilmVGyiLEfoHBRX8UCFD+1m2x3Rj97WrW3V7H3u4RWRXA4evMjImCsin2J2YT0QaVDGf+z8ondbAg==", - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/highlight": { - "version": "7.14.5", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.14.5.tgz", - "integrity": "sha512-qf9u2WFWVV0MppaL877j2dBtQIDgmidgjGk5VIMw3OadXvYaXn66U1BFlH2t4+t3i+8PhedppRv+i40ABzd+gg==", - "dependencies": { - "@babel/helper-validator-identifier": "^7.14.5", - "chalk": "^2.0.0", - "js-tokens": "^4.0.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/runtime": { - "version": "7.12.5", - "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.12.5.tgz", - "integrity": "sha512-plcc+hbExy3McchJCEQG3knOsuh3HH+Prx1P6cLIkET/0dLuQDEnrT+s27Axgc9bqfsmNUNHfscgMUdBpC9xfg==", - "dependencies": { - "regenerator-runtime": "^0.13.4" - } - }, - "node_modules/@babel/types": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.3.tgz", - "integrity": "sha512-jBD+G8+LWpMBBWvVcdr4QysjUE4mU/syrhN17o1u3gx0/WzJB1kwiVZAXRtWbsIPOwW8pF/YJV5+nmetPzepXg==", - "dependencies": { - "esutils": "^2.0.2", - "lodash": "^4.17.13", - "to-fast-properties": "^2.0.0" - } - }, - "node_modules/@fortawesome/fontawesome-common-types": { - "version": "0.2.35", - "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-common-types/-/fontawesome-common-types-0.2.35.tgz", - "integrity": "sha512-IHUfxSEDS9dDGqYwIW7wTN6tn/O8E0n5PcAHz9cAaBoZw6UpG20IG/YM3NNLaGPwPqgjBAFjIURzqoQs3rrtuw==", - "hasInstallScript": true, - "engines": { - "node": ">=6" - } - }, - "node_modules/@fortawesome/fontawesome-free": { - "version": "5.15.3", - "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-free/-/fontawesome-free-5.15.3.tgz", - "integrity": "sha512-rFnSUN/QOtnOAgqFRooTA3H57JLDm0QEG/jPdk+tLQNL/eWd+Aok8g3qCI+Q1xuDPWpGW/i9JySpJVsq8Q0s9w==", - "hasInstallScript": true, - "engines": { - "node": ">=6" - } - }, - "node_modules/@fortawesome/fontawesome-svg-core": { - "version": "1.2.35", - "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-svg-core/-/fontawesome-svg-core-1.2.35.tgz", - "integrity": "sha512-uLEXifXIL7hnh2sNZQrIJWNol7cTVIzwI+4qcBIq9QWaZqUblm0IDrtSqbNg+3SQf8SMGHkiSigD++rHmCHjBg==", - "hasInstallScript": true, - "dependencies": { - "@fortawesome/fontawesome-common-types": "^0.2.35" - }, - "engines": { - "node": ">=6" - } - }, - "node_modules/@fortawesome/free-brands-svg-icons": { - "version": "5.15.3", - "resolved": "https://registry.npmjs.org/@fortawesome/free-brands-svg-icons/-/free-brands-svg-icons-5.15.3.tgz", - "integrity": "sha512-1hirPcbjj72ZJtFvdnXGPbAbpn3Ox6mH3g5STbANFp3vGSiE5u5ingAKV06mK6ZVqNYxUPlh4DlTnaIvLtF2kw==", - "hasInstallScript": true, - "dependencies": { - "@fortawesome/fontawesome-common-types": "^0.2.35" - }, - "engines": { - "node": ">=6" - } - }, - "node_modules/@fortawesome/free-solid-svg-icons": { - "version": "5.15.3", - "resolved": "https://registry.npmjs.org/@fortawesome/free-solid-svg-icons/-/free-solid-svg-icons-5.15.3.tgz", - "integrity": "sha512-XPeeu1IlGYqz4VWGRAT5ukNMd4VHUEEJ7ysZ7pSSgaEtNvSo+FLurybGJVmiqkQdK50OkSja2bfZXOeyMGRD8Q==", - "hasInstallScript": true, - "dependencies": { - "@fortawesome/fontawesome-common-types": "^0.2.35" - }, - "engines": { - "node": ">=6" - } - }, - "node_modules/@fortawesome/react-fontawesome": { - "version": "0.1.14", - "resolved": "https://registry.npmjs.org/@fortawesome/react-fontawesome/-/react-fontawesome-0.1.14.tgz", - "integrity": "sha512-4wqNb0gRLVaBm/h+lGe8UfPPivcbuJ6ecI4hIgW0LjI7kzpYB9FkN0L9apbVzg+lsBdcTf0AlBtODjcSX5mmKA==", - "dependencies": { - "prop-types": "^15.7.2" - }, - "peerDependencies": { - "@fortawesome/fontawesome-svg-core": "^1.2.32", - "react": ">=16.x" - } - }, - "node_modules/@hapi/accept": { - "version": "5.0.2", - "resolved": "https://registry.npmjs.org/@hapi/accept/-/accept-5.0.2.tgz", - "integrity": "sha512-CmzBx/bXUR8451fnZRuZAJRlzgm0Jgu5dltTX/bszmR2lheb9BpyN47Q1RbaGTsvFzn0PXAEs+lXDKfshccYZw==", - "dependencies": { - "@hapi/boom": "9.x.x", - "@hapi/hoek": "9.x.x" - } - }, - "node_modules/@hapi/boom": { - "version": "9.1.3", - "resolved": "https://registry.npmjs.org/@hapi/boom/-/boom-9.1.3.tgz", - "integrity": "sha512-RlrGyZ603hE/eRTZtTltocRm50HHmrmL3kGOP0SQ9MasazlW1mt/fkv4C5P/6rnpFXjwld/POFX1C8tMZE3ldg==", - "dependencies": { - "@hapi/hoek": "9.x.x" - } - }, - "node_modules/@hapi/hoek": { - "version": "9.2.0", - "resolved": "https://registry.npmjs.org/@hapi/hoek/-/hoek-9.2.0.tgz", - "integrity": "sha512-sqKVVVOe5ivCaXDWivIJYVSaEgdQK9ul7a4Kity5Iw7u9+wBAPbX1RMSnLLmp7O4Vzj0WOWwMAJsTL00xwaNug==" - }, - "node_modules/@next/env": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/env/-/env-10.2.3.tgz", - "integrity": "sha512-uBOjRBjsWC4C8X3DfmWWP6ekwLnf2JCCwQX9KVnJtJkqfDsv1yQPakdOEwvJzXQc3JC/v5KKffYPVmV2wHXCgQ==" - }, - "node_modules/@next/polyfill-module": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/polyfill-module/-/polyfill-module-10.2.3.tgz", - "integrity": "sha512-OkeY4cLhzfYbXxM4fd+6V4s5pTPuyfKSlavItfNRA6PpS7t1/R6YjO7S7rB8tu1pbTGuDHGIdE1ioDv15bAbDQ==" - }, - "node_modules/@next/react-dev-overlay": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/react-dev-overlay/-/react-dev-overlay-10.2.3.tgz", - "integrity": "sha512-E6g2jws4YW94l0lMMopBVKIZK2mEHfSBvM0d9dmzKG9L/A/kEq6LZCB4SiwGJbNsAdlk2y3USDa0oNbpA+m5Kw==", - "dependencies": { - "@babel/code-frame": "7.12.11", - "anser": "1.4.9", - "chalk": "4.0.0", - "classnames": "2.2.6", - "css.escape": "1.5.1", - "data-uri-to-buffer": "3.0.1", - "platform": "1.3.6", - "shell-quote": "1.7.2", - "source-map": "0.8.0-beta.0", - "stacktrace-parser": "0.1.10", - "strip-ansi": "6.0.0" - }, - "peerDependencies": { - "react": "^16.9.0 || ^17", - "react-dom": "^16.9.0 || ^17" - } - }, - "node_modules/@next/react-dev-overlay/node_modules/ansi-styles": { - "version": "4.3.0", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", - "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", - "dependencies": { - "color-convert": "^2.0.1" - }, - "engines": { - "node": ">=8" - }, - "funding": { - "url": "https://github.com/chalk/ansi-styles?sponsor=1" - } - }, - "node_modules/@next/react-dev-overlay/node_modules/chalk": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.0.0.tgz", - "integrity": "sha512-N9oWFcegS0sFr9oh1oz2d7Npos6vNoWW9HvtCg5N1KRFpUhaAhvTv5Y58g880fZaEYSNm3qDz8SU1UrGvp+n7A==", - "dependencies": { - "ansi-styles": "^4.1.0", - "supports-color": "^7.1.0" - }, - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/chalk/chalk?sponsor=1" - } - }, - "node_modules/@next/react-dev-overlay/node_modules/color-convert": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", - "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", - "dependencies": { - "color-name": "~1.1.4" - }, - "engines": { - "node": ">=7.0.0" - } - }, - "node_modules/@next/react-dev-overlay/node_modules/color-name": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", - "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" - }, - "node_modules/@next/react-dev-overlay/node_modules/has-flag": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", - "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", - "engines": { - "node": ">=8" - } - }, - "node_modules/@next/react-dev-overlay/node_modules/supports-color": { - "version": "7.2.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", - "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", - "dependencies": { - "has-flag": "^4.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/@next/react-refresh-utils": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/react-refresh-utils/-/react-refresh-utils-10.2.3.tgz", - "integrity": "sha512-qtBF56vPC6d6a8p7LYd0iRjW89fhY80kAIzmj+VonvIGjK/nymBjcFUhbKiMFqlhsarCksnhwX+Zmn95Dw9qvA==", - "peerDependencies": { - "react-refresh": "0.8.3", - "webpack": "^4 || ^5" - }, - "peerDependenciesMeta": { - "webpack": { - "optional": true - } - } - }, - "node_modules/@opentelemetry/api": { - "version": "0.14.0", - "resolved": "https://registry.npmjs.org/@opentelemetry/api/-/api-0.14.0.tgz", - "integrity": "sha512-L7RMuZr5LzMmZiQSQDy9O1jo0q+DaLy6XpYJfIGfYSfoJA5qzYwUP3sP1uMIQ549DvxAgM3ng85EaPTM/hUHwQ==", - "dependencies": { - "@opentelemetry/context-base": "^0.14.0" - }, - "engines": { - "node": ">=8.0.0" - } - }, - "node_modules/@opentelemetry/context-base": { - "version": "0.14.0", - "resolved": "https://registry.npmjs.org/@opentelemetry/context-base/-/context-base-0.14.0.tgz", - "integrity": "sha512-sDOAZcYwynHFTbLo6n8kIbLiVF3a3BLkrmehJUyEbT9F+Smbi47kLGS2gG2g0fjBLR/Lr1InPD7kXL7FaTqEkw==", - "engines": { - "node": ">=8.0.0" - } - }, - "node_modules/@types/node": { - "version": "16.3.3", - "resolved": "https://registry.npmjs.org/@types/node/-/node-16.3.3.tgz", - "integrity": "sha512-8h7k1YgQKxKXWckzFCMfsIwn0Y61UK6tlD6y2lOb3hTOIMlK3t9/QwHOhc81TwU+RMf0As5fj7NPjroERCnejQ==" - }, - "node_modules/anser": { - "version": "1.4.9", - "resolved": "https://registry.npmjs.org/anser/-/anser-1.4.9.tgz", - "integrity": "sha512-AI+BjTeGt2+WFk4eWcqbQ7snZpDBt8SaLlj0RT2h5xfdWaiy51OjYvqwMrNzJLGy8iOAL6nKDITWO+rd4MkYEA==" - }, - "node_modules/ansi-regex": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", - "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==", - "engines": { - "node": ">=8" - } - }, - "node_modules/ansi-styles": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", - "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", - "dependencies": { - "color-convert": "^1.9.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/anymatch": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.2.tgz", - "integrity": "sha512-P43ePfOAIupkguHUycrc4qJ9kz8ZiuOUijaETwX7THt0Y/GNK7v0aa8rY816xWjZ7rJdA5XdMcpVFTKMq+RvWg==", - "dependencies": { - "normalize-path": "^3.0.0", - "picomatch": "^2.0.4" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/asn1.js": { - "version": "5.4.1", - "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", - "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", - "dependencies": { - "bn.js": "^4.0.0", - "inherits": "^2.0.1", - "minimalistic-assert": "^1.0.0", - "safer-buffer": "^2.1.0" - } - }, - "node_modules/asn1.js/node_modules/bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - }, - "node_modules/assert": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/assert/-/assert-2.0.0.tgz", - "integrity": "sha512-se5Cd+js9dXJnu6Ag2JFc00t+HmHOen+8Q+L7O9zI0PqQXr20uk2J0XQqMxZEeo5U50o8Nvmmx7dZrl+Ufr35A==", - "dependencies": { - "es6-object-assign": "^1.1.0", - "is-nan": "^1.2.1", - "object-is": "^1.0.1", - "util": "^0.12.0" - } - }, - "node_modules/ast-types": { - "version": "0.13.2", - "resolved": "https://registry.npmjs.org/ast-types/-/ast-types-0.13.2.tgz", - "integrity": "sha512-uWMHxJxtfj/1oZClOxDEV1sQ1HCDkA4MG8Gr69KKeBjEVH0R84WlejZ0y2DcwyBlpAEMltmVYkVgqfLFb2oyiA==", - "engines": { - "node": ">=4" - } - }, - "node_modules/available-typed-arrays": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/available-typed-arrays/-/available-typed-arrays-1.0.4.tgz", - "integrity": "sha512-SA5mXJWrId1TaQjfxUYghbqQ/hYioKmLJvPJyDuYRtXXenFNMjj4hSSt1Cf1xsuXSXrtxrVC5Ot4eU6cOtBDdA==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/babel-plugin-syntax-jsx": { - "version": "6.18.0", - "resolved": "https://registry.npmjs.org/babel-plugin-syntax-jsx/-/babel-plugin-syntax-jsx-6.18.0.tgz", - "integrity": "sha1-CvMqmm4Tyno/1QaeYtew9Y0NiUY=" - }, - "node_modules/base64-js": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz", - "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==", - "funding": [ - { - "type": "github", - "url": "https://github.com/sponsors/feross" - }, - { - "type": "patreon", - "url": "https://www.patreon.com/feross" - }, - { - "type": "consulting", - "url": "https://feross.org/support" - } - ] - }, - "node_modules/big.js": { - "version": "5.2.2", - "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", - "integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==", - "engines": { - "node": "*" - } - }, - "node_modules/binary-extensions": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", - "integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", - "engines": { - "node": ">=8" - } - }, - "node_modules/bn.js": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-5.2.0.tgz", - "integrity": "sha512-D7iWRBvnZE8ecXiLj/9wbxH7Tk79fAh8IHaTNq1RWRixsS02W+5qS+iE9yq6RYl0asXx5tw0bLhmT5pIfbSquw==" - }, - "node_modules/braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "dependencies": { - "fill-range": "^7.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/brorand": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz", - "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=" - }, - "node_modules/browserify-aes": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", - "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", - "dependencies": { - "buffer-xor": "^1.0.3", - "cipher-base": "^1.0.0", - "create-hash": "^1.1.0", - "evp_bytestokey": "^1.0.3", - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" - } - }, - "node_modules/browserify-cipher": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz", - "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", - "dependencies": { - "browserify-aes": "^1.0.4", - "browserify-des": "^1.0.0", - "evp_bytestokey": "^1.0.0" - } - }, - "node_modules/browserify-des": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz", - "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", - "dependencies": { - "cipher-base": "^1.0.1", - "des.js": "^1.0.0", - "inherits": "^2.0.1", - "safe-buffer": "^5.1.2" - } - }, - "node_modules/browserify-rsa": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.1.0.tgz", - "integrity": "sha512-AdEER0Hkspgno2aR97SAf6vi0y0k8NuOpGnVH3O99rcA5Q6sh8QxcngtHuJ6uXwnfAXNM4Gn1Gb7/MV1+Ymbog==", - "dependencies": { - "bn.js": "^5.0.0", - "randombytes": "^2.0.1" - } - }, - "node_modules/browserify-sign": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.2.1.tgz", - "integrity": "sha512-/vrA5fguVAKKAVTNJjgSm1tRQDHUU6DbwO9IROu/0WAzC8PKhucDSh18J0RMvVeHAn5puMd+QHC2erPRNf8lmg==", - "dependencies": { - "bn.js": "^5.1.1", - "browserify-rsa": "^4.0.1", - "create-hash": "^1.2.0", - "create-hmac": "^1.1.7", - "elliptic": "^6.5.3", - "inherits": "^2.0.4", - "parse-asn1": "^5.1.5", - "readable-stream": "^3.6.0", - "safe-buffer": "^5.2.0" - } - }, - "node_modules/browserify-zlib": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz", - "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", - "dependencies": { - "pako": "~1.0.5" - } - }, - "node_modules/browserslist": { - "version": "4.16.6", - "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.16.6.tgz", - "integrity": "sha512-Wspk/PqO+4W9qp5iUTJsa1B/QrYn1keNCcEP5OvP7WBwT4KaDly0uONYmC6Xa3Z5IqnUgS0KcgLYu1l74x0ZXQ==", - "dependencies": { - "caniuse-lite": "^1.0.30001219", - "colorette": "^1.2.2", - "electron-to-chromium": "^1.3.723", - "escalade": "^3.1.1", - "node-releases": "^1.1.71" - }, - "bin": { - "browserslist": "cli.js" - }, - "engines": { - "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" - }, - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/browserslist" - } - }, - "node_modules/buffer": { - "version": "5.6.0", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.6.0.tgz", - "integrity": "sha512-/gDYp/UtU0eA1ys8bOs9J6a+E/KWIY+DZ+Q2WESNUA0jFRsJOc0SNUO6xJ5SGA1xueg3NL65W6s+NY5l9cunuw==", - "dependencies": { - "base64-js": "^1.0.2", - "ieee754": "^1.1.4" - } - }, - "node_modules/buffer-xor": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz", - "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=" - }, - "node_modules/builtin-status-codes": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz", - "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=" - }, - "node_modules/bytes": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", - "integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==", - "engines": { - "node": ">= 0.8" - } - }, - "node_modules/call-bind": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz", - "integrity": "sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA==", - "dependencies": { - "function-bind": "^1.1.1", - "get-intrinsic": "^1.0.2" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/caniuse-lite": { - "version": "1.0.30001245", - "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001245.tgz", - "integrity": "sha512-768fM9j1PKXpOCKws6eTo3RHmvTUsG9UrpT4WoREFeZgJBTi4/X9g565azS/rVUGtqb8nt7FjLeF5u4kukERnA==", - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/browserslist" - } - }, - "node_modules/chalk": { - "version": "2.4.2", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", - "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", - "dependencies": { - "ansi-styles": "^3.2.1", - "escape-string-regexp": "^1.0.5", - "supports-color": "^5.3.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/chokidar": { - "version": "3.5.1", - "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.1.tgz", - "integrity": "sha512-9+s+Od+W0VJJzawDma/gvBNQqkTiqYTWLuZoyAsivsI4AaWTCzHG06/TMjsf1cYe9Cb97UCEhjz7HvnPk2p/tw==", - "dependencies": { - "anymatch": "~3.1.1", - "braces": "~3.0.2", - "glob-parent": "~5.1.0", - "is-binary-path": "~2.1.0", - "is-glob": "~4.0.1", - "normalize-path": "~3.0.0", - "readdirp": "~3.5.0" - }, - "engines": { - "node": ">= 8.10.0" - }, - "optionalDependencies": { - "fsevents": "~2.3.1" - } - }, - "node_modules/cipher-base": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz", - "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", - "dependencies": { - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" - } - }, - "node_modules/classnames": { - "version": "2.2.6", - "resolved": "https://registry.npmjs.org/classnames/-/classnames-2.2.6.tgz", - "integrity": "sha512-JR/iSQOSt+LQIWwrwEzJ9uk0xfN3mTVYMwt1Ir5mUcSN6pU+V4zQFFaJsclJbPuAUQH+yfWef6tm7l1quW3C8Q==" - }, - "node_modules/color-convert": { - "version": "1.9.3", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", - "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", - "dependencies": { - "color-name": "1.1.3" - } - }, - "node_modules/color-name": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", - "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" - }, - "node_modules/colorette": { - "version": "1.2.2", - "resolved": "https://registry.npmjs.org/colorette/-/colorette-1.2.2.tgz", - "integrity": "sha512-MKGMzyfeuutC/ZJ1cba9NqcNpfeqMUcYmyF1ZFY6/Cn7CNSAKx6a+s48sqLqyAiZuaP2TcqMhoo+dlwFnVxT9w==" - }, - "node_modules/commondir": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz", - "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=" - }, - "node_modules/console-browserify": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz", - "integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA==" - }, - "node_modules/constants-browserify": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz", - "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=" - }, - "node_modules/convert-source-map": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", - "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", - "dependencies": { - "safe-buffer": "~5.1.1" - } - }, - "node_modules/convert-source-map/node_modules/safe-buffer": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", - "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" - }, - "node_modules/core-util-is": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", - "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=" - }, - "node_modules/create-ecdh": { - "version": "4.0.4", - "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.4.tgz", - "integrity": "sha512-mf+TCx8wWc9VpuxfP2ht0iSISLZnt0JgWlrOKZiNqyUZWnjIaCIVNQArMHnCZKfEYRg6IM7A+NeJoN8gf/Ws0A==", - "dependencies": { - "bn.js": "^4.1.0", - "elliptic": "^6.5.3" - } - }, - "node_modules/create-ecdh/node_modules/bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - }, - "node_modules/create-hash": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", - "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", - "dependencies": { - "cipher-base": "^1.0.1", - "inherits": "^2.0.1", - "md5.js": "^1.3.4", - "ripemd160": "^2.0.1", - "sha.js": "^2.4.0" - } - }, - "node_modules/create-hmac": { - "version": "1.1.7", - "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", - "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", - "dependencies": { - "cipher-base": "^1.0.3", - "create-hash": "^1.1.0", - "inherits": "^2.0.1", - "ripemd160": "^2.0.0", - "safe-buffer": "^5.0.1", - "sha.js": "^2.4.8" - } - }, - "node_modules/crypto-browserify": { - "version": "3.12.0", - "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz", - "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", - "dependencies": { - "browserify-cipher": "^1.0.0", - "browserify-sign": "^4.0.0", - "create-ecdh": "^4.0.0", - "create-hash": "^1.1.0", - "create-hmac": "^1.1.0", - "diffie-hellman": "^5.0.0", - "inherits": "^2.0.1", - "pbkdf2": "^3.0.3", - "public-encrypt": "^4.0.0", - "randombytes": "^2.0.0", - "randomfill": "^1.0.3" - }, - "engines": { - "node": "*" - } - }, - "node_modules/css.escape": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/css.escape/-/css.escape-1.5.1.tgz", - "integrity": "sha1-QuJ9T6BK4y+TGktNQZH6nN3ul8s=" - }, - "node_modules/cssnano-preset-simple": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/cssnano-preset-simple/-/cssnano-preset-simple-2.0.0.tgz", - "integrity": "sha512-HkufSLkaBJbKBFx/7aj5HmCK9Ni/JedRQm0mT2qBzMG/dEuJOLnMt2lK6K1rwOOyV4j9aSY+knbW9WoS7BYpzg==", - "dependencies": { - "caniuse-lite": "^1.0.30001202" - }, - "peerDependencies": { - "postcss": "^8.2.1" - } - }, - "node_modules/cssnano-simple": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/cssnano-simple/-/cssnano-simple-2.0.0.tgz", - "integrity": "sha512-0G3TXaFxlh/szPEG/o3VcmCwl0N3E60XNb9YZZijew5eIs6fLjJuOPxQd9yEBaX2p/YfJtt49i4vYi38iH6/6w==", - "dependencies": { - "cssnano-preset-simple": "^2.0.0" - }, - "peerDependencies": { - "postcss": "^8.2.2" - } - }, - "node_modules/data-uri-to-buffer": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/data-uri-to-buffer/-/data-uri-to-buffer-3.0.1.tgz", - "integrity": "sha512-WboRycPNsVw3B3TL559F7kuBUM4d8CgMEvk6xEJlOp7OBPjt6G7z8WMWlD2rOFZLk6OYfFIUGsCOWzcQH9K2og==", - "engines": { - "node": ">= 6" - } - }, - "node_modules/debug": { - "version": "2.6.9", - "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", - "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", - "dependencies": { - "ms": "2.0.0" - } - }, - "node_modules/define-properties": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", - "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", - "dependencies": { - "object-keys": "^1.0.12" - }, - "engines": { - "node": ">= 0.4" - } - }, - "node_modules/depd": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", - "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", - "engines": { - "node": ">= 0.6" - } - }, - "node_modules/des.js": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz", - "integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==", - "dependencies": { - "inherits": "^2.0.1", - "minimalistic-assert": "^1.0.0" - } - }, - "node_modules/diffie-hellman": { - "version": "5.0.3", - "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", - "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", - "dependencies": { - "bn.js": "^4.1.0", - "miller-rabin": "^4.0.0", - "randombytes": "^2.0.0" - } - }, - "node_modules/diffie-hellman/node_modules/bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - }, - "node_modules/domain-browser": { - "version": "4.19.0", - "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-4.19.0.tgz", - "integrity": "sha512-fRA+BaAWOR/yr/t7T9E9GJztHPeFjj8U35ajyAjCDtAAnTn1Rc1f6W6VGPJrO1tkQv9zWu+JRof7z6oQtiYVFQ==", - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://bevry.me/fund" - } - }, - "node_modules/electron-to-chromium": { - "version": "1.3.779", - "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.779.tgz", - "integrity": "sha512-nreave0y/1Qhmo8XtO6C/LpawNyC6U26+q7d814/e+tIqUK073pM+4xW7WUXyqCRa5K4wdxHmNMBAi8ap9nEew==" - }, - "node_modules/elliptic": { - "version": "6.5.4", - "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.4.tgz", - "integrity": "sha512-iLhC6ULemrljPZb+QutR5TQGB+pdW6KGD5RSegS+8sorOZT+rdQFbsQFJgvN3eRqNALqJer4oQ16YvJHlU8hzQ==", - "dependencies": { - "bn.js": "^4.11.9", - "brorand": "^1.1.0", - "hash.js": "^1.0.0", - "hmac-drbg": "^1.0.1", - "inherits": "^2.0.4", - "minimalistic-assert": "^1.0.1", - "minimalistic-crypto-utils": "^1.0.1" - } - }, - "node_modules/elliptic/node_modules/bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - }, - "node_modules/emojis-list": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz", - "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=", - "engines": { - "node": ">= 0.10" - } - }, - "node_modules/encoding": { - "version": "0.1.13", - "resolved": "https://registry.npmjs.org/encoding/-/encoding-0.1.13.tgz", - "integrity": "sha512-ETBauow1T35Y/WZMkio9jiM0Z5xjHHmJ4XmjZOq1l/dXz3lr2sRn87nJy20RupqSh1F2m3HHPSp8ShIPQJrJ3A==", - "dependencies": { - "iconv-lite": "^0.6.2" - } - }, - "node_modules/es-abstract": { - "version": "1.18.3", - "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.18.3.tgz", - "integrity": "sha512-nQIr12dxV7SSxE6r6f1l3DtAeEYdsGpps13dR0TwJg1S8gyp4ZPgy3FZcHBgbiQqnoqSTb+oC+kO4UQ0C/J8vw==", - "dependencies": { - "call-bind": "^1.0.2", - "es-to-primitive": "^1.2.1", - "function-bind": "^1.1.1", - "get-intrinsic": "^1.1.1", - "has": "^1.0.3", - "has-symbols": "^1.0.2", - "is-callable": "^1.2.3", - "is-negative-zero": "^2.0.1", - "is-regex": "^1.1.3", - "is-string": "^1.0.6", - "object-inspect": "^1.10.3", - "object-keys": "^1.1.1", - "object.assign": "^4.1.2", - "string.prototype.trimend": "^1.0.4", - "string.prototype.trimstart": "^1.0.4", - "unbox-primitive": "^1.0.1" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/es-to-primitive": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", - "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", - "dependencies": { - "is-callable": "^1.1.4", - "is-date-object": "^1.0.1", - "is-symbol": "^1.0.2" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/es6-object-assign": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/es6-object-assign/-/es6-object-assign-1.1.0.tgz", - "integrity": "sha1-wsNYJlYkfDnqEHyx5mUrb58kUjw=" - }, - "node_modules/escalade": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz", - "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==", - "engines": { - "node": ">=6" - } - }, - "node_modules/escape-string-regexp": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", - "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=", - "engines": { - "node": ">=0.8.0" - } - }, - "node_modules/esutils": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", - "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/etag": { - "version": "1.8.1", - "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", - "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=", - "engines": { - "node": ">= 0.6" - } - }, - "node_modules/events": { - "version": "3.3.0", - "resolved": "https://registry.npmjs.org/events/-/events-3.3.0.tgz", - "integrity": "sha512-mQw+2fkQbALzQ7V0MY0IqdnXNOeTtP4r0lN9z7AAawCXgqea7bDii20AYrIBrFd/Hx0M2Ocz6S111CaFkUcb0Q==", - "engines": { - "node": ">=0.8.x" - } - }, - "node_modules/evp_bytestokey": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz", - "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", - "dependencies": { - "md5.js": "^1.3.4", - "safe-buffer": "^5.1.1" - } - }, - "node_modules/fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "dependencies": { - "to-regex-range": "^5.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/find-cache-dir": { - "version": "3.3.1", - "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-3.3.1.tgz", - "integrity": "sha512-t2GDMt3oGC/v+BMwzmllWDuJF/xcDtE5j/fCGbqDD7OLuJkj0cfh1YSA5VKPvwMeLFLNDBkwOKZ2X85jGLVftQ==", - "dependencies": { - "commondir": "^1.0.1", - "make-dir": "^3.0.2", - "pkg-dir": "^4.1.0" - }, - "engines": { - "node": ">=8" - }, - "funding": { - "url": "https://github.com/avajs/find-cache-dir?sponsor=1" - } - }, - "node_modules/find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "dependencies": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/foreach": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/foreach/-/foreach-2.0.5.tgz", - "integrity": "sha1-C+4AUBiusmDQo6865ljdATbsG5k=" - }, - "node_modules/fsevents": { - "version": "2.3.2", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.2.tgz", - "integrity": "sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==", - "hasInstallScript": true, - "optional": true, - "os": [ - "darwin" - ], - "engines": { - "node": "^8.16.0 || ^10.6.0 || >=11.0.0" - } - }, - "node_modules/function-bind": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", - "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==" - }, - "node_modules/get-intrinsic": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.1.1.tgz", - "integrity": "sha512-kWZrnVM42QCiEA2Ig1bG8zjoIMOgxWwYCEeNdwY6Tv/cOSeGpcoX4pXHfKUxNKVoArnrEr2e9srnAxxGIraS9Q==", - "dependencies": { - "function-bind": "^1.1.1", - "has": "^1.0.3", - "has-symbols": "^1.0.1" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/get-orientation": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/get-orientation/-/get-orientation-1.1.2.tgz", - "integrity": "sha512-/pViTfifW+gBbh/RnlFYHINvELT9Znt+SYyDKAUL6uV6By019AK/s+i9XP4jSwq7lwP38Fd8HVeTxym3+hkwmQ==", - "dependencies": { - "stream-parser": "^0.3.1" - } - }, - "node_modules/glob-parent": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", - "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", - "dependencies": { - "is-glob": "^4.0.1" - }, - "engines": { - "node": ">= 6" - } - }, - "node_modules/glob-to-regexp": { - "version": "0.4.1", - "resolved": "https://registry.npmjs.org/glob-to-regexp/-/glob-to-regexp-0.4.1.tgz", - "integrity": "sha512-lkX1HJXwyMcprw/5YUZc2s7DrpAiHB21/V+E1rHUrVNokkvB6bqMzT0VfV6/86ZNabt1k14YOIaT7nDvOX3Iiw==" - }, - "node_modules/graceful-fs": { - "version": "4.2.6", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.6.tgz", - "integrity": "sha512-nTnJ528pbqxYanhpDYsi4Rd8MAeaBA67+RZ10CM1m3bTAVFEDcd5AuA4a6W5YkGZ1iNXHzZz8T6TBKLeBuNriQ==" - }, - "node_modules/has": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", - "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", - "dependencies": { - "function-bind": "^1.1.1" - }, - "engines": { - "node": ">= 0.4.0" - } - }, - "node_modules/has-bigints": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-bigints/-/has-bigints-1.0.1.tgz", - "integrity": "sha512-LSBS2LjbNBTf6287JEbEzvJgftkF5qFkmCo9hDRpAzKhUOlJ+hx8dd4USs00SgsUNwc4617J9ki5YtEClM2ffA==", - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/has-flag": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", - "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", - "engines": { - "node": ">=4" - } - }, - "node_modules/has-symbols": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.2.tgz", - "integrity": "sha512-chXa79rL/UC2KlX17jo3vRGz0azaWEx5tGqZg5pO3NUyEJVB17dMruQlzCCOfUvElghKcm5194+BCRvi2Rv/Gw==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/hash-base": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.1.0.tgz", - "integrity": "sha512-1nmYp/rhMDiE7AYkDw+lLwlAzz0AntGIe51F3RfFfEqyQ3feY2eI/NcwC6umIQVOASPMsWJLJScWKSSvzL9IVA==", - "dependencies": { - "inherits": "^2.0.4", - "readable-stream": "^3.6.0", - "safe-buffer": "^5.2.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/hash.js": { - "version": "1.1.7", - "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz", - "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", - "dependencies": { - "inherits": "^2.0.3", - "minimalistic-assert": "^1.0.1" - } - }, - "node_modules/he": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/he/-/he-1.2.0.tgz", - "integrity": "sha512-F/1DnUGPopORZi0ni+CvrCgHQ5FyEAHRLSApuYWMmrbSwoN2Mn/7k+Gl38gJnR7yyDZk6WLXwiGod1JOWNDKGw==", - "bin": { - "he": "bin/he" - } - }, - "node_modules/hmac-drbg": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz", - "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", - "dependencies": { - "hash.js": "^1.0.3", - "minimalistic-assert": "^1.0.0", - "minimalistic-crypto-utils": "^1.0.1" - } - }, - "node_modules/http-errors": { - "version": "1.7.3", - "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.7.3.tgz", - "integrity": "sha512-ZTTX0MWrsQ2ZAhA1cejAwDLycFsd7I7nVtnkT3Ol0aqodaKW+0CTZDQ1uBv5whptCnc8e8HeRRJxRs0kmm/Qfw==", - "dependencies": { - "depd": "~1.1.2", - "inherits": "2.0.4", - "setprototypeof": "1.1.1", - "statuses": ">= 1.5.0 < 2", - "toidentifier": "1.0.0" - }, - "engines": { - "node": ">= 0.6" - } - }, - "node_modules/https-browserify": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz", - "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=" - }, - "node_modules/iconv-lite": { - "version": "0.6.3", - "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz", - "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==", - "dependencies": { - "safer-buffer": ">= 2.1.2 < 3.0.0" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/ieee754": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.2.1.tgz", - "integrity": "sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==", - "funding": [ - { - "type": "github", - "url": "https://github.com/sponsors/feross" - }, - { - "type": "patreon", - "url": "https://www.patreon.com/feross" - }, - { - "type": "consulting", - "url": "https://feross.org/support" - } - ] - }, - "node_modules/inherits": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", - "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" - }, - "node_modules/is-arguments": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-arguments/-/is-arguments-1.1.0.tgz", - "integrity": "sha512-1Ij4lOMPl/xB5kBDn7I+b2ttPMKa8szhEIrXDuXQD/oe3HJLTLhqhgGspwgyGd6MOywBUqVvYicF72lkgDnIHg==", - "dependencies": { - "call-bind": "^1.0.0" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-bigint": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/is-bigint/-/is-bigint-1.0.2.tgz", - "integrity": "sha512-0JV5+SOCQkIdzjBK9buARcV804Ddu7A0Qet6sHi3FimE9ne6m4BGQZfRn+NZiXbBk4F4XmHfDZIipLj9pX8dSA==", - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-binary-path": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", - "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", - "dependencies": { - "binary-extensions": "^2.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/is-boolean-object": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/is-boolean-object/-/is-boolean-object-1.1.1.tgz", - "integrity": "sha512-bXdQWkECBUIAcCkeH1unwJLIpZYaa5VvuygSyS/c2lf719mTKZDU5UdDRlpd01UjADgmW8RfqaP+mRaVPdr/Ng==", - "dependencies": { - "call-bind": "^1.0.2" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-callable": { - "version": "1.2.3", - "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.3.tgz", - "integrity": "sha512-J1DcMe8UYTBSrKezuIUTUwjXsho29693unXM2YhJUTR2txK/eG47bvNa/wipPFmZFgr/N6f1GA66dv0mEyTIyQ==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-date-object": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.4.tgz", - "integrity": "sha512-/b4ZVsG7Z5XVtIxs/h9W8nvfLgSAyKYdtGWQLbqy6jA1icmgjf8WCoTKgeS4wy5tYaPePouzFMANbnj94c2Z+A==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-extglob": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", - "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/is-generator-function": { - "version": "1.0.9", - "resolved": "https://registry.npmjs.org/is-generator-function/-/is-generator-function-1.0.9.tgz", - "integrity": "sha512-ZJ34p1uvIfptHCN7sFTjGibB9/oBg17sHqzDLfuwhvmN/qLVvIQXRQ8licZQ35WJ8KuEQt/etnnzQFI9C9Ue/A==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-glob": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz", - "integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==", - "dependencies": { - "is-extglob": "^2.1.1" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/is-nan": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/is-nan/-/is-nan-1.3.2.tgz", - "integrity": "sha512-E+zBKpQ2t6MEo1VsonYmluk9NxGrbzpeeLC2xIViuO2EjU2xsXsBPwTr3Ykv9l08UYEVEdWeRZNouaZqF6RN0w==", - "dependencies": { - "call-bind": "^1.0.0", - "define-properties": "^1.1.3" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-negative-zero": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.1.tgz", - "integrity": "sha512-2z6JzQvZRa9A2Y7xC6dQQm4FSTSTNWjKIYYTt4246eMTJmIo0Q+ZyOsU66X8lxK1AbB92dFeglPLrhwpeRKO6w==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "engines": { - "node": ">=0.12.0" - } - }, - "node_modules/is-number-object": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/is-number-object/-/is-number-object-1.0.5.tgz", - "integrity": "sha512-RU0lI/n95pMoUKu9v1BZP5MBcZuNSVJkMkAG2dJqC4z2GlkGUNeH68SuHuBKBD/XFe+LHZ+f9BKkLET60Niedw==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-regex": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.3.tgz", - "integrity": "sha512-qSVXFz28HM7y+IWX6vLCsexdlvzT1PJNFSBuaQLQ5o0IEw8UDYW6/2+eCMVyIsbM8CNLX2a/QWmSpyxYEHY7CQ==", - "dependencies": { - "call-bind": "^1.0.2", - "has-symbols": "^1.0.2" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-string": { - "version": "1.0.6", - "resolved": "https://registry.npmjs.org/is-string/-/is-string-1.0.6.tgz", - "integrity": "sha512-2gdzbKUuqtQ3lYNrUTQYoClPhm7oQu4UdpSZMp1/DGgkHBT8E2Z1l0yMdb6D4zNAxwDiMv8MdulKROJGNl0Q0w==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-symbol": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.4.tgz", - "integrity": "sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==", - "dependencies": { - "has-symbols": "^1.0.2" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-typed-array": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.5.tgz", - "integrity": "sha512-S+GRDgJlR3PyEbsX/Fobd9cqpZBuvUS+8asRqYDMLCb2qMzt1oz5m5oxQCxOgUDxiWsOVNi4yaF+/uvdlHlYug==", - "dependencies": { - "available-typed-arrays": "^1.0.2", - "call-bind": "^1.0.2", - "es-abstract": "^1.18.0-next.2", - "foreach": "^2.0.5", - "has-symbols": "^1.0.1" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/isarray": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", - "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=" - }, - "node_modules/jest-worker": { - "version": "27.0.0-next.5", - "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-27.0.0-next.5.tgz", - "integrity": "sha512-mk0umAQ5lT+CaOJ+Qp01N6kz48sJG2kr2n1rX0koqKf6FIygQV0qLOdN9SCYID4IVeSigDOcPeGLozdMLYfb5g==", - "dependencies": { - "@types/node": "*", - "merge-stream": "^2.0.0", - "supports-color": "^8.0.0" - }, - "engines": { - "node": "^10.13.0 || ^12.13.0 || ^14.15.0 || >=15.0.0" - } - }, - "node_modules/jest-worker/node_modules/has-flag": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", - "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", - "engines": { - "node": ">=8" - } - }, - "node_modules/jest-worker/node_modules/supports-color": { - "version": "8.1.1", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-8.1.1.tgz", - "integrity": "sha512-MpUEN2OodtUzxvKQl72cUF7RQ5EiHsGvSsVG0ia9c5RbWGL2CI4C7EpPS8UTBIplnlzZiNuV56w+FuNxy3ty2Q==", - "dependencies": { - "has-flag": "^4.0.0" - }, - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/chalk/supports-color?sponsor=1" - } - }, - "node_modules/js-tokens": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", - "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==" - }, - "node_modules/json5": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", - "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", - "dependencies": { - "minimist": "^1.2.0" - }, - "bin": { - "json5": "lib/cli.js" - } - }, - "node_modules/loader-utils": { - "version": "1.2.3", - "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz", - "integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==", - "dependencies": { - "big.js": "^5.2.2", - "emojis-list": "^2.0.0", - "json5": "^1.0.1" - }, - "engines": { - "node": ">=4.0.0" - } - }, - "node_modules/locate-path": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", - "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", - "dependencies": { - "p-locate": "^4.1.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/lodash": { - "version": "4.17.21", - "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.21.tgz", - "integrity": "sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==" - }, - "node_modules/lodash.sortby": { - "version": "4.7.0", - "resolved": "https://registry.npmjs.org/lodash.sortby/-/lodash.sortby-4.7.0.tgz", - "integrity": "sha1-7dFMgk4sycHgsKG0K7UhBRakJDg=" - }, - "node_modules/loose-envify": { - "version": "1.4.0", - "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", - "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", - "dependencies": { - "js-tokens": "^3.0.0 || ^4.0.0" - }, - "bin": { - "loose-envify": "cli.js" - } - }, - "node_modules/make-dir": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", - "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", - "dependencies": { - "semver": "^6.0.0" - }, - "engines": { - "node": ">=8" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/md5.js": { - "version": "1.3.5", - "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", - "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", - "dependencies": { - "hash-base": "^3.0.0", - "inherits": "^2.0.1", - "safe-buffer": "^5.1.2" - } - }, - "node_modules/merge-stream": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/merge-stream/-/merge-stream-2.0.0.tgz", - "integrity": "sha512-abv/qOcuPfk3URPfDzmZU1LKmuw8kT+0nIHvKrKgFrwifol/doWcdA4ZqsWQ8ENrFKkd67Mfpo/LovbIUsbt3w==" - }, - "node_modules/miller-rabin": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz", - "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", - "dependencies": { - "bn.js": "^4.0.0", - "brorand": "^1.0.1" - }, - "bin": { - "miller-rabin": "bin/miller-rabin" - } - }, - "node_modules/miller-rabin/node_modules/bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - }, - "node_modules/minimalistic-assert": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", - "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==" - }, - "node_modules/minimalistic-crypto-utils": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz", - "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=" - }, - "node_modules/minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==" - }, - "node_modules/ms": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", - "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" - }, - "node_modules/nanoid": { - "version": "3.1.23", - "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.1.23.tgz", - "integrity": "sha512-FiB0kzdP0FFVGDKlRLEQ1BgDzU87dy5NnzjeW9YZNt+/c3+q82EQDUwniSAUxp/F0gFNI1ZhKU1FqYsMuqZVnw==", - "bin": { - "nanoid": "bin/nanoid.cjs" - }, - "engines": { - "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" - } - }, - "node_modules/native-url": { - "version": "0.3.4", - "resolved": "https://registry.npmjs.org/native-url/-/native-url-0.3.4.tgz", - "integrity": "sha512-6iM8R99ze45ivyH8vybJ7X0yekIcPf5GgLV5K0ENCbmRcaRIDoj37BC8iLEmaaBfqqb8enuZ5p0uhY+lVAbAcA==", - "dependencies": { - "querystring": "^0.2.0" - } - }, - "node_modules/next": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/next/-/next-10.2.3.tgz", - "integrity": "sha512-dkM1mIfnORtGyzw/Yme8RdqNxlCMZyi4Lqj56F01/yHbe1ZtOaJ0cyqqRB4RGiPhjGGh0319f8ddjDyO1605Ow==", - "dependencies": { - "@babel/runtime": "7.12.5", - "@hapi/accept": "5.0.2", - "@next/env": "10.2.3", - "@next/polyfill-module": "10.2.3", - "@next/react-dev-overlay": "10.2.3", - "@next/react-refresh-utils": "10.2.3", - "@opentelemetry/api": "0.14.0", - "assert": "2.0.0", - "ast-types": "0.13.2", - "browserify-zlib": "0.2.0", - "browserslist": "4.16.6", - "buffer": "5.6.0", - "caniuse-lite": "^1.0.30001228", - "chalk": "2.4.2", - "chokidar": "3.5.1", - "constants-browserify": "1.0.0", - "crypto-browserify": "3.12.0", - "cssnano-simple": "2.0.0", - "domain-browser": "4.19.0", - "encoding": "0.1.13", - "etag": "1.8.1", - "find-cache-dir": "3.3.1", - "get-orientation": "1.1.2", - "https-browserify": "1.0.0", - "jest-worker": "27.0.0-next.5", - "native-url": "0.3.4", - "node-fetch": "2.6.1", - "node-html-parser": "1.4.9", - "node-libs-browser": "^2.2.1", - "os-browserify": "0.3.0", - "p-limit": "3.1.0", - "path-browserify": "1.0.1", - "pnp-webpack-plugin": "1.6.4", - "postcss": "8.2.13", - "process": "0.11.10", - "prop-types": "15.7.2", - "querystring-es3": "0.2.1", - "raw-body": "2.4.1", - "react-is": "16.13.1", - "react-refresh": "0.8.3", - "stream-browserify": "3.0.0", - "stream-http": "3.1.1", - "string_decoder": "1.3.0", - "styled-jsx": "3.3.2", - "timers-browserify": "2.0.12", - "tty-browserify": "0.0.1", - "use-subscription": "1.5.1", - "util": "0.12.3", - "vm-browserify": "1.1.2", - "watchpack": "2.1.1" - }, - "bin": { - "next": "dist/bin/next" - }, - "engines": { - "node": ">=10.13.0" - }, - "peerDependencies": { - "fibers": ">= 3.1.0", - "node-sass": "^4.0.0 || ^5.0.0", - "react": "^16.6.0 || ^17", - "react-dom": "^16.6.0 || ^17", - "sass": "^1.3.0" - }, - "peerDependenciesMeta": { - "fibers": { - "optional": true - }, - "node-sass": { - "optional": true - }, - "sass": { - "optional": true - } - } - }, - "node_modules/node-fetch": { - "version": "2.6.1", - "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.1.tgz", - "integrity": "sha512-V4aYg89jEoVRxRb2fJdAg8FHvI7cEyYdVAh94HH0UIK8oJxUfkjlDQN9RbMx+bEjP7+ggMiFRprSti032Oipxw==", - "engines": { - "node": "4.x || >=6.0.0" - } - }, - "node_modules/node-html-parser": { - "version": "1.4.9", - "resolved": "https://registry.npmjs.org/node-html-parser/-/node-html-parser-1.4.9.tgz", - "integrity": "sha512-UVcirFD1Bn0O+TSmloHeHqZZCxHjvtIeGdVdGMhyZ8/PWlEiZaZ5iJzR189yKZr8p0FXN58BUeC7RHRkf/KYGw==", - "dependencies": { - "he": "1.2.0" - } - }, - "node_modules/node-libs-browser": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz", - "integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==", - "dependencies": { - "assert": "^1.1.1", - "browserify-zlib": "^0.2.0", - "buffer": "^4.3.0", - "console-browserify": "^1.1.0", - "constants-browserify": "^1.0.0", - "crypto-browserify": "^3.11.0", - "domain-browser": "^1.1.1", - "events": "^3.0.0", - "https-browserify": "^1.0.0", - "os-browserify": "^0.3.0", - "path-browserify": "0.0.1", - "process": "^0.11.10", - "punycode": "^1.2.4", - "querystring-es3": "^0.2.0", - "readable-stream": "^2.3.3", - "stream-browserify": "^2.0.1", - "stream-http": "^2.7.2", - "string_decoder": "^1.0.0", - "timers-browserify": "^2.0.4", - "tty-browserify": "0.0.0", - "url": "^0.11.0", - "util": "^0.11.0", - "vm-browserify": "^1.0.1" - } - }, - "node_modules/node-libs-browser/node_modules/assert": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz", - "integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==", - "dependencies": { - "object-assign": "^4.1.1", - "util": "0.10.3" - } - }, - "node_modules/node-libs-browser/node_modules/assert/node_modules/util": { - "version": "0.10.3", - "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", - "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", - "dependencies": { - "inherits": "2.0.1" - } - }, - "node_modules/node-libs-browser/node_modules/buffer": { - "version": "4.9.2", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", - "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", - "dependencies": { - "base64-js": "^1.0.2", - "ieee754": "^1.1.4", - "isarray": "^1.0.0" - } - }, - "node_modules/node-libs-browser/node_modules/domain-browser": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz", - "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==", - "engines": { - "node": ">=0.4", - "npm": ">=1.2" - } - }, - "node_modules/node-libs-browser/node_modules/inherits": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz", - "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=" - }, - "node_modules/node-libs-browser/node_modules/path-browserify": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz", - "integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ==" - }, - "node_modules/node-libs-browser/node_modules/punycode": { - "version": "1.4.1", - "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", - "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=" - }, - "node_modules/node-libs-browser/node_modules/readable-stream": { - "version": "2.3.7", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", - "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", - "dependencies": { - "core-util-is": "~1.0.0", - "inherits": "~2.0.3", - "isarray": "~1.0.0", - "process-nextick-args": "~2.0.0", - "safe-buffer": "~5.1.1", - "string_decoder": "~1.1.1", - "util-deprecate": "~1.0.1" - } - }, - "node_modules/node-libs-browser/node_modules/readable-stream/node_modules/inherits": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", - "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" - }, - "node_modules/node-libs-browser/node_modules/readable-stream/node_modules/string_decoder": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", - "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", - "dependencies": { - "safe-buffer": "~5.1.0" - } - }, - "node_modules/node-libs-browser/node_modules/safe-buffer": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", - "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" - }, - "node_modules/node-libs-browser/node_modules/stream-browserify": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz", - "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", - "dependencies": { - "inherits": "~2.0.1", - "readable-stream": "^2.0.2" - } - }, - "node_modules/node-libs-browser/node_modules/stream-http": { - "version": "2.8.3", - "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", - "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", - "dependencies": { - "builtin-status-codes": "^3.0.0", - "inherits": "^2.0.1", - "readable-stream": "^2.3.6", - "to-arraybuffer": "^1.0.0", - "xtend": "^4.0.0" - } - }, - "node_modules/node-libs-browser/node_modules/tty-browserify": { - "version": "0.0.0", - "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", - "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=" - }, - "node_modules/node-libs-browser/node_modules/util": { - "version": "0.11.1", - "resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz", - "integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==", - "dependencies": { - "inherits": "2.0.3" - } - }, - "node_modules/node-libs-browser/node_modules/util/node_modules/inherits": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", - "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" - }, - "node_modules/node-releases": { - "version": "1.1.73", - "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.73.tgz", - "integrity": "sha512-uW7fodD6pyW2FZNZnp/Z3hvWKeEW1Y8R1+1CnErE8cXFXzl5blBOoVB41CvMer6P6Q0S5FXDwcHgFd1Wj0U9zg==" - }, - "node_modules/normalize-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", - "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/object-assign": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", - "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/object-inspect": { - "version": "1.11.0", - "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.11.0.tgz", - "integrity": "sha512-jp7ikS6Sd3GxQfZJPyH3cjcbJF6GZPClgdV+EFygjFLQ5FmW/dRUnTd9PQ9k0JhoNDabWFbpF1yCdSWCC6gexg==", - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/object-is": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.5.tgz", - "integrity": "sha512-3cyDsyHgtmi7I7DfSSI2LDp6SK2lwvtbg0p0R1e0RvTqF5ceGx+K2dfSjm1bKDMVCFEDAQvy+o8c6a7VujOddw==", - "dependencies": { - "call-bind": "^1.0.2", - "define-properties": "^1.1.3" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/object-keys": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", - "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", - "engines": { - "node": ">= 0.4" - } - }, - "node_modules/object.assign": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", - "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", - "dependencies": { - "call-bind": "^1.0.0", - "define-properties": "^1.1.3", - "has-symbols": "^1.0.1", - "object-keys": "^1.1.1" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/os-browserify": { - "version": "0.3.0", - "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz", - "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=" - }, - "node_modules/p-limit": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz", - "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==", - "dependencies": { - "yocto-queue": "^0.1.0" - }, - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/p-locate": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", - "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", - "dependencies": { - "p-limit": "^2.2.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/p-locate/node_modules/p-limit": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", - "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", - "dependencies": { - "p-try": "^2.0.0" - }, - "engines": { - "node": ">=6" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", - "engines": { - "node": ">=6" - } - }, - "node_modules/pako": { - "version": "1.0.11", - "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz", - "integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==" - }, - "node_modules/parse-asn1": { - "version": "5.1.6", - "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.6.tgz", - "integrity": "sha512-RnZRo1EPU6JBnra2vGHj0yhp6ebyjBZpmUCLHWiFhxlzvBCCpAuZ7elsBp1PVAbQN0/04VD/19rfzlBSwLstMw==", - "dependencies": { - "asn1.js": "^5.2.0", - "browserify-aes": "^1.0.0", - "evp_bytestokey": "^1.0.0", - "pbkdf2": "^3.0.3", - "safe-buffer": "^5.1.1" - } - }, - "node_modules/path-browserify": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-1.0.1.tgz", - "integrity": "sha512-b7uo2UCUOYZcnF/3ID0lulOJi/bafxa1xPe7ZPsammBSpjSWQkjNxlt635YGS2MiR9GjvuXCtz2emr3jbsz98g==" - }, - "node_modules/path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", - "engines": { - "node": ">=8" - } - }, - "node_modules/pbkdf2": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.2.tgz", - "integrity": "sha512-iuh7L6jA7JEGu2WxDwtQP1ddOpaJNC4KlDEFfdQajSGgGPNi4OyDc2R7QnbY2bR9QjBVGwgvTdNJZoE7RaxUMA==", - "dependencies": { - "create-hash": "^1.1.2", - "create-hmac": "^1.1.4", - "ripemd160": "^2.0.1", - "safe-buffer": "^5.0.1", - "sha.js": "^2.4.8" - }, - "engines": { - "node": ">=0.12" - } - }, - "node_modules/picomatch": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.0.tgz", - "integrity": "sha512-lY1Q/PiJGC2zOv/z391WOTD+Z02bCgsFfvxoXXf6h7kv9o+WmsmzYqrAwY63sNgOxE4xEdq0WyUnXfKeBrSvYw==", - "engines": { - "node": ">=8.6" - }, - "funding": { - "url": "https://github.com/sponsors/jonschlinkert" - } - }, - "node_modules/pkg-dir": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", - "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", - "dependencies": { - "find-up": "^4.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/platform": { - "version": "1.3.6", - "resolved": "https://registry.npmjs.org/platform/-/platform-1.3.6.tgz", - "integrity": "sha512-fnWVljUchTro6RiCFvCXBbNhJc2NijN7oIQxbwsyL0buWJPG85v81ehlHI9fXrJsMNgTofEoWIQeClKpgxFLrg==" - }, - "node_modules/pnp-webpack-plugin": { - "version": "1.6.4", - "resolved": "https://registry.npmjs.org/pnp-webpack-plugin/-/pnp-webpack-plugin-1.6.4.tgz", - "integrity": "sha512-7Wjy+9E3WwLOEL30D+m8TSTF7qJJUJLONBnwQp0518siuMxUQUbgZwssaFX+QKlZkjHZcw/IpZCt/H0srrntSg==", - "dependencies": { - "ts-pnp": "^1.1.6" - }, - "engines": { - "node": ">=6" - } - }, - "node_modules/postcss": { - "version": "8.2.13", - "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.2.13.tgz", - "integrity": "sha512-FCE5xLH+hjbzRdpbRb1IMCvPv9yZx2QnDarBEYSN0N0HYk+TcXsEhwdFcFb+SRWOKzKGErhIEbBK2ogyLdTtfQ==", - "dependencies": { - "colorette": "^1.2.2", - "nanoid": "^3.1.22", - "source-map": "^0.6.1" - }, - "engines": { - "node": "^10 || ^12 || >=14" - }, - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/postcss/" - } - }, - "node_modules/postcss/node_modules/source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/process": { - "version": "0.11.10", - "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", - "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=", - "engines": { - "node": ">= 0.6.0" - } - }, - "node_modules/process-nextick-args": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", - "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==" - }, - "node_modules/prop-types": { - "version": "15.7.2", - "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.7.2.tgz", - "integrity": "sha512-8QQikdH7//R2vurIJSutZ1smHYTcLpRWEOlHnzcWHmBYrOGUysKwSsrC89BCiFj3CbrfJ/nXFdJepOVrY1GCHQ==", - "dependencies": { - "loose-envify": "^1.4.0", - "object-assign": "^4.1.1", - "react-is": "^16.8.1" - } - }, - "node_modules/public-encrypt": { - "version": "4.0.3", - "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz", - "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", - "dependencies": { - "bn.js": "^4.1.0", - "browserify-rsa": "^4.0.0", - "create-hash": "^1.1.0", - "parse-asn1": "^5.0.0", - "randombytes": "^2.0.1", - "safe-buffer": "^5.1.2" - } - }, - "node_modules/public-encrypt/node_modules/bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - }, - "node_modules/punycode": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz", - "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==", - "engines": { - "node": ">=6" - } - }, - "node_modules/querystring": { - "version": "0.2.1", - "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.1.tgz", - "integrity": "sha512-wkvS7mL/JMugcup3/rMitHmd9ecIGd2lhFhK9N3UUQ450h66d1r3Y9nvXzQAW1Lq+wyx61k/1pfKS5KuKiyEbg==", - "deprecated": "The querystring API is considered Legacy. new code should use the URLSearchParams API instead.", - "engines": { - "node": ">=0.4.x" - } - }, - "node_modules/querystring-es3": { - "version": "0.2.1", - "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz", - "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=", - "engines": { - "node": ">=0.4.x" - } - }, - "node_modules/randombytes": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", - "integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==", - "dependencies": { - "safe-buffer": "^5.1.0" - } - }, - "node_modules/randomfill": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz", - "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", - "dependencies": { - "randombytes": "^2.0.5", - "safe-buffer": "^5.1.0" - } - }, - "node_modules/raw-body": { - "version": "2.4.1", - "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.1.tgz", - "integrity": "sha512-9WmIKF6mkvA0SLmA2Knm9+qj89e+j1zqgyn8aXGd7+nAduPoqgI9lO57SAZNn/Byzo5P7JhXTyg9PzaJbH73bA==", - "dependencies": { - "bytes": "3.1.0", - "http-errors": "1.7.3", - "iconv-lite": "0.4.24", - "unpipe": "1.0.0" - }, - "engines": { - "node": ">= 0.8" - } - }, - "node_modules/raw-body/node_modules/iconv-lite": { - "version": "0.4.24", - "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", - "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", - "dependencies": { - "safer-buffer": ">= 2.1.2 < 3" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/react": { - "version": "17.0.2", - "resolved": "https://registry.npmjs.org/react/-/react-17.0.2.tgz", - "integrity": "sha512-gnhPt75i/dq/z3/6q/0asP78D0u592D5L1pd7M8P+dck6Fu/jJeL6iVVK23fptSUZj8Vjf++7wXA8UNclGQcbA==", - "dependencies": { - "loose-envify": "^1.1.0", - "object-assign": "^4.1.1" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/react-dom": { - "version": "17.0.2", - "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-17.0.2.tgz", - "integrity": "sha512-s4h96KtLDUQlsENhMn1ar8t2bEa+q/YAtj8pPPdIjPDGBDIVNsrD9aXNWqspUe6AzKCIG0C1HZZLqLV7qpOBGA==", - "dependencies": { - "loose-envify": "^1.1.0", - "object-assign": "^4.1.1", - "scheduler": "^0.20.2" - }, - "peerDependencies": { - "react": "17.0.2" - } - }, - "node_modules/react-is": { - "version": "16.13.1", - "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz", - "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==" - }, - "node_modules/react-refresh": { - "version": "0.8.3", - "resolved": "https://registry.npmjs.org/react-refresh/-/react-refresh-0.8.3.tgz", - "integrity": "sha512-X8jZHc7nCMjaCqoU+V2I0cOhNW+QMBwSUkeXnTi8IPe6zaRWfn60ZzvFDZqWPfmSJfjub7dDW1SP0jaHWLu/hg==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "dependencies": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - }, - "engines": { - "node": ">= 6" - } - }, - "node_modules/readdirp": { - "version": "3.5.0", - "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", - "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", - "dependencies": { - "picomatch": "^2.2.1" - }, - "engines": { - "node": ">=8.10.0" - } - }, - "node_modules/regenerator-runtime": { - "version": "0.13.7", - "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz", - "integrity": "sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew==" - }, - "node_modules/ripemd160": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz", - "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", - "dependencies": { - "hash-base": "^3.0.0", - "inherits": "^2.0.1" - } - }, - "node_modules/safe-buffer": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", - "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==", - "funding": [ - { - "type": "github", - "url": "https://github.com/sponsors/feross" - }, - { - "type": "patreon", - "url": "https://www.patreon.com/feross" - }, - { - "type": "consulting", - "url": "https://feross.org/support" - } - ] - }, - "node_modules/safer-buffer": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", - "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" - }, - "node_modules/scheduler": { - "version": "0.20.2", - "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.20.2.tgz", - "integrity": "sha512-2eWfGgAqqWFGqtdMmcL5zCMK1U8KlXv8SQFGglL3CEtd0aDVDWgeF/YoCmvln55m5zSk3J/20hTaSBeSObsQDQ==", - "dependencies": { - "loose-envify": "^1.1.0", - "object-assign": "^4.1.1" - } - }, - "node_modules/semver": { - "version": "6.3.0", - "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", - "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", - "bin": { - "semver": "bin/semver.js" - } - }, - "node_modules/setimmediate": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz", - "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=" - }, - "node_modules/setprototypeof": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.1.tgz", - "integrity": "sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw==" - }, - "node_modules/sha.js": { - "version": "2.4.11", - "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", - "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", - "dependencies": { - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" - }, - "bin": { - "sha.js": "bin.js" - } - }, - "node_modules/shell-quote": { - "version": "1.7.2", - "resolved": "https://registry.npmjs.org/shell-quote/-/shell-quote-1.7.2.tgz", - "integrity": "sha512-mRz/m/JVscCrkMyPqHc/bczi3OQHkLTqXHEFu0zDhK/qfv3UcOA4SVmRCLmos4bhjr9ekVQubj/R7waKapmiQg==" - }, - "node_modules/source-map": { - "version": "0.8.0-beta.0", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.8.0-beta.0.tgz", - "integrity": "sha512-2ymg6oRBpebeZi9UUNsgQ89bhx01TcTkmNTGnNO88imTmbSgy4nfujrgVEFKWpMTEGA11EDkTt7mqObTPdigIA==", - "dependencies": { - "whatwg-url": "^7.0.0" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/stacktrace-parser": { - "version": "0.1.10", - "resolved": "https://registry.npmjs.org/stacktrace-parser/-/stacktrace-parser-0.1.10.tgz", - "integrity": "sha512-KJP1OCML99+8fhOHxwwzyWrlUuVX5GQ0ZpJTd1DFXhdkrvg1szxfHhawXUZ3g9TkXORQd4/WG68jMlQZ2p8wlg==", - "dependencies": { - "type-fest": "^0.7.1" - }, - "engines": { - "node": ">=6" - } - }, - "node_modules/statuses": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", - "integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=", - "engines": { - "node": ">= 0.6" - } - }, - "node_modules/stream-browserify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-3.0.0.tgz", - "integrity": "sha512-H73RAHsVBapbim0tU2JwwOiXUj+fikfiaoYAKHF3VJfA0pe2BCzkhAHBlLG6REzE+2WNZcxOXjK7lkso+9euLA==", - "dependencies": { - "inherits": "~2.0.4", - "readable-stream": "^3.5.0" - } - }, - "node_modules/stream-http": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-3.1.1.tgz", - "integrity": "sha512-S7OqaYu0EkFpgeGFb/NPOoPLxFko7TPqtEeFg5DXPB4v/KETHG0Ln6fRFrNezoelpaDKmycEmmZ81cC9DAwgYg==", - "dependencies": { - "builtin-status-codes": "^3.0.0", - "inherits": "^2.0.4", - "readable-stream": "^3.6.0", - "xtend": "^4.0.2" - } - }, - "node_modules/stream-parser": { - "version": "0.3.1", - "resolved": "https://registry.npmjs.org/stream-parser/-/stream-parser-0.3.1.tgz", - "integrity": "sha1-FhhUhpRCACGhGC/wrxkRwSl2F3M=", - "dependencies": { - "debug": "2" - } - }, - "node_modules/string_decoder": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz", - "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==", - "dependencies": { - "safe-buffer": "~5.2.0" - } - }, - "node_modules/string-hash": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/string-hash/-/string-hash-1.1.3.tgz", - "integrity": "sha1-6Kr8CsGFW0Zmkp7X3RJ1311sgRs=" - }, - "node_modules/string.prototype.trimend": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.4.tgz", - "integrity": "sha512-y9xCjw1P23Awk8EvTpcyL2NIr1j7wJ39f+k6lvRnSMz+mz9CGz9NYPelDk42kOz6+ql8xjfK8oYzy3jAP5QU5A==", - "dependencies": { - "call-bind": "^1.0.2", - "define-properties": "^1.1.3" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/string.prototype.trimstart": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.4.tgz", - "integrity": "sha512-jh6e984OBfvxS50tdY2nRZnoC5/mLFKOREQfw8t5yytkoUsJRNxvI/E39qu1sD0OtWI3OC0XgKSmcWwziwYuZw==", - "dependencies": { - "call-bind": "^1.0.2", - "define-properties": "^1.1.3" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/strip-ansi": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", - "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", - "dependencies": { - "ansi-regex": "^5.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/styled-jsx": { - "version": "3.3.2", - "resolved": "https://registry.npmjs.org/styled-jsx/-/styled-jsx-3.3.2.tgz", - "integrity": "sha512-daAkGd5mqhbBhLd6jYAjYBa9LpxYCzsgo/f6qzPdFxVB8yoGbhxvzQgkC0pfmCVvW3JuAEBn0UzFLBfkHVZG1g==", - "dependencies": { - "@babel/types": "7.8.3", - "babel-plugin-syntax-jsx": "6.18.0", - "convert-source-map": "1.7.0", - "loader-utils": "1.2.3", - "source-map": "0.7.3", - "string-hash": "1.1.3", - "stylis": "3.5.4", - "stylis-rule-sheet": "0.0.10" - }, - "peerDependencies": { - "react": "15.x.x || 16.x.x || 17.x.x" - } - }, - "node_modules/styled-jsx/node_modules/source-map": { - "version": "0.7.3", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.7.3.tgz", - "integrity": "sha512-CkCj6giN3S+n9qrYiBTX5gystlENnRW5jZeNLHpe6aue+SrHcG5VYwujhW9s4dY31mEGsxBDrHR6oI69fTXsaQ==", - "engines": { - "node": ">= 8" - } - }, - "node_modules/stylis": { - "version": "3.5.4", - "resolved": "https://registry.npmjs.org/stylis/-/stylis-3.5.4.tgz", - "integrity": "sha512-8/3pSmthWM7lsPBKv7NXkzn2Uc9W7NotcwGNpJaa3k7WMM1XDCA4MgT5k/8BIexd5ydZdboXtU90XH9Ec4Bv/Q==" - }, - "node_modules/stylis-rule-sheet": { - "version": "0.0.10", - "resolved": "https://registry.npmjs.org/stylis-rule-sheet/-/stylis-rule-sheet-0.0.10.tgz", - "integrity": "sha512-nTbZoaqoBnmK+ptANthb10ZRZOGC+EmTLLUxeYIuHNkEKcmKgXX1XWKkUBT2Ac4es3NybooPe0SmvKdhKJZAuw==", - "peerDependencies": { - "stylis": "^3.5.0" - } - }, - "node_modules/supports-color": { - "version": "5.5.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", - "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", - "dependencies": { - "has-flag": "^3.0.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/timers-browserify": { - "version": "2.0.12", - "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.12.tgz", - "integrity": "sha512-9phl76Cqm6FhSX9Xe1ZUAMLtm1BLkKj2Qd5ApyWkXzsMRaA7dgr81kf4wJmQf/hAvg8EEyJxDo3du/0KlhPiKQ==", - "dependencies": { - "setimmediate": "^1.0.4" - }, - "engines": { - "node": ">=0.6.0" - } - }, - "node_modules/to-arraybuffer": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", - "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=" - }, - "node_modules/to-fast-properties": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", - "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=", - "engines": { - "node": ">=4" - } - }, - "node_modules/to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dependencies": { - "is-number": "^7.0.0" - }, - "engines": { - "node": ">=8.0" - } - }, - "node_modules/toidentifier": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", - "integrity": "sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw==", - "engines": { - "node": ">=0.6" - } - }, - "node_modules/tr46": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/tr46/-/tr46-1.0.1.tgz", - "integrity": "sha1-qLE/1r/SSJUZZ0zN5VujaTtwbQk=", - "dependencies": { - "punycode": "^2.1.0" - } - }, - "node_modules/ts-pnp": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/ts-pnp/-/ts-pnp-1.2.0.tgz", - "integrity": "sha512-csd+vJOb/gkzvcCHgTGSChYpy5f1/XKNsmvBGO4JXS+z1v2HobugDz4s1IeFXM3wZB44uczs+eazB5Q/ccdhQw==", - "engines": { - "node": ">=6" - }, - "peerDependenciesMeta": { - "typescript": { - "optional": true - } - } - }, - "node_modules/tty-browserify": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.1.tgz", - "integrity": "sha512-C3TaO7K81YvjCgQH9Q1S3R3P3BtN3RIM8n+OvX4il1K1zgE8ZhI0op7kClgkxtutIE8hQrcrHBXvIheqKUUCxw==" - }, - "node_modules/type-fest": { - "version": "0.7.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.7.1.tgz", - "integrity": "sha512-Ne2YiiGN8bmrmJJEuTWTLJR32nh/JdL1+PSicowtNb0WFpn59GK8/lfD61bVtzguz7b3PBt74nxpv/Pw5po5Rg==", - "engines": { - "node": ">=8" - } - }, - "node_modules/unbox-primitive": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/unbox-primitive/-/unbox-primitive-1.0.1.tgz", - "integrity": "sha512-tZU/3NqK3dA5gpE1KtyiJUrEB0lxnGkMFHptJ7q6ewdZ8s12QrODwNbhIJStmJkd1QDXa1NRA8aF2A1zk/Ypyw==", - "dependencies": { - "function-bind": "^1.1.1", - "has-bigints": "^1.0.1", - "has-symbols": "^1.0.2", - "which-boxed-primitive": "^1.0.2" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/unpipe": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", - "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", - "engines": { - "node": ">= 0.8" - } - }, - "node_modules/url": { - "version": "0.11.0", - "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz", - "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=", - "dependencies": { - "punycode": "1.3.2", - "querystring": "0.2.0" - } - }, - "node_modules/url/node_modules/punycode": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz", - "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=" - }, - "node_modules/url/node_modules/querystring": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz", - "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=", - "deprecated": "The querystring API is considered Legacy. new code should use the URLSearchParams API instead.", - "engines": { - "node": ">=0.4.x" - } - }, - "node_modules/use-subscription": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/use-subscription/-/use-subscription-1.5.1.tgz", - "integrity": "sha512-Xv2a1P/yReAjAbhylMfFplFKj9GssgTwN7RlcTxBujFQcloStWNDQdc4g4NRWH9xS4i/FDk04vQBptAXoF3VcA==", - "dependencies": { - "object-assign": "^4.1.1" - }, - "peerDependencies": { - "react": "^16.8.0 || ^17.0.0" - } - }, - "node_modules/util": { - "version": "0.12.3", - "resolved": "https://registry.npmjs.org/util/-/util-0.12.3.tgz", - "integrity": "sha512-I8XkoQwE+fPQEhy9v012V+TSdH2kp9ts29i20TaaDUXsg7x/onePbhFJUExBfv/2ay1ZOp/Vsm3nDlmnFGSAog==", - "dependencies": { - "inherits": "^2.0.3", - "is-arguments": "^1.0.4", - "is-generator-function": "^1.0.7", - "is-typed-array": "^1.1.3", - "safe-buffer": "^5.1.2", - "which-typed-array": "^1.1.2" - } - }, - "node_modules/util-deprecate": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", - "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" - }, - "node_modules/vm-browserify": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", - "integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ==" - }, - "node_modules/watchpack": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-2.1.1.tgz", - "integrity": "sha512-Oo7LXCmc1eE1AjyuSBmtC3+Wy4HcV8PxWh2kP6fOl8yTlNS7r0K9l1ao2lrrUza7V39Y3D/BbJgY8VeSlc5JKw==", - "dependencies": { - "glob-to-regexp": "^0.4.1", - "graceful-fs": "^4.1.2" - }, - "engines": { - "node": ">=10.13.0" - } - }, - "node_modules/webidl-conversions": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/webidl-conversions/-/webidl-conversions-4.0.2.tgz", - "integrity": "sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==" - }, - "node_modules/whatwg-url": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/whatwg-url/-/whatwg-url-7.1.0.tgz", - "integrity": "sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==", - "dependencies": { - "lodash.sortby": "^4.7.0", - "tr46": "^1.0.1", - "webidl-conversions": "^4.0.2" - } - }, - "node_modules/which-boxed-primitive": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz", - "integrity": "sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg==", - "dependencies": { - "is-bigint": "^1.0.1", - "is-boolean-object": "^1.1.0", - "is-number-object": "^1.0.4", - "is-string": "^1.0.5", - "is-symbol": "^1.0.3" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/which-typed-array": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.4.tgz", - "integrity": "sha512-49E0SpUe90cjpoc7BOJwyPHRqSAd12c10Qm2amdEZrJPCY2NDxaW01zHITrem+rnETY3dwrbH3UUrUwagfCYDA==", - "dependencies": { - "available-typed-arrays": "^1.0.2", - "call-bind": "^1.0.0", - "es-abstract": "^1.18.0-next.1", - "foreach": "^2.0.5", - "function-bind": "^1.1.1", - "has-symbols": "^1.0.1", - "is-typed-array": "^1.1.3" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/xtend": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", - "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==", - "engines": { - "node": ">=0.4" - } - }, - "node_modules/yocto-queue": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz", - "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==", - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - } - }, - "dependencies": { - "@babel/code-frame": { - "version": "7.12.11", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.12.11.tgz", - "integrity": "sha512-Zt1yodBx1UcyiePMSkWnU4hPqhwq7hGi2nFL1LeA3EUl+q2LQx16MISgJ0+z7dnmgvP9QtIleuETGOiOH1RcIw==", - "requires": { - "@babel/highlight": "^7.10.4" - } - }, - "@babel/helper-validator-identifier": { - "version": "7.14.5", - "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.14.5.tgz", - "integrity": "sha512-5lsetuxCLilmVGyiLEfoHBRX8UCFD+1m2x3Rj97WrW3V7H3u4RWRXA4evMjImCsin2J2YT0QaVDGf+z8ondbAg==" - }, - "@babel/highlight": { - "version": "7.14.5", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.14.5.tgz", - "integrity": "sha512-qf9u2WFWVV0MppaL877j2dBtQIDgmidgjGk5VIMw3OadXvYaXn66U1BFlH2t4+t3i+8PhedppRv+i40ABzd+gg==", - "requires": { - "@babel/helper-validator-identifier": "^7.14.5", - "chalk": "^2.0.0", - "js-tokens": "^4.0.0" - } - }, - "@babel/runtime": { - "version": "7.12.5", - "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.12.5.tgz", - "integrity": "sha512-plcc+hbExy3McchJCEQG3knOsuh3HH+Prx1P6cLIkET/0dLuQDEnrT+s27Axgc9bqfsmNUNHfscgMUdBpC9xfg==", - "requires": { - "regenerator-runtime": "^0.13.4" - } - }, - "@babel/types": { - "version": "7.8.3", - "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.8.3.tgz", - "integrity": "sha512-jBD+G8+LWpMBBWvVcdr4QysjUE4mU/syrhN17o1u3gx0/WzJB1kwiVZAXRtWbsIPOwW8pF/YJV5+nmetPzepXg==", - "requires": { - "esutils": "^2.0.2", - "lodash": "^4.17.13", - "to-fast-properties": "^2.0.0" - } - }, - "@fortawesome/fontawesome-common-types": { - "version": "0.2.35", - "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-common-types/-/fontawesome-common-types-0.2.35.tgz", - "integrity": "sha512-IHUfxSEDS9dDGqYwIW7wTN6tn/O8E0n5PcAHz9cAaBoZw6UpG20IG/YM3NNLaGPwPqgjBAFjIURzqoQs3rrtuw==" - }, - "@fortawesome/fontawesome-free": { - "version": "5.15.3", - "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-free/-/fontawesome-free-5.15.3.tgz", - "integrity": "sha512-rFnSUN/QOtnOAgqFRooTA3H57JLDm0QEG/jPdk+tLQNL/eWd+Aok8g3qCI+Q1xuDPWpGW/i9JySpJVsq8Q0s9w==" - }, - "@fortawesome/fontawesome-svg-core": { - "version": "1.2.35", - "resolved": "https://registry.npmjs.org/@fortawesome/fontawesome-svg-core/-/fontawesome-svg-core-1.2.35.tgz", - "integrity": "sha512-uLEXifXIL7hnh2sNZQrIJWNol7cTVIzwI+4qcBIq9QWaZqUblm0IDrtSqbNg+3SQf8SMGHkiSigD++rHmCHjBg==", - "requires": { - "@fortawesome/fontawesome-common-types": "^0.2.35" - } - }, - "@fortawesome/free-brands-svg-icons": { - "version": "5.15.3", - "resolved": "https://registry.npmjs.org/@fortawesome/free-brands-svg-icons/-/free-brands-svg-icons-5.15.3.tgz", - "integrity": "sha512-1hirPcbjj72ZJtFvdnXGPbAbpn3Ox6mH3g5STbANFp3vGSiE5u5ingAKV06mK6ZVqNYxUPlh4DlTnaIvLtF2kw==", - "requires": { - "@fortawesome/fontawesome-common-types": "^0.2.35" - } - }, - "@fortawesome/free-solid-svg-icons": { - "version": "5.15.3", - "resolved": "https://registry.npmjs.org/@fortawesome/free-solid-svg-icons/-/free-solid-svg-icons-5.15.3.tgz", - "integrity": "sha512-XPeeu1IlGYqz4VWGRAT5ukNMd4VHUEEJ7ysZ7pSSgaEtNvSo+FLurybGJVmiqkQdK50OkSja2bfZXOeyMGRD8Q==", - "requires": { - "@fortawesome/fontawesome-common-types": "^0.2.35" - } - }, - "@fortawesome/react-fontawesome": { - "version": "0.1.14", - "resolved": "https://registry.npmjs.org/@fortawesome/react-fontawesome/-/react-fontawesome-0.1.14.tgz", - "integrity": "sha512-4wqNb0gRLVaBm/h+lGe8UfPPivcbuJ6ecI4hIgW0LjI7kzpYB9FkN0L9apbVzg+lsBdcTf0AlBtODjcSX5mmKA==", - "requires": { - "prop-types": "^15.7.2" - } - }, - "@hapi/accept": { - "version": "5.0.2", - "resolved": "https://registry.npmjs.org/@hapi/accept/-/accept-5.0.2.tgz", - "integrity": "sha512-CmzBx/bXUR8451fnZRuZAJRlzgm0Jgu5dltTX/bszmR2lheb9BpyN47Q1RbaGTsvFzn0PXAEs+lXDKfshccYZw==", - "requires": { - "@hapi/boom": "9.x.x", - "@hapi/hoek": "9.x.x" - } - }, - "@hapi/boom": { - "version": "9.1.3", - "resolved": "https://registry.npmjs.org/@hapi/boom/-/boom-9.1.3.tgz", - "integrity": "sha512-RlrGyZ603hE/eRTZtTltocRm50HHmrmL3kGOP0SQ9MasazlW1mt/fkv4C5P/6rnpFXjwld/POFX1C8tMZE3ldg==", - "requires": { - "@hapi/hoek": "9.x.x" - } - }, - "@hapi/hoek": { - "version": "9.2.0", - "resolved": "https://registry.npmjs.org/@hapi/hoek/-/hoek-9.2.0.tgz", - "integrity": "sha512-sqKVVVOe5ivCaXDWivIJYVSaEgdQK9ul7a4Kity5Iw7u9+wBAPbX1RMSnLLmp7O4Vzj0WOWwMAJsTL00xwaNug==" - }, - "@next/env": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/env/-/env-10.2.3.tgz", - "integrity": "sha512-uBOjRBjsWC4C8X3DfmWWP6ekwLnf2JCCwQX9KVnJtJkqfDsv1yQPakdOEwvJzXQc3JC/v5KKffYPVmV2wHXCgQ==" - }, - "@next/polyfill-module": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/polyfill-module/-/polyfill-module-10.2.3.tgz", - "integrity": "sha512-OkeY4cLhzfYbXxM4fd+6V4s5pTPuyfKSlavItfNRA6PpS7t1/R6YjO7S7rB8tu1pbTGuDHGIdE1ioDv15bAbDQ==" - }, - "@next/react-dev-overlay": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/react-dev-overlay/-/react-dev-overlay-10.2.3.tgz", - "integrity": "sha512-E6g2jws4YW94l0lMMopBVKIZK2mEHfSBvM0d9dmzKG9L/A/kEq6LZCB4SiwGJbNsAdlk2y3USDa0oNbpA+m5Kw==", - "requires": { - "@babel/code-frame": "7.12.11", - "anser": "1.4.9", - "chalk": "4.0.0", - "classnames": "2.2.6", - "css.escape": "1.5.1", - "data-uri-to-buffer": "3.0.1", - "platform": "1.3.6", - "shell-quote": "1.7.2", - "source-map": "0.8.0-beta.0", - "stacktrace-parser": "0.1.10", - "strip-ansi": "6.0.0" - }, - "dependencies": { - "ansi-styles": { - "version": "4.3.0", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", - "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", - "requires": { - "color-convert": "^2.0.1" - } - }, - "chalk": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.0.0.tgz", - "integrity": "sha512-N9oWFcegS0sFr9oh1oz2d7Npos6vNoWW9HvtCg5N1KRFpUhaAhvTv5Y58g880fZaEYSNm3qDz8SU1UrGvp+n7A==", - "requires": { - "ansi-styles": "^4.1.0", - "supports-color": "^7.1.0" - } - }, - "color-convert": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", - "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", - "requires": { - "color-name": "~1.1.4" - } - }, - "color-name": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", - "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" - }, - "has-flag": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", - "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==" - }, - "supports-color": { - "version": "7.2.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", - "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", - "requires": { - "has-flag": "^4.0.0" - } - } - } - }, - "@next/react-refresh-utils": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/@next/react-refresh-utils/-/react-refresh-utils-10.2.3.tgz", - "integrity": "sha512-qtBF56vPC6d6a8p7LYd0iRjW89fhY80kAIzmj+VonvIGjK/nymBjcFUhbKiMFqlhsarCksnhwX+Zmn95Dw9qvA==", - "requires": {} - }, - "@opentelemetry/api": { - "version": "0.14.0", - "resolved": "https://registry.npmjs.org/@opentelemetry/api/-/api-0.14.0.tgz", - "integrity": "sha512-L7RMuZr5LzMmZiQSQDy9O1jo0q+DaLy6XpYJfIGfYSfoJA5qzYwUP3sP1uMIQ549DvxAgM3ng85EaPTM/hUHwQ==", - "requires": { - "@opentelemetry/context-base": "^0.14.0" - } - }, - "@opentelemetry/context-base": { - "version": "0.14.0", - "resolved": "https://registry.npmjs.org/@opentelemetry/context-base/-/context-base-0.14.0.tgz", - "integrity": "sha512-sDOAZcYwynHFTbLo6n8kIbLiVF3a3BLkrmehJUyEbT9F+Smbi47kLGS2gG2g0fjBLR/Lr1InPD7kXL7FaTqEkw==" - }, - "@types/node": { - "version": "16.3.3", - "resolved": "https://registry.npmjs.org/@types/node/-/node-16.3.3.tgz", - "integrity": "sha512-8h7k1YgQKxKXWckzFCMfsIwn0Y61UK6tlD6y2lOb3hTOIMlK3t9/QwHOhc81TwU+RMf0As5fj7NPjroERCnejQ==" - }, - "anser": { - "version": "1.4.9", - "resolved": "https://registry.npmjs.org/anser/-/anser-1.4.9.tgz", - "integrity": "sha512-AI+BjTeGt2+WFk4eWcqbQ7snZpDBt8SaLlj0RT2h5xfdWaiy51OjYvqwMrNzJLGy8iOAL6nKDITWO+rd4MkYEA==" - }, - "ansi-regex": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.0.tgz", - "integrity": "sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==" - }, - "ansi-styles": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", - "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", - "requires": { - "color-convert": "^1.9.0" - } - }, - "anymatch": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.2.tgz", - "integrity": "sha512-P43ePfOAIupkguHUycrc4qJ9kz8ZiuOUijaETwX7THt0Y/GNK7v0aa8rY816xWjZ7rJdA5XdMcpVFTKMq+RvWg==", - "requires": { - "normalize-path": "^3.0.0", - "picomatch": "^2.0.4" - } - }, - "asn1.js": { - "version": "5.4.1", - "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", - "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", - "requires": { - "bn.js": "^4.0.0", - "inherits": "^2.0.1", - "minimalistic-assert": "^1.0.0", - "safer-buffer": "^2.1.0" - }, - "dependencies": { - "bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - } - } - }, - "assert": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/assert/-/assert-2.0.0.tgz", - "integrity": "sha512-se5Cd+js9dXJnu6Ag2JFc00t+HmHOen+8Q+L7O9zI0PqQXr20uk2J0XQqMxZEeo5U50o8Nvmmx7dZrl+Ufr35A==", - "requires": { - "es6-object-assign": "^1.1.0", - "is-nan": "^1.2.1", - "object-is": "^1.0.1", - "util": "^0.12.0" - } - }, - "ast-types": { - "version": "0.13.2", - "resolved": "https://registry.npmjs.org/ast-types/-/ast-types-0.13.2.tgz", - "integrity": "sha512-uWMHxJxtfj/1oZClOxDEV1sQ1HCDkA4MG8Gr69KKeBjEVH0R84WlejZ0y2DcwyBlpAEMltmVYkVgqfLFb2oyiA==" - }, - "available-typed-arrays": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/available-typed-arrays/-/available-typed-arrays-1.0.4.tgz", - "integrity": "sha512-SA5mXJWrId1TaQjfxUYghbqQ/hYioKmLJvPJyDuYRtXXenFNMjj4hSSt1Cf1xsuXSXrtxrVC5Ot4eU6cOtBDdA==" - }, - "babel-plugin-syntax-jsx": { - "version": "6.18.0", - "resolved": "https://registry.npmjs.org/babel-plugin-syntax-jsx/-/babel-plugin-syntax-jsx-6.18.0.tgz", - "integrity": "sha1-CvMqmm4Tyno/1QaeYtew9Y0NiUY=" - }, - "base64-js": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.5.1.tgz", - "integrity": "sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA==" - }, - "big.js": { - "version": "5.2.2", - "resolved": "https://registry.npmjs.org/big.js/-/big.js-5.2.2.tgz", - "integrity": "sha512-vyL2OymJxmarO8gxMr0mhChsO9QGwhynfuu4+MHTAW6czfq9humCB7rKpUjDd9YUiDPU4mzpyupFSvOClAwbmQ==" - }, - "binary-extensions": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", - "integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==" - }, - "bn.js": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-5.2.0.tgz", - "integrity": "sha512-D7iWRBvnZE8ecXiLj/9wbxH7Tk79fAh8IHaTNq1RWRixsS02W+5qS+iE9yq6RYl0asXx5tw0bLhmT5pIfbSquw==" - }, - "braces": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", - "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", - "requires": { - "fill-range": "^7.0.1" - } - }, - "brorand": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz", - "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=" - }, - "browserify-aes": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz", - "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==", - "requires": { - "buffer-xor": "^1.0.3", - "cipher-base": "^1.0.0", - "create-hash": "^1.1.0", - "evp_bytestokey": "^1.0.3", - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" - } - }, - "browserify-cipher": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz", - "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==", - "requires": { - "browserify-aes": "^1.0.4", - "browserify-des": "^1.0.0", - "evp_bytestokey": "^1.0.0" - } - }, - "browserify-des": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz", - "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==", - "requires": { - "cipher-base": "^1.0.1", - "des.js": "^1.0.0", - "inherits": "^2.0.1", - "safe-buffer": "^5.1.2" - } - }, - "browserify-rsa": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.1.0.tgz", - "integrity": "sha512-AdEER0Hkspgno2aR97SAf6vi0y0k8NuOpGnVH3O99rcA5Q6sh8QxcngtHuJ6uXwnfAXNM4Gn1Gb7/MV1+Ymbog==", - "requires": { - "bn.js": "^5.0.0", - "randombytes": "^2.0.1" - } - }, - "browserify-sign": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.2.1.tgz", - "integrity": "sha512-/vrA5fguVAKKAVTNJjgSm1tRQDHUU6DbwO9IROu/0WAzC8PKhucDSh18J0RMvVeHAn5puMd+QHC2erPRNf8lmg==", - "requires": { - "bn.js": "^5.1.1", - "browserify-rsa": "^4.0.1", - "create-hash": "^1.2.0", - "create-hmac": "^1.1.7", - "elliptic": "^6.5.3", - "inherits": "^2.0.4", - "parse-asn1": "^5.1.5", - "readable-stream": "^3.6.0", - "safe-buffer": "^5.2.0" - } - }, - "browserify-zlib": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz", - "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==", - "requires": { - "pako": "~1.0.5" - } - }, - "browserslist": { - "version": "4.16.6", - "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.16.6.tgz", - "integrity": "sha512-Wspk/PqO+4W9qp5iUTJsa1B/QrYn1keNCcEP5OvP7WBwT4KaDly0uONYmC6Xa3Z5IqnUgS0KcgLYu1l74x0ZXQ==", - "requires": { - "caniuse-lite": "^1.0.30001219", - "colorette": "^1.2.2", - "electron-to-chromium": "^1.3.723", - "escalade": "^3.1.1", - "node-releases": "^1.1.71" - } - }, - "buffer": { - "version": "5.6.0", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-5.6.0.tgz", - "integrity": "sha512-/gDYp/UtU0eA1ys8bOs9J6a+E/KWIY+DZ+Q2WESNUA0jFRsJOc0SNUO6xJ5SGA1xueg3NL65W6s+NY5l9cunuw==", - "requires": { - "base64-js": "^1.0.2", - "ieee754": "^1.1.4" - } - }, - "buffer-xor": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz", - "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=" - }, - "builtin-status-codes": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz", - "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=" - }, - "bytes": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", - "integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==" - }, - "call-bind": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz", - "integrity": "sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA==", - "requires": { - "function-bind": "^1.1.1", - "get-intrinsic": "^1.0.2" - } - }, - "caniuse-lite": { - "version": "1.0.30001245", - "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001245.tgz", - "integrity": "sha512-768fM9j1PKXpOCKws6eTo3RHmvTUsG9UrpT4WoREFeZgJBTi4/X9g565azS/rVUGtqb8nt7FjLeF5u4kukERnA==" - }, - "chalk": { - "version": "2.4.2", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", - "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", - "requires": { - "ansi-styles": "^3.2.1", - "escape-string-regexp": "^1.0.5", - "supports-color": "^5.3.0" - } - }, - "chokidar": { - "version": "3.5.1", - "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.1.tgz", - "integrity": "sha512-9+s+Od+W0VJJzawDma/gvBNQqkTiqYTWLuZoyAsivsI4AaWTCzHG06/TMjsf1cYe9Cb97UCEhjz7HvnPk2p/tw==", - "requires": { - "anymatch": "~3.1.1", - "braces": "~3.0.2", - "fsevents": "~2.3.1", - "glob-parent": "~5.1.0", - "is-binary-path": "~2.1.0", - "is-glob": "~4.0.1", - "normalize-path": "~3.0.0", - "readdirp": "~3.5.0" - } - }, - "cipher-base": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz", - "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==", - "requires": { - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" - } - }, - "classnames": { - "version": "2.2.6", - "resolved": "https://registry.npmjs.org/classnames/-/classnames-2.2.6.tgz", - "integrity": "sha512-JR/iSQOSt+LQIWwrwEzJ9uk0xfN3mTVYMwt1Ir5mUcSN6pU+V4zQFFaJsclJbPuAUQH+yfWef6tm7l1quW3C8Q==" - }, - "color-convert": { - "version": "1.9.3", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", - "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", - "requires": { - "color-name": "1.1.3" - } - }, - "color-name": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", - "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" - }, - "colorette": { - "version": "1.2.2", - "resolved": "https://registry.npmjs.org/colorette/-/colorette-1.2.2.tgz", - "integrity": "sha512-MKGMzyfeuutC/ZJ1cba9NqcNpfeqMUcYmyF1ZFY6/Cn7CNSAKx6a+s48sqLqyAiZuaP2TcqMhoo+dlwFnVxT9w==" - }, - "commondir": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz", - "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=" - }, - "console-browserify": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.2.0.tgz", - "integrity": "sha512-ZMkYO/LkF17QvCPqM0gxw8yUzigAOZOSWSHg91FH6orS7vcEj5dVZTidN2fQ14yBSdg97RqhSNwLUXInd52OTA==" - }, - "constants-browserify": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz", - "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=" - }, - "convert-source-map": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.7.0.tgz", - "integrity": "sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA==", - "requires": { - "safe-buffer": "~5.1.1" - }, - "dependencies": { - "safe-buffer": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", - "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" - } - } - }, - "core-util-is": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", - "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=" - }, - "create-ecdh": { - "version": "4.0.4", - "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.4.tgz", - "integrity": "sha512-mf+TCx8wWc9VpuxfP2ht0iSISLZnt0JgWlrOKZiNqyUZWnjIaCIVNQArMHnCZKfEYRg6IM7A+NeJoN8gf/Ws0A==", - "requires": { - "bn.js": "^4.1.0", - "elliptic": "^6.5.3" - }, - "dependencies": { - "bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - } - } - }, - "create-hash": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz", - "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==", - "requires": { - "cipher-base": "^1.0.1", - "inherits": "^2.0.1", - "md5.js": "^1.3.4", - "ripemd160": "^2.0.1", - "sha.js": "^2.4.0" - } - }, - "create-hmac": { - "version": "1.1.7", - "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz", - "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==", - "requires": { - "cipher-base": "^1.0.3", - "create-hash": "^1.1.0", - "inherits": "^2.0.1", - "ripemd160": "^2.0.0", - "safe-buffer": "^5.0.1", - "sha.js": "^2.4.8" - } - }, - "crypto-browserify": { - "version": "3.12.0", - "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz", - "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==", - "requires": { - "browserify-cipher": "^1.0.0", - "browserify-sign": "^4.0.0", - "create-ecdh": "^4.0.0", - "create-hash": "^1.1.0", - "create-hmac": "^1.1.0", - "diffie-hellman": "^5.0.0", - "inherits": "^2.0.1", - "pbkdf2": "^3.0.3", - "public-encrypt": "^4.0.0", - "randombytes": "^2.0.0", - "randomfill": "^1.0.3" - } - }, - "css.escape": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/css.escape/-/css.escape-1.5.1.tgz", - "integrity": "sha1-QuJ9T6BK4y+TGktNQZH6nN3ul8s=" - }, - "cssnano-preset-simple": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/cssnano-preset-simple/-/cssnano-preset-simple-2.0.0.tgz", - "integrity": "sha512-HkufSLkaBJbKBFx/7aj5HmCK9Ni/JedRQm0mT2qBzMG/dEuJOLnMt2lK6K1rwOOyV4j9aSY+knbW9WoS7BYpzg==", - "requires": { - "caniuse-lite": "^1.0.30001202" - } - }, - "cssnano-simple": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/cssnano-simple/-/cssnano-simple-2.0.0.tgz", - "integrity": "sha512-0G3TXaFxlh/szPEG/o3VcmCwl0N3E60XNb9YZZijew5eIs6fLjJuOPxQd9yEBaX2p/YfJtt49i4vYi38iH6/6w==", - "requires": { - "cssnano-preset-simple": "^2.0.0" - } - }, - "data-uri-to-buffer": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/data-uri-to-buffer/-/data-uri-to-buffer-3.0.1.tgz", - "integrity": "sha512-WboRycPNsVw3B3TL559F7kuBUM4d8CgMEvk6xEJlOp7OBPjt6G7z8WMWlD2rOFZLk6OYfFIUGsCOWzcQH9K2og==" - }, - "debug": { - "version": "2.6.9", - "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", - "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", - "requires": { - "ms": "2.0.0" - } - }, - "define-properties": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz", - "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==", - "requires": { - "object-keys": "^1.0.12" - } - }, - "depd": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", - "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=" - }, - "des.js": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.1.tgz", - "integrity": "sha512-Q0I4pfFrv2VPd34/vfLrFOoRmlYj3OV50i7fskps1jZWK1kApMWWT9G6RRUeYedLcBDIhnSDaUvJMb3AhUlaEA==", - "requires": { - "inherits": "^2.0.1", - "minimalistic-assert": "^1.0.0" - } - }, - "diffie-hellman": { - "version": "5.0.3", - "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz", - "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==", - "requires": { - "bn.js": "^4.1.0", - "miller-rabin": "^4.0.0", - "randombytes": "^2.0.0" - }, - "dependencies": { - "bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - } - } - }, - "domain-browser": { - "version": "4.19.0", - "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-4.19.0.tgz", - "integrity": "sha512-fRA+BaAWOR/yr/t7T9E9GJztHPeFjj8U35ajyAjCDtAAnTn1Rc1f6W6VGPJrO1tkQv9zWu+JRof7z6oQtiYVFQ==" - }, - "electron-to-chromium": { - "version": "1.3.779", - "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.779.tgz", - "integrity": "sha512-nreave0y/1Qhmo8XtO6C/LpawNyC6U26+q7d814/e+tIqUK073pM+4xW7WUXyqCRa5K4wdxHmNMBAi8ap9nEew==" - }, - "elliptic": { - "version": "6.5.4", - "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.5.4.tgz", - "integrity": "sha512-iLhC6ULemrljPZb+QutR5TQGB+pdW6KGD5RSegS+8sorOZT+rdQFbsQFJgvN3eRqNALqJer4oQ16YvJHlU8hzQ==", - "requires": { - "bn.js": "^4.11.9", - "brorand": "^1.1.0", - "hash.js": "^1.0.0", - "hmac-drbg": "^1.0.1", - "inherits": "^2.0.4", - "minimalistic-assert": "^1.0.1", - "minimalistic-crypto-utils": "^1.0.1" - }, - "dependencies": { - "bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - } - } - }, - "emojis-list": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz", - "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=" - }, - "encoding": { - "version": "0.1.13", - "resolved": "https://registry.npmjs.org/encoding/-/encoding-0.1.13.tgz", - "integrity": "sha512-ETBauow1T35Y/WZMkio9jiM0Z5xjHHmJ4XmjZOq1l/dXz3lr2sRn87nJy20RupqSh1F2m3HHPSp8ShIPQJrJ3A==", - "requires": { - "iconv-lite": "^0.6.2" - } - }, - "es-abstract": { - "version": "1.18.3", - "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.18.3.tgz", - "integrity": "sha512-nQIr12dxV7SSxE6r6f1l3DtAeEYdsGpps13dR0TwJg1S8gyp4ZPgy3FZcHBgbiQqnoqSTb+oC+kO4UQ0C/J8vw==", - "requires": { - "call-bind": "^1.0.2", - "es-to-primitive": "^1.2.1", - "function-bind": "^1.1.1", - "get-intrinsic": "^1.1.1", - "has": "^1.0.3", - "has-symbols": "^1.0.2", - "is-callable": "^1.2.3", - "is-negative-zero": "^2.0.1", - "is-regex": "^1.1.3", - "is-string": "^1.0.6", - "object-inspect": "^1.10.3", - "object-keys": "^1.1.1", - "object.assign": "^4.1.2", - "string.prototype.trimend": "^1.0.4", - "string.prototype.trimstart": "^1.0.4", - "unbox-primitive": "^1.0.1" - } - }, - "es-to-primitive": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", - "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", - "requires": { - "is-callable": "^1.1.4", - "is-date-object": "^1.0.1", - "is-symbol": "^1.0.2" - } - }, - "es6-object-assign": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/es6-object-assign/-/es6-object-assign-1.1.0.tgz", - "integrity": "sha1-wsNYJlYkfDnqEHyx5mUrb58kUjw=" - }, - "escalade": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz", - "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==" - }, - "escape-string-regexp": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", - "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=" - }, - "esutils": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", - "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==" - }, - "etag": { - "version": "1.8.1", - "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", - "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=" - }, - "events": { - "version": "3.3.0", - "resolved": "https://registry.npmjs.org/events/-/events-3.3.0.tgz", - "integrity": "sha512-mQw+2fkQbALzQ7V0MY0IqdnXNOeTtP4r0lN9z7AAawCXgqea7bDii20AYrIBrFd/Hx0M2Ocz6S111CaFkUcb0Q==" - }, - "evp_bytestokey": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz", - "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==", - "requires": { - "md5.js": "^1.3.4", - "safe-buffer": "^5.1.1" - } - }, - "fill-range": { - "version": "7.0.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", - "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", - "requires": { - "to-regex-range": "^5.0.1" - } - }, - "find-cache-dir": { - "version": "3.3.1", - "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-3.3.1.tgz", - "integrity": "sha512-t2GDMt3oGC/v+BMwzmllWDuJF/xcDtE5j/fCGbqDD7OLuJkj0cfh1YSA5VKPvwMeLFLNDBkwOKZ2X85jGLVftQ==", - "requires": { - "commondir": "^1.0.1", - "make-dir": "^3.0.2", - "pkg-dir": "^4.1.0" - } - }, - "find-up": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", - "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", - "requires": { - "locate-path": "^5.0.0", - "path-exists": "^4.0.0" - } - }, - "foreach": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/foreach/-/foreach-2.0.5.tgz", - "integrity": "sha1-C+4AUBiusmDQo6865ljdATbsG5k=" - }, - "fsevents": { - "version": "2.3.2", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.2.tgz", - "integrity": "sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==", - "optional": true - }, - "function-bind": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", - "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==" - }, - "get-intrinsic": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.1.1.tgz", - "integrity": "sha512-kWZrnVM42QCiEA2Ig1bG8zjoIMOgxWwYCEeNdwY6Tv/cOSeGpcoX4pXHfKUxNKVoArnrEr2e9srnAxxGIraS9Q==", - "requires": { - "function-bind": "^1.1.1", - "has": "^1.0.3", - "has-symbols": "^1.0.1" - } - }, - "get-orientation": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/get-orientation/-/get-orientation-1.1.2.tgz", - "integrity": "sha512-/pViTfifW+gBbh/RnlFYHINvELT9Znt+SYyDKAUL6uV6By019AK/s+i9XP4jSwq7lwP38Fd8HVeTxym3+hkwmQ==", - "requires": { - "stream-parser": "^0.3.1" - } - }, - "glob-parent": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", - "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", - "requires": { - "is-glob": "^4.0.1" - } - }, - "glob-to-regexp": { - "version": "0.4.1", - "resolved": "https://registry.npmjs.org/glob-to-regexp/-/glob-to-regexp-0.4.1.tgz", - "integrity": "sha512-lkX1HJXwyMcprw/5YUZc2s7DrpAiHB21/V+E1rHUrVNokkvB6bqMzT0VfV6/86ZNabt1k14YOIaT7nDvOX3Iiw==" - }, - "graceful-fs": { - "version": "4.2.6", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.6.tgz", - "integrity": "sha512-nTnJ528pbqxYanhpDYsi4Rd8MAeaBA67+RZ10CM1m3bTAVFEDcd5AuA4a6W5YkGZ1iNXHzZz8T6TBKLeBuNriQ==" - }, - "has": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", - "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", - "requires": { - "function-bind": "^1.1.1" - } - }, - "has-bigints": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/has-bigints/-/has-bigints-1.0.1.tgz", - "integrity": "sha512-LSBS2LjbNBTf6287JEbEzvJgftkF5qFkmCo9hDRpAzKhUOlJ+hx8dd4USs00SgsUNwc4617J9ki5YtEClM2ffA==" - }, - "has-flag": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", - "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=" - }, - "has-symbols": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.2.tgz", - "integrity": "sha512-chXa79rL/UC2KlX17jo3vRGz0azaWEx5tGqZg5pO3NUyEJVB17dMruQlzCCOfUvElghKcm5194+BCRvi2Rv/Gw==" - }, - "hash-base": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.1.0.tgz", - "integrity": "sha512-1nmYp/rhMDiE7AYkDw+lLwlAzz0AntGIe51F3RfFfEqyQ3feY2eI/NcwC6umIQVOASPMsWJLJScWKSSvzL9IVA==", - "requires": { - "inherits": "^2.0.4", - "readable-stream": "^3.6.0", - "safe-buffer": "^5.2.0" - } - }, - "hash.js": { - "version": "1.1.7", - "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.7.tgz", - "integrity": "sha512-taOaskGt4z4SOANNseOviYDvjEJinIkRgmp7LbKP2YTTmVxWBl87s/uzK9r+44BclBSp2X7K1hqeNfz9JbBeXA==", - "requires": { - "inherits": "^2.0.3", - "minimalistic-assert": "^1.0.1" - } - }, - "he": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/he/-/he-1.2.0.tgz", - "integrity": "sha512-F/1DnUGPopORZi0ni+CvrCgHQ5FyEAHRLSApuYWMmrbSwoN2Mn/7k+Gl38gJnR7yyDZk6WLXwiGod1JOWNDKGw==" - }, - "hmac-drbg": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz", - "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=", - "requires": { - "hash.js": "^1.0.3", - "minimalistic-assert": "^1.0.0", - "minimalistic-crypto-utils": "^1.0.1" - } - }, - "http-errors": { - "version": "1.7.3", - "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.7.3.tgz", - "integrity": "sha512-ZTTX0MWrsQ2ZAhA1cejAwDLycFsd7I7nVtnkT3Ol0aqodaKW+0CTZDQ1uBv5whptCnc8e8HeRRJxRs0kmm/Qfw==", - "requires": { - "depd": "~1.1.2", - "inherits": "2.0.4", - "setprototypeof": "1.1.1", - "statuses": ">= 1.5.0 < 2", - "toidentifier": "1.0.0" - } - }, - "https-browserify": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz", - "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=" - }, - "iconv-lite": { - "version": "0.6.3", - "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz", - "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==", - "requires": { - "safer-buffer": ">= 2.1.2 < 3.0.0" - } - }, - "ieee754": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.2.1.tgz", - "integrity": "sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA==" - }, - "inherits": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", - "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" - }, - "is-arguments": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-arguments/-/is-arguments-1.1.0.tgz", - "integrity": "sha512-1Ij4lOMPl/xB5kBDn7I+b2ttPMKa8szhEIrXDuXQD/oe3HJLTLhqhgGspwgyGd6MOywBUqVvYicF72lkgDnIHg==", - "requires": { - "call-bind": "^1.0.0" - } - }, - "is-bigint": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/is-bigint/-/is-bigint-1.0.2.tgz", - "integrity": "sha512-0JV5+SOCQkIdzjBK9buARcV804Ddu7A0Qet6sHi3FimE9ne6m4BGQZfRn+NZiXbBk4F4XmHfDZIipLj9pX8dSA==" - }, - "is-binary-path": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", - "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", - "requires": { - "binary-extensions": "^2.0.0" - } - }, - "is-boolean-object": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/is-boolean-object/-/is-boolean-object-1.1.1.tgz", - "integrity": "sha512-bXdQWkECBUIAcCkeH1unwJLIpZYaa5VvuygSyS/c2lf719mTKZDU5UdDRlpd01UjADgmW8RfqaP+mRaVPdr/Ng==", - "requires": { - "call-bind": "^1.0.2" - } - }, - "is-callable": { - "version": "1.2.3", - "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.3.tgz", - "integrity": "sha512-J1DcMe8UYTBSrKezuIUTUwjXsho29693unXM2YhJUTR2txK/eG47bvNa/wipPFmZFgr/N6f1GA66dv0mEyTIyQ==" - }, - "is-date-object": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.4.tgz", - "integrity": "sha512-/b4ZVsG7Z5XVtIxs/h9W8nvfLgSAyKYdtGWQLbqy6jA1icmgjf8WCoTKgeS4wy5tYaPePouzFMANbnj94c2Z+A==" - }, - "is-extglob": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", - "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=" - }, - "is-generator-function": { - "version": "1.0.9", - "resolved": "https://registry.npmjs.org/is-generator-function/-/is-generator-function-1.0.9.tgz", - "integrity": "sha512-ZJ34p1uvIfptHCN7sFTjGibB9/oBg17sHqzDLfuwhvmN/qLVvIQXRQ8licZQ35WJ8KuEQt/etnnzQFI9C9Ue/A==" - }, - "is-glob": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.1.tgz", - "integrity": "sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==", - "requires": { - "is-extglob": "^2.1.1" - } - }, - "is-nan": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/is-nan/-/is-nan-1.3.2.tgz", - "integrity": "sha512-E+zBKpQ2t6MEo1VsonYmluk9NxGrbzpeeLC2xIViuO2EjU2xsXsBPwTr3Ykv9l08UYEVEdWeRZNouaZqF6RN0w==", - "requires": { - "call-bind": "^1.0.0", - "define-properties": "^1.1.3" - } - }, - "is-negative-zero": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.1.tgz", - "integrity": "sha512-2z6JzQvZRa9A2Y7xC6dQQm4FSTSTNWjKIYYTt4246eMTJmIo0Q+ZyOsU66X8lxK1AbB92dFeglPLrhwpeRKO6w==" - }, - "is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==" - }, - "is-number-object": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/is-number-object/-/is-number-object-1.0.5.tgz", - "integrity": "sha512-RU0lI/n95pMoUKu9v1BZP5MBcZuNSVJkMkAG2dJqC4z2GlkGUNeH68SuHuBKBD/XFe+LHZ+f9BKkLET60Niedw==" - }, - "is-regex": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.3.tgz", - "integrity": "sha512-qSVXFz28HM7y+IWX6vLCsexdlvzT1PJNFSBuaQLQ5o0IEw8UDYW6/2+eCMVyIsbM8CNLX2a/QWmSpyxYEHY7CQ==", - "requires": { - "call-bind": "^1.0.2", - "has-symbols": "^1.0.2" - } - }, - "is-string": { - "version": "1.0.6", - "resolved": "https://registry.npmjs.org/is-string/-/is-string-1.0.6.tgz", - "integrity": "sha512-2gdzbKUuqtQ3lYNrUTQYoClPhm7oQu4UdpSZMp1/DGgkHBT8E2Z1l0yMdb6D4zNAxwDiMv8MdulKROJGNl0Q0w==" - }, - "is-symbol": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.4.tgz", - "integrity": "sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==", - "requires": { - "has-symbols": "^1.0.2" - } - }, - "is-typed-array": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.5.tgz", - "integrity": "sha512-S+GRDgJlR3PyEbsX/Fobd9cqpZBuvUS+8asRqYDMLCb2qMzt1oz5m5oxQCxOgUDxiWsOVNi4yaF+/uvdlHlYug==", - "requires": { - "available-typed-arrays": "^1.0.2", - "call-bind": "^1.0.2", - "es-abstract": "^1.18.0-next.2", - "foreach": "^2.0.5", - "has-symbols": "^1.0.1" - } - }, - "isarray": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz", - "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=" - }, - "jest-worker": { - "version": "27.0.0-next.5", - "resolved": "https://registry.npmjs.org/jest-worker/-/jest-worker-27.0.0-next.5.tgz", - "integrity": "sha512-mk0umAQ5lT+CaOJ+Qp01N6kz48sJG2kr2n1rX0koqKf6FIygQV0qLOdN9SCYID4IVeSigDOcPeGLozdMLYfb5g==", - "requires": { - "@types/node": "*", - "merge-stream": "^2.0.0", - "supports-color": "^8.0.0" - }, - "dependencies": { - "has-flag": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", - "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==" - }, - "supports-color": { - "version": "8.1.1", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-8.1.1.tgz", - "integrity": "sha512-MpUEN2OodtUzxvKQl72cUF7RQ5EiHsGvSsVG0ia9c5RbWGL2CI4C7EpPS8UTBIplnlzZiNuV56w+FuNxy3ty2Q==", - "requires": { - "has-flag": "^4.0.0" - } - } - } - }, - "js-tokens": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", - "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==" - }, - "json5": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.1.tgz", - "integrity": "sha512-aKS4WQjPenRxiQsC93MNfjx+nbF4PAdYzmd/1JIj8HYzqfbu86beTuNgXDzPknWk0n0uARlyewZo4s++ES36Ow==", - "requires": { - "minimist": "^1.2.0" - } - }, - "loader-utils": { - "version": "1.2.3", - "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.2.3.tgz", - "integrity": "sha512-fkpz8ejdnEMG3s37wGL07iSBDg99O9D5yflE9RGNH3hRdx9SOwYfnGYdZOUIZitN8E+E2vkq3MUMYMvPYl5ZZA==", - "requires": { - "big.js": "^5.2.2", - "emojis-list": "^2.0.0", - "json5": "^1.0.1" - } - }, - "locate-path": { - "version": "5.0.0", - "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", - "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", - "requires": { - "p-locate": "^4.1.0" - } - }, - "lodash": { - "version": "4.17.21", - "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.21.tgz", - "integrity": "sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==" - }, - "lodash.sortby": { - "version": "4.7.0", - "resolved": "https://registry.npmjs.org/lodash.sortby/-/lodash.sortby-4.7.0.tgz", - "integrity": "sha1-7dFMgk4sycHgsKG0K7UhBRakJDg=" - }, - "loose-envify": { - "version": "1.4.0", - "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", - "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", - "requires": { - "js-tokens": "^3.0.0 || ^4.0.0" - } - }, - "make-dir": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", - "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", - "requires": { - "semver": "^6.0.0" - } - }, - "md5.js": { - "version": "1.3.5", - "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.5.tgz", - "integrity": "sha512-xitP+WxNPcTTOgnTJcrhM0xvdPepipPSf3I8EIpGKeFLjt3PlJLIDG3u8EX53ZIubkb+5U2+3rELYpEhHhzdkg==", - "requires": { - "hash-base": "^3.0.0", - "inherits": "^2.0.1", - "safe-buffer": "^5.1.2" - } - }, - "merge-stream": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/merge-stream/-/merge-stream-2.0.0.tgz", - "integrity": "sha512-abv/qOcuPfk3URPfDzmZU1LKmuw8kT+0nIHvKrKgFrwifol/doWcdA4ZqsWQ8ENrFKkd67Mfpo/LovbIUsbt3w==" - }, - "miller-rabin": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz", - "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==", - "requires": { - "bn.js": "^4.0.0", - "brorand": "^1.0.1" - }, - "dependencies": { - "bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - } - } - }, - "minimalistic-assert": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", - "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==" - }, - "minimalistic-crypto-utils": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz", - "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=" - }, - "minimist": { - "version": "1.2.5", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.5.tgz", - "integrity": "sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw==" - }, - "ms": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", - "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" - }, - "nanoid": { - "version": "3.1.23", - "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.1.23.tgz", - "integrity": "sha512-FiB0kzdP0FFVGDKlRLEQ1BgDzU87dy5NnzjeW9YZNt+/c3+q82EQDUwniSAUxp/F0gFNI1ZhKU1FqYsMuqZVnw==" - }, - "native-url": { - "version": "0.3.4", - "resolved": "https://registry.npmjs.org/native-url/-/native-url-0.3.4.tgz", - "integrity": "sha512-6iM8R99ze45ivyH8vybJ7X0yekIcPf5GgLV5K0ENCbmRcaRIDoj37BC8iLEmaaBfqqb8enuZ5p0uhY+lVAbAcA==", - "requires": { - "querystring": "^0.2.0" - } - }, - "next": { - "version": "10.2.3", - "resolved": "https://registry.npmjs.org/next/-/next-10.2.3.tgz", - "integrity": "sha512-dkM1mIfnORtGyzw/Yme8RdqNxlCMZyi4Lqj56F01/yHbe1ZtOaJ0cyqqRB4RGiPhjGGh0319f8ddjDyO1605Ow==", - "requires": { - "@babel/runtime": "7.12.5", - "@hapi/accept": "5.0.2", - "@next/env": "10.2.3", - "@next/polyfill-module": "10.2.3", - "@next/react-dev-overlay": "10.2.3", - "@next/react-refresh-utils": "10.2.3", - "@opentelemetry/api": "0.14.0", - "assert": "2.0.0", - "ast-types": "0.13.2", - "browserify-zlib": "0.2.0", - "browserslist": "4.16.6", - "buffer": "5.6.0", - "caniuse-lite": "^1.0.30001228", - "chalk": "2.4.2", - "chokidar": "3.5.1", - "constants-browserify": "1.0.0", - "crypto-browserify": "3.12.0", - "cssnano-simple": "2.0.0", - "domain-browser": "4.19.0", - "encoding": "0.1.13", - "etag": "1.8.1", - "find-cache-dir": "3.3.1", - "get-orientation": "1.1.2", - "https-browserify": "1.0.0", - "jest-worker": "27.0.0-next.5", - "native-url": "0.3.4", - "node-fetch": "2.6.1", - "node-html-parser": "1.4.9", - "node-libs-browser": "^2.2.1", - "os-browserify": "0.3.0", - "p-limit": "3.1.0", - "path-browserify": "1.0.1", - "pnp-webpack-plugin": "1.6.4", - "postcss": "8.2.13", - "process": "0.11.10", - "prop-types": "15.7.2", - "querystring-es3": "0.2.1", - "raw-body": "2.4.1", - "react-is": "16.13.1", - "react-refresh": "0.8.3", - "stream-browserify": "3.0.0", - "stream-http": "3.1.1", - "string_decoder": "1.3.0", - "styled-jsx": "3.3.2", - "timers-browserify": "2.0.12", - "tty-browserify": "0.0.1", - "use-subscription": "1.5.1", - "util": "0.12.3", - "vm-browserify": "1.1.2", - "watchpack": "2.1.1" - } - }, - "node-fetch": { - "version": "2.6.1", - "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.1.tgz", - "integrity": "sha512-V4aYg89jEoVRxRb2fJdAg8FHvI7cEyYdVAh94HH0UIK8oJxUfkjlDQN9RbMx+bEjP7+ggMiFRprSti032Oipxw==" - }, - "node-html-parser": { - "version": "1.4.9", - "resolved": "https://registry.npmjs.org/node-html-parser/-/node-html-parser-1.4.9.tgz", - "integrity": "sha512-UVcirFD1Bn0O+TSmloHeHqZZCxHjvtIeGdVdGMhyZ8/PWlEiZaZ5iJzR189yKZr8p0FXN58BUeC7RHRkf/KYGw==", - "requires": { - "he": "1.2.0" - } - }, - "node-libs-browser": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.2.1.tgz", - "integrity": "sha512-h/zcD8H9kaDZ9ALUWwlBUDo6TKF8a7qBSCSEGfjTVIYeqsioSKaAX+BN7NgiMGp6iSIXZ3PxgCu8KS3b71YK5Q==", - "requires": { - "assert": "^1.1.1", - "browserify-zlib": "^0.2.0", - "buffer": "^4.3.0", - "console-browserify": "^1.1.0", - "constants-browserify": "^1.0.0", - "crypto-browserify": "^3.11.0", - "domain-browser": "^1.1.1", - "events": "^3.0.0", - "https-browserify": "^1.0.0", - "os-browserify": "^0.3.0", - "path-browserify": "0.0.1", - "process": "^0.11.10", - "punycode": "^1.2.4", - "querystring-es3": "^0.2.0", - "readable-stream": "^2.3.3", - "stream-browserify": "^2.0.1", - "stream-http": "^2.7.2", - "string_decoder": "^1.0.0", - "timers-browserify": "^2.0.4", - "tty-browserify": "0.0.0", - "url": "^0.11.0", - "util": "^0.11.0", - "vm-browserify": "^1.0.1" - }, - "dependencies": { - "assert": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/assert/-/assert-1.5.0.tgz", - "integrity": "sha512-EDsgawzwoun2CZkCgtxJbv392v4nbk9XDD06zI+kQYoBM/3RBWLlEyJARDOmhAAosBjWACEkKL6S+lIZtcAubA==", - "requires": { - "object-assign": "^4.1.1", - "util": "0.10.3" - }, - "dependencies": { - "util": { - "version": "0.10.3", - "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz", - "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=", - "requires": { - "inherits": "2.0.1" - } - } - } - }, - "buffer": { - "version": "4.9.2", - "resolved": "https://registry.npmjs.org/buffer/-/buffer-4.9.2.tgz", - "integrity": "sha512-xq+q3SRMOxGivLhBNaUdC64hDTQwejJ+H0T/NB1XMtTVEwNTrfFF3gAxiyW0Bu/xWEGhjVKgUcMhCrUy2+uCWg==", - "requires": { - "base64-js": "^1.0.2", - "ieee754": "^1.1.4", - "isarray": "^1.0.0" - } - }, - "domain-browser": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz", - "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==" - }, - "inherits": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz", - "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=" - }, - "path-browserify": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.1.tgz", - "integrity": "sha512-BapA40NHICOS+USX9SN4tyhq+A2RrN/Ws5F0Z5aMHDp98Fl86lX8Oti8B7uN93L4Ifv4fHOEA+pQw87gmMO/lQ==" - }, - "punycode": { - "version": "1.4.1", - "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz", - "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=" - }, - "readable-stream": { - "version": "2.3.7", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.7.tgz", - "integrity": "sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw==", - "requires": { - "core-util-is": "~1.0.0", - "inherits": "~2.0.3", - "isarray": "~1.0.0", - "process-nextick-args": "~2.0.0", - "safe-buffer": "~5.1.1", - "string_decoder": "~1.1.1", - "util-deprecate": "~1.0.1" - }, - "dependencies": { - "inherits": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", - "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" - }, - "string_decoder": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz", - "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==", - "requires": { - "safe-buffer": "~5.1.0" - } - } - } - }, - "safe-buffer": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", - "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" - }, - "stream-browserify": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.2.tgz", - "integrity": "sha512-nX6hmklHs/gr2FuxYDltq8fJA1GDlxKQCz8O/IM4atRqBH8OORmBNgfvW5gG10GT/qQ9u0CzIvr2X5Pkt6ntqg==", - "requires": { - "inherits": "~2.0.1", - "readable-stream": "^2.0.2" - } - }, - "stream-http": { - "version": "2.8.3", - "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz", - "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==", - "requires": { - "builtin-status-codes": "^3.0.0", - "inherits": "^2.0.1", - "readable-stream": "^2.3.6", - "to-arraybuffer": "^1.0.0", - "xtend": "^4.0.0" - } - }, - "tty-browserify": { - "version": "0.0.0", - "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz", - "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=" - }, - "util": { - "version": "0.11.1", - "resolved": "https://registry.npmjs.org/util/-/util-0.11.1.tgz", - "integrity": "sha512-HShAsny+zS2TZfaXxD9tYj4HQGlBezXZMZuM/S5PKLLoZkShZiGk9o5CzukI1LVHZvjdvZ2Sj1aW/Ndn2NB/HQ==", - "requires": { - "inherits": "2.0.3" - }, - "dependencies": { - "inherits": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", - "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" - } - } - } - } - }, - "node-releases": { - "version": "1.1.73", - "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-1.1.73.tgz", - "integrity": "sha512-uW7fodD6pyW2FZNZnp/Z3hvWKeEW1Y8R1+1CnErE8cXFXzl5blBOoVB41CvMer6P6Q0S5FXDwcHgFd1Wj0U9zg==" - }, - "normalize-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", - "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==" - }, - "object-assign": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", - "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=" - }, - "object-inspect": { - "version": "1.11.0", - "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.11.0.tgz", - "integrity": "sha512-jp7ikS6Sd3GxQfZJPyH3cjcbJF6GZPClgdV+EFygjFLQ5FmW/dRUnTd9PQ9k0JhoNDabWFbpF1yCdSWCC6gexg==" - }, - "object-is": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/object-is/-/object-is-1.1.5.tgz", - "integrity": "sha512-3cyDsyHgtmi7I7DfSSI2LDp6SK2lwvtbg0p0R1e0RvTqF5ceGx+K2dfSjm1bKDMVCFEDAQvy+o8c6a7VujOddw==", - "requires": { - "call-bind": "^1.0.2", - "define-properties": "^1.1.3" - } - }, - "object-keys": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", - "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==" - }, - "object.assign": { - "version": "4.1.2", - "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.2.tgz", - "integrity": "sha512-ixT2L5THXsApyiUPYKmW+2EHpXXe5Ii3M+f4e+aJFAHao5amFRW6J0OO6c/LU8Be47utCx2GL89hxGB6XSmKuQ==", - "requires": { - "call-bind": "^1.0.0", - "define-properties": "^1.1.3", - "has-symbols": "^1.0.1", - "object-keys": "^1.1.1" - } - }, - "os-browserify": { - "version": "0.3.0", - "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz", - "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=" - }, - "p-limit": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz", - "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==", - "requires": { - "yocto-queue": "^0.1.0" - } - }, - "p-locate": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", - "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", - "requires": { - "p-limit": "^2.2.0" - }, - "dependencies": { - "p-limit": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", - "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", - "requires": { - "p-try": "^2.0.0" - } - } - } - }, - "p-try": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", - "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==" - }, - "pako": { - "version": "1.0.11", - "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.11.tgz", - "integrity": "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw==" - }, - "parse-asn1": { - "version": "5.1.6", - "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.6.tgz", - "integrity": "sha512-RnZRo1EPU6JBnra2vGHj0yhp6ebyjBZpmUCLHWiFhxlzvBCCpAuZ7elsBp1PVAbQN0/04VD/19rfzlBSwLstMw==", - "requires": { - "asn1.js": "^5.2.0", - "browserify-aes": "^1.0.0", - "evp_bytestokey": "^1.0.0", - "pbkdf2": "^3.0.3", - "safe-buffer": "^5.1.1" - } - }, - "path-browserify": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-1.0.1.tgz", - "integrity": "sha512-b7uo2UCUOYZcnF/3ID0lulOJi/bafxa1xPe7ZPsammBSpjSWQkjNxlt635YGS2MiR9GjvuXCtz2emr3jbsz98g==" - }, - "path-exists": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", - "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==" - }, - "pbkdf2": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.1.2.tgz", - "integrity": "sha512-iuh7L6jA7JEGu2WxDwtQP1ddOpaJNC4KlDEFfdQajSGgGPNi4OyDc2R7QnbY2bR9QjBVGwgvTdNJZoE7RaxUMA==", - "requires": { - "create-hash": "^1.1.2", - "create-hmac": "^1.1.4", - "ripemd160": "^2.0.1", - "safe-buffer": "^5.0.1", - "sha.js": "^2.4.8" - } - }, - "picomatch": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.0.tgz", - "integrity": "sha512-lY1Q/PiJGC2zOv/z391WOTD+Z02bCgsFfvxoXXf6h7kv9o+WmsmzYqrAwY63sNgOxE4xEdq0WyUnXfKeBrSvYw==" - }, - "pkg-dir": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-4.2.0.tgz", - "integrity": "sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ==", - "requires": { - "find-up": "^4.0.0" - } - }, - "platform": { - "version": "1.3.6", - "resolved": "https://registry.npmjs.org/platform/-/platform-1.3.6.tgz", - "integrity": "sha512-fnWVljUchTro6RiCFvCXBbNhJc2NijN7oIQxbwsyL0buWJPG85v81ehlHI9fXrJsMNgTofEoWIQeClKpgxFLrg==" - }, - "pnp-webpack-plugin": { - "version": "1.6.4", - "resolved": "https://registry.npmjs.org/pnp-webpack-plugin/-/pnp-webpack-plugin-1.6.4.tgz", - "integrity": "sha512-7Wjy+9E3WwLOEL30D+m8TSTF7qJJUJLONBnwQp0518siuMxUQUbgZwssaFX+QKlZkjHZcw/IpZCt/H0srrntSg==", - "requires": { - "ts-pnp": "^1.1.6" - } - }, - "postcss": { - "version": "8.2.13", - "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.2.13.tgz", - "integrity": "sha512-FCE5xLH+hjbzRdpbRb1IMCvPv9yZx2QnDarBEYSN0N0HYk+TcXsEhwdFcFb+SRWOKzKGErhIEbBK2ogyLdTtfQ==", - "requires": { - "colorette": "^1.2.2", - "nanoid": "^3.1.22", - "source-map": "^0.6.1" - }, - "dependencies": { - "source-map": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz", - "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==" - } - } - }, - "process": { - "version": "0.11.10", - "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz", - "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=" - }, - "process-nextick-args": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.1.tgz", - "integrity": "sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==" - }, - "prop-types": { - "version": "15.7.2", - "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.7.2.tgz", - "integrity": "sha512-8QQikdH7//R2vurIJSutZ1smHYTcLpRWEOlHnzcWHmBYrOGUysKwSsrC89BCiFj3CbrfJ/nXFdJepOVrY1GCHQ==", - "requires": { - "loose-envify": "^1.4.0", - "object-assign": "^4.1.1", - "react-is": "^16.8.1" - } - }, - "public-encrypt": { - "version": "4.0.3", - "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.3.tgz", - "integrity": "sha512-zVpa8oKZSz5bTMTFClc1fQOnyyEzpl5ozpi1B5YcvBrdohMjH2rfsBtyXcuNuwjsDIXmBYlF2N5FlJYhR29t8Q==", - "requires": { - "bn.js": "^4.1.0", - "browserify-rsa": "^4.0.0", - "create-hash": "^1.1.0", - "parse-asn1": "^5.0.0", - "randombytes": "^2.0.1", - "safe-buffer": "^5.1.2" - }, - "dependencies": { - "bn.js": { - "version": "4.12.0", - "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.0.tgz", - "integrity": "sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA==" - } - } - }, - "punycode": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz", - "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==" - }, - "querystring": { - "version": "0.2.1", - "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.1.tgz", - "integrity": "sha512-wkvS7mL/JMugcup3/rMitHmd9ecIGd2lhFhK9N3UUQ450h66d1r3Y9nvXzQAW1Lq+wyx61k/1pfKS5KuKiyEbg==" - }, - "querystring-es3": { - "version": "0.2.1", - "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz", - "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=" - }, - "randombytes": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.1.0.tgz", - "integrity": "sha512-vYl3iOX+4CKUWuxGi9Ukhie6fsqXqS9FE2Zaic4tNFD2N2QQaXOMFbuKK4QmDHC0JO6B1Zp41J0LpT0oR68amQ==", - "requires": { - "safe-buffer": "^5.1.0" - } - }, - "randomfill": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz", - "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==", - "requires": { - "randombytes": "^2.0.5", - "safe-buffer": "^5.1.0" - } - }, - "raw-body": { - "version": "2.4.1", - "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.1.tgz", - "integrity": "sha512-9WmIKF6mkvA0SLmA2Knm9+qj89e+j1zqgyn8aXGd7+nAduPoqgI9lO57SAZNn/Byzo5P7JhXTyg9PzaJbH73bA==", - "requires": { - "bytes": "3.1.0", - "http-errors": "1.7.3", - "iconv-lite": "0.4.24", - "unpipe": "1.0.0" - }, - "dependencies": { - "iconv-lite": { - "version": "0.4.24", - "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", - "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", - "requires": { - "safer-buffer": ">= 2.1.2 < 3" - } - } - } - }, - "react": { - "version": "17.0.2", - "resolved": "https://registry.npmjs.org/react/-/react-17.0.2.tgz", - "integrity": "sha512-gnhPt75i/dq/z3/6q/0asP78D0u592D5L1pd7M8P+dck6Fu/jJeL6iVVK23fptSUZj8Vjf++7wXA8UNclGQcbA==", - "requires": { - "loose-envify": "^1.1.0", - "object-assign": "^4.1.1" - } - }, - "react-dom": { - "version": "17.0.2", - "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-17.0.2.tgz", - "integrity": "sha512-s4h96KtLDUQlsENhMn1ar8t2bEa+q/YAtj8pPPdIjPDGBDIVNsrD9aXNWqspUe6AzKCIG0C1HZZLqLV7qpOBGA==", - "requires": { - "loose-envify": "^1.1.0", - "object-assign": "^4.1.1", - "scheduler": "^0.20.2" - } - }, - "react-is": { - "version": "16.13.1", - "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz", - "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==" - }, - "react-refresh": { - "version": "0.8.3", - "resolved": "https://registry.npmjs.org/react-refresh/-/react-refresh-0.8.3.tgz", - "integrity": "sha512-X8jZHc7nCMjaCqoU+V2I0cOhNW+QMBwSUkeXnTi8IPe6zaRWfn60ZzvFDZqWPfmSJfjub7dDW1SP0jaHWLu/hg==" - }, - "readable-stream": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", - "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", - "requires": { - "inherits": "^2.0.3", - "string_decoder": "^1.1.1", - "util-deprecate": "^1.0.1" - } - }, - "readdirp": { - "version": "3.5.0", - "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.5.0.tgz", - "integrity": "sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ==", - "requires": { - "picomatch": "^2.2.1" - } - }, - "regenerator-runtime": { - "version": "0.13.7", - "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz", - "integrity": "sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew==" - }, - "ripemd160": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz", - "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==", - "requires": { - "hash-base": "^3.0.0", - "inherits": "^2.0.1" - } - }, - "safe-buffer": { - "version": "5.2.1", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", - "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==" - }, - "safer-buffer": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", - "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" - }, - "scheduler": { - "version": "0.20.2", - "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.20.2.tgz", - "integrity": "sha512-2eWfGgAqqWFGqtdMmcL5zCMK1U8KlXv8SQFGglL3CEtd0aDVDWgeF/YoCmvln55m5zSk3J/20hTaSBeSObsQDQ==", - "requires": { - "loose-envify": "^1.1.0", - "object-assign": "^4.1.1" - } - }, - "semver": { - "version": "6.3.0", - "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", - "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==" - }, - "setimmediate": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz", - "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=" - }, - "setprototypeof": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.1.tgz", - "integrity": "sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw==" - }, - "sha.js": { - "version": "2.4.11", - "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz", - "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==", - "requires": { - "inherits": "^2.0.1", - "safe-buffer": "^5.0.1" - } - }, - "shell-quote": { - "version": "1.7.2", - "resolved": "https://registry.npmjs.org/shell-quote/-/shell-quote-1.7.2.tgz", - "integrity": "sha512-mRz/m/JVscCrkMyPqHc/bczi3OQHkLTqXHEFu0zDhK/qfv3UcOA4SVmRCLmos4bhjr9ekVQubj/R7waKapmiQg==" - }, - "source-map": { - "version": "0.8.0-beta.0", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.8.0-beta.0.tgz", - "integrity": "sha512-2ymg6oRBpebeZi9UUNsgQ89bhx01TcTkmNTGnNO88imTmbSgy4nfujrgVEFKWpMTEGA11EDkTt7mqObTPdigIA==", - "requires": { - "whatwg-url": "^7.0.0" - } - }, - "stacktrace-parser": { - "version": "0.1.10", - "resolved": "https://registry.npmjs.org/stacktrace-parser/-/stacktrace-parser-0.1.10.tgz", - "integrity": "sha512-KJP1OCML99+8fhOHxwwzyWrlUuVX5GQ0ZpJTd1DFXhdkrvg1szxfHhawXUZ3g9TkXORQd4/WG68jMlQZ2p8wlg==", - "requires": { - "type-fest": "^0.7.1" - } - }, - "statuses": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", - "integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=" - }, - "stream-browserify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-3.0.0.tgz", - "integrity": "sha512-H73RAHsVBapbim0tU2JwwOiXUj+fikfiaoYAKHF3VJfA0pe2BCzkhAHBlLG6REzE+2WNZcxOXjK7lkso+9euLA==", - "requires": { - "inherits": "~2.0.4", - "readable-stream": "^3.5.0" - } - }, - "stream-http": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-3.1.1.tgz", - "integrity": "sha512-S7OqaYu0EkFpgeGFb/NPOoPLxFko7TPqtEeFg5DXPB4v/KETHG0Ln6fRFrNezoelpaDKmycEmmZ81cC9DAwgYg==", - "requires": { - "builtin-status-codes": "^3.0.0", - "inherits": "^2.0.4", - "readable-stream": "^3.6.0", - "xtend": "^4.0.2" - } - }, - "stream-parser": { - "version": "0.3.1", - "resolved": "https://registry.npmjs.org/stream-parser/-/stream-parser-0.3.1.tgz", - "integrity": "sha1-FhhUhpRCACGhGC/wrxkRwSl2F3M=", - "requires": { - "debug": "2" - } - }, - "string_decoder": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz", - "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==", - "requires": { - "safe-buffer": "~5.2.0" - } - }, - "string-hash": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/string-hash/-/string-hash-1.1.3.tgz", - "integrity": "sha1-6Kr8CsGFW0Zmkp7X3RJ1311sgRs=" - }, - "string.prototype.trimend": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.4.tgz", - "integrity": "sha512-y9xCjw1P23Awk8EvTpcyL2NIr1j7wJ39f+k6lvRnSMz+mz9CGz9NYPelDk42kOz6+ql8xjfK8oYzy3jAP5QU5A==", - "requires": { - "call-bind": "^1.0.2", - "define-properties": "^1.1.3" - } - }, - "string.prototype.trimstart": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.4.tgz", - "integrity": "sha512-jh6e984OBfvxS50tdY2nRZnoC5/mLFKOREQfw8t5yytkoUsJRNxvI/E39qu1sD0OtWI3OC0XgKSmcWwziwYuZw==", - "requires": { - "call-bind": "^1.0.2", - "define-properties": "^1.1.3" - } - }, - "strip-ansi": { - "version": "6.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.0.tgz", - "integrity": "sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==", - "requires": { - "ansi-regex": "^5.0.0" - } - }, - "styled-jsx": { - "version": "3.3.2", - "resolved": "https://registry.npmjs.org/styled-jsx/-/styled-jsx-3.3.2.tgz", - "integrity": "sha512-daAkGd5mqhbBhLd6jYAjYBa9LpxYCzsgo/f6qzPdFxVB8yoGbhxvzQgkC0pfmCVvW3JuAEBn0UzFLBfkHVZG1g==", - "requires": { - "@babel/types": "7.8.3", - "babel-plugin-syntax-jsx": "6.18.0", - "convert-source-map": "1.7.0", - "loader-utils": "1.2.3", - "source-map": "0.7.3", - "string-hash": "1.1.3", - "stylis": "3.5.4", - "stylis-rule-sheet": "0.0.10" - }, - "dependencies": { - "source-map": { - "version": "0.7.3", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.7.3.tgz", - "integrity": "sha512-CkCj6giN3S+n9qrYiBTX5gystlENnRW5jZeNLHpe6aue+SrHcG5VYwujhW9s4dY31mEGsxBDrHR6oI69fTXsaQ==" - } - } - }, - "stylis": { - "version": "3.5.4", - "resolved": "https://registry.npmjs.org/stylis/-/stylis-3.5.4.tgz", - "integrity": "sha512-8/3pSmthWM7lsPBKv7NXkzn2Uc9W7NotcwGNpJaa3k7WMM1XDCA4MgT5k/8BIexd5ydZdboXtU90XH9Ec4Bv/Q==" - }, - "stylis-rule-sheet": { - "version": "0.0.10", - "resolved": "https://registry.npmjs.org/stylis-rule-sheet/-/stylis-rule-sheet-0.0.10.tgz", - "integrity": "sha512-nTbZoaqoBnmK+ptANthb10ZRZOGC+EmTLLUxeYIuHNkEKcmKgXX1XWKkUBT2Ac4es3NybooPe0SmvKdhKJZAuw==", - "requires": {} - }, - "supports-color": { - "version": "5.5.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", - "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", - "requires": { - "has-flag": "^3.0.0" - } - }, - "timers-browserify": { - "version": "2.0.12", - "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.12.tgz", - "integrity": "sha512-9phl76Cqm6FhSX9Xe1ZUAMLtm1BLkKj2Qd5ApyWkXzsMRaA7dgr81kf4wJmQf/hAvg8EEyJxDo3du/0KlhPiKQ==", - "requires": { - "setimmediate": "^1.0.4" - } - }, - "to-arraybuffer": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz", - "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=" - }, - "to-fast-properties": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", - "integrity": "sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=" - }, - "to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "requires": { - "is-number": "^7.0.0" - } - }, - "toidentifier": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", - "integrity": "sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw==" - }, - "tr46": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/tr46/-/tr46-1.0.1.tgz", - "integrity": "sha1-qLE/1r/SSJUZZ0zN5VujaTtwbQk=", - "requires": { - "punycode": "^2.1.0" - } - }, - "ts-pnp": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/ts-pnp/-/ts-pnp-1.2.0.tgz", - "integrity": "sha512-csd+vJOb/gkzvcCHgTGSChYpy5f1/XKNsmvBGO4JXS+z1v2HobugDz4s1IeFXM3wZB44uczs+eazB5Q/ccdhQw==" - }, - "tty-browserify": { - "version": "0.0.1", - "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.1.tgz", - "integrity": "sha512-C3TaO7K81YvjCgQH9Q1S3R3P3BtN3RIM8n+OvX4il1K1zgE8ZhI0op7kClgkxtutIE8hQrcrHBXvIheqKUUCxw==" - }, - "type-fest": { - "version": "0.7.1", - "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.7.1.tgz", - "integrity": "sha512-Ne2YiiGN8bmrmJJEuTWTLJR32nh/JdL1+PSicowtNb0WFpn59GK8/lfD61bVtzguz7b3PBt74nxpv/Pw5po5Rg==" - }, - "unbox-primitive": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/unbox-primitive/-/unbox-primitive-1.0.1.tgz", - "integrity": "sha512-tZU/3NqK3dA5gpE1KtyiJUrEB0lxnGkMFHptJ7q6ewdZ8s12QrODwNbhIJStmJkd1QDXa1NRA8aF2A1zk/Ypyw==", - "requires": { - "function-bind": "^1.1.1", - "has-bigints": "^1.0.1", - "has-symbols": "^1.0.2", - "which-boxed-primitive": "^1.0.2" - } - }, - "unpipe": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", - "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=" - }, - "url": { - "version": "0.11.0", - "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz", - "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=", - "requires": { - "punycode": "1.3.2", - "querystring": "0.2.0" - }, - "dependencies": { - "punycode": { - "version": "1.3.2", - "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz", - "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=" - }, - "querystring": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz", - "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=" - } - } - }, - "use-subscription": { - "version": "1.5.1", - "resolved": "https://registry.npmjs.org/use-subscription/-/use-subscription-1.5.1.tgz", - "integrity": "sha512-Xv2a1P/yReAjAbhylMfFplFKj9GssgTwN7RlcTxBujFQcloStWNDQdc4g4NRWH9xS4i/FDk04vQBptAXoF3VcA==", - "requires": { - "object-assign": "^4.1.1" - } - }, - "util": { - "version": "0.12.3", - "resolved": "https://registry.npmjs.org/util/-/util-0.12.3.tgz", - "integrity": "sha512-I8XkoQwE+fPQEhy9v012V+TSdH2kp9ts29i20TaaDUXsg7x/onePbhFJUExBfv/2ay1ZOp/Vsm3nDlmnFGSAog==", - "requires": { - "inherits": "^2.0.3", - "is-arguments": "^1.0.4", - "is-generator-function": "^1.0.7", - "is-typed-array": "^1.1.3", - "safe-buffer": "^5.1.2", - "which-typed-array": "^1.1.2" - } - }, - "util-deprecate": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", - "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" - }, - "vm-browserify": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-1.1.2.tgz", - "integrity": "sha512-2ham8XPWTONajOR0ohOKOHXkm3+gaBmGut3SRuu75xLd/RRaY6vqgh8NBYYk7+RW3u5AtzPQZG8F10LHkl0lAQ==" - }, - "watchpack": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-2.1.1.tgz", - "integrity": "sha512-Oo7LXCmc1eE1AjyuSBmtC3+Wy4HcV8PxWh2kP6fOl8yTlNS7r0K9l1ao2lrrUza7V39Y3D/BbJgY8VeSlc5JKw==", - "requires": { - "glob-to-regexp": "^0.4.1", - "graceful-fs": "^4.1.2" - } - }, - "webidl-conversions": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/webidl-conversions/-/webidl-conversions-4.0.2.tgz", - "integrity": "sha512-YQ+BmxuTgd6UXZW3+ICGfyqRyHXVlD5GtQr5+qjiNW7bF0cqrzX500HVXPBOvgXb5YnzDd+h0zqyv61KUD7+Sg==" - }, - "whatwg-url": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/whatwg-url/-/whatwg-url-7.1.0.tgz", - "integrity": "sha512-WUu7Rg1DroM7oQvGWfOiAK21n74Gg+T4elXEQYkOhtyLeWiJFoOGLXPKI/9gzIie9CtwVLm8wtw6YJdKyxSjeg==", - "requires": { - "lodash.sortby": "^4.7.0", - "tr46": "^1.0.1", - "webidl-conversions": "^4.0.2" - } - }, - "which-boxed-primitive": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz", - "integrity": "sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg==", - "requires": { - "is-bigint": "^1.0.1", - "is-boolean-object": "^1.1.0", - "is-number-object": "^1.0.4", - "is-string": "^1.0.5", - "is-symbol": "^1.0.3" - } - }, - "which-typed-array": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.4.tgz", - "integrity": "sha512-49E0SpUe90cjpoc7BOJwyPHRqSAd12c10Qm2amdEZrJPCY2NDxaW01zHITrem+rnETY3dwrbH3UUrUwagfCYDA==", - "requires": { - "available-typed-arrays": "^1.0.2", - "call-bind": "^1.0.0", - "es-abstract": "^1.18.0-next.1", - "foreach": "^2.0.5", - "function-bind": "^1.1.1", - "has-symbols": "^1.0.1", - "is-typed-array": "^1.1.3" - } - }, - "xtend": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.2.tgz", - "integrity": "sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==" - }, - "yocto-queue": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz", - "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==" - } - } -} diff --git a/package.json b/package.json deleted file mode 100644 index 30ab4e0..0000000 --- a/package.json +++ /dev/null @@ -1,20 +0,0 @@ -{ - "name": "nextjs", - "version": "0.1.0", - "private": true, - "scripts": { - "dev": "next dev", - "build": "next build", - "start": "next start" - }, - "dependencies": { - "@fortawesome/fontawesome-free": "^5.15.3", - "@fortawesome/fontawesome-svg-core": "^1.2.35", - "@fortawesome/free-brands-svg-icons": "^5.15.3", - "@fortawesome/free-solid-svg-icons": "^5.15.3", - "@fortawesome/react-fontawesome": "^0.1.14", - "next": "10.x", - "react": "17.x", - "react-dom": "17.x" - } -} diff --git a/pages/_app.js b/pages/_app.js deleted file mode 100644 index b1b81c4..0000000 --- a/pages/_app.js +++ /dev/null @@ -1,11 +0,0 @@ -import '../styles/globals.css' - -import '@fortawesome/fontawesome-svg-core/styles.css'; -import { config } from '@fortawesome/fontawesome-svg-core'; -config.autoAddCss = false; /* eslint-disable import/first */ - -function MyApp({ Component, pageProps }) { - return -} - -export default MyApp diff --git a/pages/api/hello.js b/pages/api/hello.js deleted file mode 100644 index cd2378c..0000000 --- a/pages/api/hello.js +++ /dev/null @@ -1,6 +0,0 @@ -// Next.js API route support: https://nextjs.org/docs/api-routes/introduction - -export default (req, res) => { - res.statusCode = 200 - res.json({ name: 'John Doe' }) -} diff --git a/pages/home.js b/pages/home.js deleted file mode 100644 index 096a191..0000000 --- a/pages/home.js +++ /dev/null @@ -1,65 +0,0 @@ -import Head from 'next/head' -import styles from '../styles/Home.module.css' - -export default function Home() { - return ( -
- - Create Next App - - - -
-

- Welcome to Next.js! -

- -

- Get started by editing{' '} - pages/index.js -

- -
- -

Documentation →

-

Find in-depth information about Next.js features and API.

-
- - -

Learn →

-

Learn about Next.js in an interactive course with quizzes!

-
- - -

Examples →

-

Discover and deploy boilerplate example Next.js projects.

-
- - -

Deploy →

-

- Instantly deploy your Next.js site to a public URL with Vercel. -

-
-
-
- - -
- ) -} diff --git a/pages/index.js b/pages/index.js deleted file mode 100644 index 9ee43f0..0000000 --- a/pages/index.js +++ /dev/null @@ -1,92 +0,0 @@ -import Head from 'next/head' -import HeadComponent from '../components/head.js' -import Menu from '../components/menu.js' -import Image from 'next/image' -import styles from '../styles/Index.module.css' - -import { FontAwesomeIcon } from '@fortawesome/react-fontawesome' -import { faDiscord } from '@fortawesome/free-brands-svg-icons' -import { faTwitter } from '@fortawesome/free-brands-svg-icons' -import { faSpotify } from '@fortawesome/free-brands-svg-icons' -import { faSteam } from '@fortawesome/free-brands-svg-icons' -import { faSoundcloud } from '@fortawesome/free-brands-svg-icons' -import { faEnvelope } from '@fortawesome/free-solid-svg-icons' - -export default function Index() { - return ( -
- - - Invesvpo | Landing Page - - -
- - -
- -
-
- -
- -
-

INVESVPO

-

aka
Fuhz — Elikas — C2RW

-
-
- -
-
-

- {`Hey I'm Invesvpo, I make some cool 3d models including guns and I'm trying to learn more about it.`}
- {`I also make music, so check out my Spotify and SoundCloud below. `}
- {`A lot of my songs are made to be downtempo ambient songs.`} -

-
- - -
-
-
- ) -} \ No newline at end of file diff --git a/pages/models.js b/pages/models.js deleted file mode 100644 index 77fef91..0000000 --- a/pages/models.js +++ /dev/null @@ -1,9 +0,0 @@ -import Head from 'next/head' - -export default function Models() { - return ( -
- -
- ) -} \ No newline at end of file diff --git a/pages/music.js b/pages/music.js deleted file mode 100644 index 8e8a21e..0000000 --- a/pages/music.js +++ /dev/null @@ -1,9 +0,0 @@ -import Head from 'next/head' - -export default function Music() { - return ( -
- -
- ) -} \ No newline at end of file diff --git a/public/fonts/Anurati-Regular.otf b/public/fonts/Anurati-Regular.otf deleted file mode 100644 index ad37593..0000000 Binary files a/public/fonts/Anurati-Regular.otf and /dev/null differ diff --git a/public/fonts/Blanka-Regular.otf b/public/fonts/Blanka-Regular.otf deleted file mode 100644 index 60b18d7..0000000 Binary files a/public/fonts/Blanka-Regular.otf and /dev/null differ diff --git a/public/fonts/Blanka-Regular.ttf b/public/fonts/Blanka-Regular.ttf deleted file mode 100644 index e07a843..0000000 Binary files a/public/fonts/Blanka-Regular.ttf and /dev/null differ diff --git a/public/fonts/Dual-300.otf b/public/fonts/Dual-300.otf deleted file mode 100644 index 605cba0..0000000 Binary files a/public/fonts/Dual-300.otf and /dev/null differ diff --git a/public/fonts/Dual-300.ttf b/public/fonts/Dual-300.ttf deleted file mode 100644 index dcb39f0..0000000 Binary files a/public/fonts/Dual-300.ttf and /dev/null differ diff --git a/public/fonts/Elianto-Regular.otf b/public/fonts/Elianto-Regular.otf deleted file mode 100644 index 6ad449c..0000000 Binary files a/public/fonts/Elianto-Regular.otf and /dev/null differ diff --git a/public/fonts/Elianto-Regular.ttf b/public/fonts/Elianto-Regular.ttf deleted file mode 100644 index 2dbbc96..0000000 Binary files a/public/fonts/Elianto-Regular.ttf and /dev/null differ diff --git a/public/fonts/yukarimobil.ttf b/public/fonts/yukarimobil.ttf deleted file mode 100644 index e0d530f..0000000 Binary files a/public/fonts/yukarimobil.ttf and /dev/null differ diff --git a/public/gun.png b/public/gun.png deleted file mode 100644 index 553be76..0000000 Binary files a/public/gun.png and /dev/null differ diff --git a/public/logo.png b/public/logo.png deleted file mode 100644 index 25933f0..0000000 Binary files a/public/logo.png and /dev/null differ diff --git a/styles/Home.module.css b/styles/Home.module.css deleted file mode 100644 index 15b9abd..0000000 --- a/styles/Home.module.css +++ /dev/null @@ -1,122 +0,0 @@ -.container { - min-height: 100vh; - padding: 0 0.5rem; - display: flex; - flex-direction: column; - justify-content: center; - align-items: center; -} - -.main { - padding: 5rem 0; - flex: 1; - display: flex; - flex-direction: column; - justify-content: center; - align-items: center; -} - -.footer { - width: 100%; - height: 100px; - border-top: 1px solid #eaeaea; - display: flex; - justify-content: center; - align-items: center; -} - -.footer img { - margin-left: 0.5rem; -} - -.footer a { - display: flex; - justify-content: center; - align-items: center; -} - -.title a { - color: #0070f3; - text-decoration: none; -} - -.title a:hover, -.title a:focus, -.title a:active { - text-decoration: underline; -} - -.title { - margin: 0; - line-height: 1.15; - font-size: 4rem; -} - -.title, -.description { - text-align: center; -} - -.description { - line-height: 1.5; - font-size: 1.5rem; -} - -.code { - background: #fafafa; - border-radius: 5px; - padding: 0.75rem; - font-size: 1.1rem; - font-family: Menlo, Monaco, Lucida Console, Liberation Mono, DejaVu Sans Mono, - Bitstream Vera Sans Mono, Courier New, monospace; -} - -.grid { - display: flex; - align-items: center; - justify-content: center; - flex-wrap: wrap; - max-width: 800px; - margin-top: 3rem; -} - -.card { - margin: 1rem; - flex-basis: 45%; - padding: 1.5rem; - text-align: left; - color: inherit; - text-decoration: none; - border: 1px solid #eaeaea; - border-radius: 10px; - transition: color 0.15s ease, border-color 0.15s ease; -} - -.card:hover, -.card:focus, -.card:active { - color: #0070f3; - border-color: #0070f3; -} - -.card h3 { - margin: 0 0 1rem 0; - font-size: 1.5rem; -} - -.card p { - margin: 0; - font-size: 1.25rem; - line-height: 1.5; -} - -.logo { - height: 1em; -} - -@media (max-width: 600px) { - .grid { - width: 100%; - flex-direction: column; - } -} diff --git a/styles/Index.module.css b/styles/Index.module.css deleted file mode 100644 index ab95c03..0000000 --- a/styles/Index.module.css +++ /dev/null @@ -1,189 +0,0 @@ -/* page specific overwrites css */ -.page h1 { - font-size: var(--font-xl); -} - -.page h3 { - font-size: var(--font-lg); - font-weight: normal; -} - - -/* page layout */ -.page { - display: flex; -} - -.page .content { - flex-grow: 1; -} - -.content { - position: relative; - width: 100%; -} - -.topcontainerbackg { - height: 40vh; - z-index: 0; - background-color: #2940D3; - - -ms-transform: skewX(-20deg); - -webkit-transform: skewX(-20deg); - transform: skewX(-20deg); -} - -.topcontainer { - padding: 0 var(--padding-xl); - top: 0; - right: 0; - left: 0; - bottom: 0; - position: absolute; - height: 40vh; - display: flex; - flex-direction: column; - align-items: start; - justify-content: space-between; - color: white; - background-image: url('/gun.png'); - background-size: contain; - background-repeat: no-repeat; - background-position: right center; -} - -.topcontainer h1 { - margin: unset; -} - -.topcontainer p { - opacity: 50%; - margin-top: - var(--padding-sm); -} - -.bottomcontainer { - padding: 0 var(--padding-xl); - height: 60vh; - background-color: #232323; - display: flex; - flex-direction: column; - justify-content: space-between; - align-items: start; - color: white; - padding-bottom: var(--padding); -} - -.leftsidetint { - z-index: 1; - width: 10vw; - background-color: #1a1a1a; - display: flex; - flex-direction: column; - justify-content: space-between; -} - -.leftsidetint footer { - font-size: var(--font-sm); - padding: var(--padding-lg); -} - - -/* items */ - -.links { - width: 100%; - display: flex; - flex-grow: 1; - align-items: center; -} - -.links div { - width: 100%; - font-size: 1.5em; - display: grid; - grid-template-columns: 25% 25% 25%; - gap: var(--padding-lg); -} - -.links div a { - text-align: center; - padding: var(--padding) var(--padding-xl); - transition-duration: var(--transition-speed); - background-color: #2940D3; - - -ms-transform: skewX(-20deg); - -webkit-transform: skewX(-20deg); - transform: skewX(-20deg); -} - -.links div a:hover { - -ms-transform: skewX(0deg); - -webkit-transform: skewX(0deg); - transform: skewX(0deg); - transition-duration: var(--transition-speed); -} - -.links div a:hover span { - -ms-transform: skewX(0deg); - -webkit-transform: skewX(0deg); - transform: skewX(0deg); - transition-duration: var(--transition-speed); -} - -.links div p { - margin: unset; -} - -.links div a span { - transition-duration: var(--transition-speed); - -ms-transform: skewX(20deg); - -webkit-transform: skewX(20deg); - transform: skewX(20deg); - - display: inline-flex; - align-items: center; - justify-content: space-between; - width: 100%; -} - - -.links div a:hover { - transition-duration: 0.3s; - background-color: #1f309e; -} - - -/* mobile responsivity */ - -@media (max-aspect-ratio: 1/1) { - .topcontent { - width: 100%; - padding: var(--padding); - } - - .links a { - padding: 0 var(--padding-lg); - } - - .page h1 { - font-size: var(--font-lg); - } - - .page h3 { - font-size: var(--font-lg); - font-weight: normal; - } - - .links div { - font-size: var(--font); - display: flex; - flex-wrap: wrap; - justify-content: center; - } -} - -@media (max-aspect-ratio: 5/4) { - .leftsidetint { - display: none; - } -} \ No newline at end of file diff --git a/styles/globals.css b/styles/globals.css deleted file mode 100644 index 4958a15..0000000 --- a/styles/globals.css +++ /dev/null @@ -1,166 +0,0 @@ -:root { - --padding-sm: 5px; - --padding: 10px; - --padding-lg: 20px; - --padding-xl: 50px; - --padding-xxl: 100px; - - --font-xl: 5em; - --font-lg: 1.5em; - --font: 1em; - --font-sm: 0.8em; - - --page-width: 1200px; - - --transition-speed: 0.3s; -} - -@font-face { - font-family: 'Dual'; - src: url('/fonts/Dual-300.otf'); - src: url('/fonts/Dual-300.ttf') format('truetype'); -} - -@font-face { - font-family: 'Anurati'; - src: url('/fonts/Anurati-Regular.otf'); -} - -html, -body { - padding: 0; - margin: 0; - font-family: 'Dual', sans-serif; - background-color: #232323; - overflow: hidden; - color: white; -} - -h1, h2 { - font-family: 'Anurati', sans-serif; - letter-spacing: 0.5em; -} - -footer { - opacity: 50%; -} - -footer a:hover { - text-decoration: underline; -} - -a { - color: inherit; - text-decoration: none; -} - -* { - box-sizing: border-box; -} - -img { - max-width: 100%; -} - - -/* help classes */ -.text-center { - text-align: center; -} - -.badge { - display: inline-block; - background-color: rgba(35,35,35,0.5); - padding: var(--padding-sm) var(--padding); - margin: 0 var(--padding-sm); - - -ms-transform: skewX(-20deg); - -webkit-transform: skewX(-20deg); - transform: skewX(-20deg); -} - -.badge span { - -ms-transform: skewX(20deg); - -webkit-transform: skewX(20deg); - transform: skewX(20deg); - display: inline-block; -} - - -/* animations */ -.slide-in-right { - animation-name: slide-in-right; - animation-duration: 1s; - margin-right: var(--padding-xxl); - margin-left: -50vw; - animation-timing-function: ease-in-out; -} - -@keyframes slide-in-right { - 0% { - margin-right: 150vw; - } - 25% { - margin-right: 150vw; - } - 100% { - margin-right: var(--padding-xxl); - } - -} - -.slide-in-left { - animation-name: slide-in-left; - animation-duration: 1.2s; - margin-left: 0vw; - animation-timing-function: ease-in-out; -} - -@keyframes slide-in-left { - 0% { - margin-left: 100vw; - } - 25% { - margin-left: 100vw; - } - 100% { - margin-left: 0vw; - } - -} - -.slide-in-up { - animation-name: slide-in-up; - animation-duration: 1.4s; - margin-top: 0vh; - animation-timing-function: ease-in-out; -} - -@keyframes slide-in-up { - 0% { - margin-top: 100vh; - } - 25% { - margin-top: 100vh; - } - 100% { - margin-top: 0vh; - } -} - -.slide-in-down { - animation-name: slide-in-down; - animation-duration: 0.4s; - overflow-y: hidden; - margin-top: 0vh; - animation-timing-function: ease-in-out; -} - -@keyframes slide-in-down { - 0% { - margin-top: 100vh; - } - 100% { - margin-top: 0vh; - } -} \ No newline at end of file diff --git a/vendor/bootstrap/css/bootstrap.min.css b/vendor/bootstrap/css/bootstrap.min.css new file mode 100644 index 0000000..cd2774e --- /dev/null +++ b/vendor/bootstrap/css/bootstrap.min.css @@ -0,0 +1,7 @@ +@charset "UTF-8";/*! + * Bootstrap v5.2.0 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors + * Copyright 2011-2022 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-body-color-rgb:33,37,41;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-link-color:#0d6efd;--bs-link-hover-color:#0a58ca;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:#6c757d;text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:#6c757d}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);--bs-table-bg:transparent;--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-body-color);--bs-table-striped-bg:rgba(0, 0, 0, 0.05);--bs-table-active-color:var(--bs-body-color);--bs-table-active-bg:rgba(0, 0, 0, 0.1);--bs-table-hover-color:var(--bs-body-color);--bs-table-hover-bg:rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg:var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg:var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#bacbe6;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#cbccce;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#bcd0c7;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#badce3;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#e6dbb9;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#dfc2c4;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#dfe0e1;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#373b3e;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:#6c757d}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;-webkit-appearance:none;-moz-appearance:none;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:#dde0e3}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + .5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:calc(1.5em + .75rem + 2px);padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:.375rem}.form-control-color::-webkit-color-swatch{border-radius:.375rem}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + 2px)}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + 2px)}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);-webkit-appearance:none;-moz-appearance:none;appearance:none;-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;width:100%;height:100%;padding:1rem .75rem;overflow:hidden;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:1px solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:3}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:3}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select,.input-group>:not(:first-child):not(.dropdown-menu):not(.form-floating):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#198754;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:#198754}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:#198754}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:#198754}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group .form-control.is-valid,.input-group .form-select.is-valid,.was-validated .input-group .form-control:valid,.was-validated .input-group .form-select:valid{z-index:1}.input-group .form-control.is-valid:focus,.input-group .form-select.is-valid:focus,.was-validated .input-group .form-control:valid:focus,.was-validated .input-group .form-select:valid:focus{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:#dc3545}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:#dc3545}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:#dc3545}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group .form-control.is-invalid,.input-group .form-select.is-invalid,.was-validated .input-group .form-control:invalid,.was-validated .input-group .form-select:invalid{z-index:2}.input-group .form-control.is-invalid:focus,.input-group .form-select.is-invalid:focus,.was-validated .input-group .form-control:invalid:focus,.was-validated .input-group .form-select:invalid:focus{z-index:3}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#212529;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:0.375rem;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check:focus+.btn,.btn:focus{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:active+.btn,.btn-check:checked+.btn,.btn.active,.btn.show,.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:active+.btn:focus,.btn-check:checked+.btn:focus,.btn.active:focus,.btn.show:focus,.btn:active:focus{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:none;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:#212529;--bs-dropdown-bg:#fff;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:0.375rem;--bs-dropdown-border-width:1px;--bs-dropdown-inner-border-radius:calc(0.375rem - 1px);--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color:#212529;--bs-dropdown-link-hover-color:#1e2125;--bs-dropdown-link-hover-bg:#e9ecef;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:1000;display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>.btn-group:not(:first-child),.btn-group>.btn:not(:first-child){margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:1px;--bs-nav-tabs-border-color:#dee2e6;--bs-nav-tabs-border-radius:0.375rem;--bs-nav-tabs-link-hover-border-color:#e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color:#495057;--bs-nav-tabs-link-active-bg:#fff;--bs-nav-tabs-link-active-border-color:#dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(var(--bs-nav-tabs-border-width) * -1);background:0 0;border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(var(--bs-nav-tabs-border-width) * -1);border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:0.375rem;--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(0, 0, 0, 0.55);--bs-navbar-hover-color:rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color:rgba(0, 0, 0, 0.3);--bs-navbar-active-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color:rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius:0.375rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:#000;--bs-accordion-bg:#fff;--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:1px;--bs-accordion-border-radius:0.375rem;--bs-accordion-inner-border-radius:calc(0.375rem - 1px);--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='var%28--bs-body-color%29'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:#0c63e4;--bs-accordion-active-bg:#e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(var(--bs-accordion-border-width) * -1) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:#6c757d;--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:#6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:#fff;--bs-pagination-border-width:1px;--bs-pagination-border-color:#dee2e6;--bs-pagination-border-radius:0.375rem;--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:#e9ecef;--bs-pagination-hover-border-color:#dee2e6;--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:#e9ecef;--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:#6c757d;--bs-pagination-disabled-bg:#fff;--bs-pagination-disabled-border-color:#dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:1px solid var(--bs-alert-border-color);--bs-alert-border-radius:0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:#084298;--bs-alert-bg:#cfe2ff;--bs-alert-border-color:#b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color:#41464b;--bs-alert-bg:#e2e3e5;--bs-alert-border-color:#d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color:#0f5132;--bs-alert-bg:#d1e7dd;--bs-alert-border-color:#badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color:#055160;--bs-alert-bg:#cff4fc;--bs-alert-border-color:#b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color:#664d03;--bs-alert-bg:#fff3cd;--bs-alert-border-color:#ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color:#842029;--bs-alert-bg:#f8d7da;--bs-alert-border-color:#f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color:#636464;--bs-alert-bg:#fefefe;--bs-alert-border-color:#fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color:#141619;--bs-alert-bg:#d3d3d4;--bs-alert-border-color:#bcbebf}.alert-dark .alert-link{color:#101214}@-webkit-keyframes progress-bar-stripes{0%{background-position-x:1rem}}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:#e9ecef;--bs-progress-border-radius:0.375rem;--bs-progress-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{-webkit-animation:1s linear infinite progress-bar-stripes;animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.list-group{--bs-list-group-color:#212529;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(0, 0, 0, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#212529;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#6c757d;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(var(--bs-list-group-border-width) * -1);border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child{border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child{border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(var(--bs-list-group-border-width) * -1);border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(255, 255, 255, 0.85);--bs-toast-border-width:1px;--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:0.375rem;--bs-toast-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color:#6c757d;--bs-toast-header-bg:rgba(255, 255, 255, 0.85);--bs-toast-header-border-color:rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{position:absolute;z-index:1090;width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(var(--bs-toast-padding-x) * -.5);margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:#fff;--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:1px;--bs-modal-border-radius:0.5rem;--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius:calc(0.5rem - 1px);--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:1px;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(var(--bs-modal-header-padding-y) * -.5) calc(var(--bs-modal-header-padding-x) * -.5) calc(var(--bs-modal-header-padding-y) * -.5) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:#fff;--bs-tooltip-bg:#000;--bs-tooltip-border-radius:0.375rem;--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:0}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:0}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:#fff;--bs-popover-border-width:1px;--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:0.5rem;--bs-popover-inner-border-radius:calc(0.5rem - 1px);--bs-popover-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:var(--bs-heading-color);--bs-popover-header-bg:#f0f0f0;--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:#212529;--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(var(--bs-popover-arrow-width) * -.5);content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(var(--bs-popover-arrow-height) * -1 - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;-webkit-animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@-webkit-keyframes spinner-border{to{transform:rotate(360deg)}}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@-webkit-keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg:#fff;--bs-offcanvas-border-width:1px;--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:1045;display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(var(--bs-offcanvas-padding-y) * -.5);margin-right:calc(var(--bs-offcanvas-padding-x) * -.5);margin-bottom:calc(var(--bs-offcanvas-padding-y) * -.5)}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{-webkit-animation:placeholder-glow 2s ease-in-out infinite;animation:placeholder-glow 2s ease-in-out infinite}@-webkit-keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;-webkit-animation:placeholder-wave 2s linear infinite;animation:placeholder-wave 2s linear infinite}@-webkit-keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(13,110,253,var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(108,117,125,var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(25,135,84,var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(13,202,240,var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(255,193,7,var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(220,53,69,var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(248,249,250,var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(33,37,41,var(--bs-bg-opacity,1))!important}.link-primary{color:#0d6efd!important}.link-primary:focus,.link-primary:hover{color:#0a58ca!important}.link-secondary{color:#6c757d!important}.link-secondary:focus,.link-secondary:hover{color:#565e64!important}.link-success{color:#198754!important}.link-success:focus,.link-success:hover{color:#146c43!important}.link-info{color:#0dcaf0!important}.link-info:focus,.link-info:hover{color:#3dd5f3!important}.link-warning{color:#ffc107!important}.link-warning:focus,.link-warning:hover{color:#ffcd39!important}.link-danger{color:#dc3545!important}.link-danger:focus,.link-danger:hover{color:#b02a37!important}.link-light{color:#f8f9fa!important}.link-light:focus,.link-light:hover{color:#f9fafb!important}.link-dark{color:#212529!important}.link-dark:focus,.link-dark:hover{color:#1a1e21!important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute!important;width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-1{--bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-normal{font-weight:400!important}.fw-bold{font-weight:700!important}.fw-semibold{font-weight:600!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:#6c757d!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} +/*# sourceMappingURL=bootstrap.min.css.map */ \ No newline at end of file diff --git a/vendor/bootstrap/js/bootstrap.min.js b/vendor/bootstrap/js/bootstrap.min.js new file mode 100644 index 0000000..fa175a7 --- /dev/null +++ b/vendor/bootstrap/js/bootstrap.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v5.2.0 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e(require("@popperjs/core")):"function"==typeof define&&define.amd?define(["@popperjs/core"],e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e(t.Popper)}(this,(function(t){"use strict";function e(t){if(t&&t.__esModule)return t;const e=Object.create(null,{[Symbol.toStringTag]:{value:"Module"}});if(t)for(const i in t)if("default"!==i){const s=Object.getOwnPropertyDescriptor(t,i);Object.defineProperty(e,i,s.get?s:{enumerable:!0,get:()=>t[i]})}return e.default=t,Object.freeze(e)}const i=e(t),s="transitionend",n=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e},o=t=>{const e=n(t);return e&&document.querySelector(e)?e:null},r=t=>{const e=n(t);return e?document.querySelector(e):null},a=t=>{t.dispatchEvent(new Event(s))},l=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),c=t=>l(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(t):null,h=t=>{if(!l(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},d=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),u=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?u(t.parentNode):null},_=()=>{},g=t=>{t.offsetHeight},f=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,p=[],m=()=>"rtl"===document.documentElement.dir,b=t=>{var e;e=()=>{const e=f();if(e){const i=t.NAME,s=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=s,t.jQueryInterface)}},"loading"===document.readyState?(p.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of p)t()})),p.push(e)):e()},v=t=>{"function"==typeof t&&t()},y=(t,e,i=!0)=>{if(!i)return void v(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const s=Number.parseFloat(e),n=Number.parseFloat(i);return s||n?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let o=!1;const r=({target:i})=>{i===e&&(o=!0,e.removeEventListener(s,r),v(t))};e.addEventListener(s,r),setTimeout((()=>{o||a(e)}),n)},w=(t,e,i,s)=>{const n=t.length;let o=t.indexOf(e);return-1===o?!i&&s?t[n-1]:t[0]:(o+=i?1:-1,s&&(o=(o+n)%n),t[Math.max(0,Math.min(o,n-1))])},A=/[^.]*(?=\..*)\.|.*/,T=/\..*/,E=/::\d+$/,C={};let k=1;const L={mouseenter:"mouseover",mouseleave:"mouseout"},O=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function I(t,e){return e&&`${e}::${k++}`||t.uidEvent||k++}function S(t){const e=I(t);return t.uidEvent=e,C[e]=C[e]||{},C[e]}function D(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function N(t,e,i){const s="string"==typeof e,n=s?i:e||i;let o=j(t);return O.has(o)||(o=t),[s,n,o]}function P(t,e,i,s,n){if("string"!=typeof e||!t)return;let[o,r,a]=N(e,i,s);if(e in L){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=S(t),c=l[a]||(l[a]={}),h=D(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&n);const d=I(r,e.replace(A,"")),u=o?function(t,e,i){return function s(n){const o=t.querySelectorAll(e);for(let{target:r}=n;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return F(n,{delegateTarget:r}),s.oneOff&&$.off(t,n.type,e,i),i.apply(r,[n])}}(t,i,r):function(t,e){return function i(s){return F(s,{delegateTarget:t}),i.oneOff&&$.off(t,s.type,e),e.apply(t,[s])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=n,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function x(t,e,i,s,n){const o=D(e[i],s,n);o&&(t.removeEventListener(i,o,Boolean(n)),delete e[i][o.uidEvent])}function M(t,e,i,s){const n=e[i]||{};for(const o of Object.keys(n))if(o.includes(s)){const s=n[o];x(t,e,i,s.callable,s.delegationSelector)}}function j(t){return t=t.replace(T,""),L[t]||t}const $={on(t,e,i,s){P(t,e,i,s,!1)},one(t,e,i,s){P(t,e,i,s,!0)},off(t,e,i,s){if("string"!=typeof e||!t)return;const[n,o,r]=N(e,i,s),a=r!==e,l=S(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))M(t,l,i,e.slice(1));for(const i of Object.keys(c)){const s=i.replace(E,"");if(!a||e.includes(s)){const e=c[i];x(t,l,r,e.callable,e.delegationSelector)}}}else{if(!Object.keys(c).length)return;x(t,l,r,o,n?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const s=f();let n=null,o=!0,r=!0,a=!1;e!==j(e)&&s&&(n=s.Event(e,i),s(t).trigger(n),o=!n.isPropagationStopped(),r=!n.isImmediatePropagationStopped(),a=n.isDefaultPrevented());let l=new Event(e,{bubbles:o,cancelable:!0});return l=F(l,i),a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&n&&n.preventDefault(),l}};function F(t,e){for(const[i,s]of Object.entries(e||{}))try{t[i]=s}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>s})}return t}const z=new Map,H={set(t,e,i){z.has(t)||z.set(t,new Map);const s=z.get(t);s.has(e)||0===s.size?s.set(e,i):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(t,e)=>z.has(t)&&z.get(t).get(e)||null,remove(t,e){if(!z.has(t))return;const i=z.get(t);i.delete(e),0===i.size&&z.delete(t)}};function q(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function B(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const W={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${B(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${B(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const s of i){let i=s.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=q(t.dataset[s])}return e},getDataAttribute:(t,e)=>q(t.getAttribute(`data-bs-${B(e)}`))};class R{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=l(e)?W.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...l(e)?W.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const s of Object.keys(e)){const n=e[s],o=t[s],r=l(o)?"element":null==(i=o)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(n).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${s}" provided type "${r}" but expected type "${n}".`)}var i}}class V extends R{constructor(t,e){super(),(t=c(t))&&(this._element=t,this._config=this._getConfig(e),H.set(this._element,this.constructor.DATA_KEY,this))}dispose(){H.remove(this._element,this.constructor.DATA_KEY),$.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){y(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return H.get(c(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.2.0"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const K=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,s=t.NAME;$.on(document,i,`[data-bs-dismiss="${s}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),d(this))return;const n=r(this)||this.closest(`.${s}`);t.getOrCreateInstance(n)[e]()}))};class Q extends V{static get NAME(){return"alert"}close(){if($.trigger(this._element,"close.bs.alert").defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),$.trigger(this._element,"closed.bs.alert"),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}K(Q,"close"),b(Q);const X='[data-bs-toggle="button"]';class Y extends V{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}$.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),b(Y);const U={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let s=t.parentNode.closest(e);for(;s;)i.push(s),s=s.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!d(t)&&h(t)))}},G={endCallback:null,leftCallback:null,rightCallback:null},J={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class Z extends R{constructor(t,e){super(),this._element=t,t&&Z.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return G}static get DefaultType(){return J}static get NAME(){return"swipe"}dispose(){$.off(this._element,".bs.swipe")}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),v(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&v(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?($.on(this._element,"pointerdown.bs.swipe",(t=>this._start(t))),$.on(this._element,"pointerup.bs.swipe",(t=>this._end(t))),this._element.classList.add("pointer-event")):($.on(this._element,"touchstart.bs.swipe",(t=>this._start(t))),$.on(this._element,"touchmove.bs.swipe",(t=>this._move(t))),$.on(this._element,"touchend.bs.swipe",(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const tt="next",et="prev",it="left",st="right",nt="slid.bs.carousel",ot="carousel",rt="active",at={ArrowLeft:st,ArrowRight:it},lt={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},ct={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class ht extends V{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=U.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===ot&&this.cycle()}static get Default(){return lt}static get DefaultType(){return ct}static get NAME(){return"carousel"}next(){this._slide(tt)}nextWhenVisible(){!document.hidden&&h(this._element)&&this.next()}prev(){this._slide(et)}pause(){this._isSliding&&a(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?$.one(this._element,nt,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void $.one(this._element,nt,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const s=t>i?tt:et;this._slide(s,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&$.on(this._element,"keydown.bs.carousel",(t=>this._keydown(t))),"hover"===this._config.pause&&($.on(this._element,"mouseenter.bs.carousel",(()=>this.pause())),$.on(this._element,"mouseleave.bs.carousel",(()=>this._maybeEnableCycle()))),this._config.touch&&Z.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of U.find(".carousel-item img",this._element))$.on(t,"dragstart.bs.carousel",(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(it)),rightCallback:()=>this._slide(this._directionToOrder(st)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new Z(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=at[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=U.findOne(".active",this._indicatorsElement);e.classList.remove(rt),e.removeAttribute("aria-current");const i=U.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(rt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),s=t===tt,n=e||w(this._getItems(),i,s,this._config.wrap);if(n===i)return;const o=this._getItemIndex(n),r=e=>$.trigger(this._element,e,{relatedTarget:n,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r("slide.bs.carousel").defaultPrevented)return;if(!i||!n)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=n;const l=s?"carousel-item-start":"carousel-item-end",c=s?"carousel-item-next":"carousel-item-prev";n.classList.add(c),g(n),i.classList.add(l),n.classList.add(l),this._queueCallback((()=>{n.classList.remove(l,c),n.classList.add(rt),i.classList.remove(rt,c,l),this._isSliding=!1,r(nt)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return U.findOne(".active.carousel-item",this._element)}_getItems(){return U.find(".carousel-item",this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return m()?t===it?et:tt:t===it?tt:et}_orderToDirection(t){return m()?t===et?it:st:t===et?st:it}static jQueryInterface(t){return this.each((function(){const e=ht.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}$.on(document,"click.bs.carousel.data-api","[data-bs-slide], [data-bs-slide-to]",(function(t){const e=r(this);if(!e||!e.classList.contains(ot))return;t.preventDefault();const i=ht.getOrCreateInstance(e),s=this.getAttribute("data-bs-slide-to");return s?(i.to(s),void i._maybeEnableCycle()):"next"===W.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),$.on(window,"load.bs.carousel.data-api",(()=>{const t=U.find('[data-bs-ride="carousel"]');for(const e of t)ht.getOrCreateInstance(e)})),b(ht);const dt="show",ut="collapse",_t="collapsing",gt='[data-bs-toggle="collapse"]',ft={parent:null,toggle:!0},pt={parent:"(null|element)",toggle:"boolean"};class mt extends V{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=U.find(gt);for(const t of i){const e=o(t),i=U.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return ft}static get DefaultType(){return pt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>mt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if($.trigger(this._element,"show.bs.collapse").defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(ut),this._element.classList.add(_t),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_t),this._element.classList.add(ut,dt),this._element.style[e]="",$.trigger(this._element,"shown.bs.collapse")}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if($.trigger(this._element,"hide.bs.collapse").defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,g(this._element),this._element.classList.add(_t),this._element.classList.remove(ut,dt);for(const t of this._triggerArray){const e=r(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_t),this._element.classList.add(ut),$.trigger(this._element,"hidden.bs.collapse")}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(dt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=c(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(gt);for(const e of t){const t=r(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=U.find(":scope .collapse .collapse",this._config.parent);return U.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=mt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}$.on(document,"click.bs.collapse.data-api",gt,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();const e=o(this),i=U.find(e);for(const t of i)mt.getOrCreateInstance(t,{toggle:!1}).toggle()})),b(mt);const bt="dropdown",vt="ArrowUp",yt="ArrowDown",wt="click.bs.dropdown.data-api",At="keydown.bs.dropdown.data-api",Tt="show",Et='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',Ct=`${Et}.show`,kt=".dropdown-menu",Lt=m()?"top-end":"top-start",Ot=m()?"top-start":"top-end",It=m()?"bottom-end":"bottom-start",St=m()?"bottom-start":"bottom-end",Dt=m()?"left-start":"right-start",Nt=m()?"right-start":"left-start",Pt={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},xt={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Mt extends V{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=U.findOne(kt,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return Pt}static get DefaultType(){return xt}static get NAME(){return bt}toggle(){return this._isShown()?this.hide():this.show()}show(){if(d(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!$.trigger(this._element,"show.bs.dropdown",t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))$.on(t,"mouseover",_);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Tt),this._element.classList.add(Tt),$.trigger(this._element,"shown.bs.dropdown",t)}}hide(){if(d(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!$.trigger(this._element,"hide.bs.dropdown",t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))$.off(t,"mouseover",_);this._popper&&this._popper.destroy(),this._menu.classList.remove(Tt),this._element.classList.remove(Tt),this._element.setAttribute("aria-expanded","false"),W.removeDataAttribute(this._menu,"popper"),$.trigger(this._element,"hidden.bs.dropdown",t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!l(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${bt.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===i)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:l(this._config.reference)?t=c(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const e=this._getPopperConfig();this._popper=i.createPopper(t,this._menu,e)}_isShown(){return this._menu.classList.contains(Tt)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Dt;if(t.classList.contains("dropstart"))return Nt;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Ot:Lt:e?St:It}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(W.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,..."function"==typeof this._config.popperConfig?this._config.popperConfig(t):this._config.popperConfig}}_selectMenuItem({key:t,target:e}){const i=U.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>h(t)));i.length&&w(i,e,t===yt,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Mt.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=U.find(Ct);for(const i of e){const e=Mt.getInstance(i);if(!e||!1===e._config.autoClose)continue;const s=t.composedPath(),n=s.includes(e._menu);if(s.includes(e._element)||"inside"===e._config.autoClose&&!n||"outside"===e._config.autoClose&&n)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,s=[vt,yt].includes(t.key);if(!s&&!i)return;if(e&&!i)return;t.preventDefault();const n=U.findOne(Et,t.delegateTarget.parentNode),o=Mt.getOrCreateInstance(n);if(s)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),n.focus())}}$.on(document,At,Et,Mt.dataApiKeydownHandler),$.on(document,At,kt,Mt.dataApiKeydownHandler),$.on(document,wt,Mt.clearMenus),$.on(document,"keyup.bs.dropdown.data-api",Mt.clearMenus),$.on(document,wt,Et,(function(t){t.preventDefault(),Mt.getOrCreateInstance(this).toggle()})),b(Mt);const jt=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",$t=".sticky-top",Ft="padding-right",zt="margin-right";class Ht{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,Ft,(e=>e+t)),this._setElementAttributes(jt,Ft,(e=>e+t)),this._setElementAttributes($t,zt,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,Ft),this._resetElementAttributes(jt,Ft),this._resetElementAttributes($t,zt)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const s=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+s)return;this._saveInitialAttribute(t,e);const n=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(n))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&W.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=W.getDataAttribute(t,e);null!==i?(W.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(l(t))e(t);else for(const i of U.find(t,this._element))e(i)}}const qt="show",Bt="mousedown.bs.backdrop",Wt={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Rt={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Vt extends R{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Wt}static get DefaultType(){return Rt}static get NAME(){return"backdrop"}show(t){if(!this._config.isVisible)return void v(t);this._append();const e=this._getElement();this._config.isAnimated&&g(e),e.classList.add(qt),this._emulateAnimation((()=>{v(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(qt),this._emulateAnimation((()=>{this.dispose(),v(t)}))):v(t)}dispose(){this._isAppended&&($.off(this._element,Bt),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=c(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),$.on(t,Bt,(()=>{v(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){y(t,this._getElement(),this._config.isAnimated)}}const Kt=".bs.focustrap",Qt="backward",Xt={autofocus:!0,trapElement:null},Yt={autofocus:"boolean",trapElement:"element"};class Ut extends R{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return Xt}static get DefaultType(){return Yt}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),$.off(document,Kt),$.on(document,"focusin.bs.focustrap",(t=>this._handleFocusin(t))),$.on(document,"keydown.tab.bs.focustrap",(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,$.off(document,Kt))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=U.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===Qt?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?Qt:"forward")}}const Gt="hidden.bs.modal",Jt="show.bs.modal",Zt="modal-open",te="show",ee="modal-static",ie={backdrop:!0,focus:!0,keyboard:!0},se={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class ne extends V{constructor(t,e){super(t,e),this._dialog=U.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new Ht,this._addEventListeners()}static get Default(){return ie}static get DefaultType(){return se}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||$.trigger(this._element,Jt,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(Zt),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&($.trigger(this._element,"hide.bs.modal").defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(te),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){for(const t of[window,this._dialog])$.off(t,".bs.modal");this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Vt({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new Ut({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=U.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),g(this._element),this._element.classList.add(te),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,$.trigger(this._element,"shown.bs.modal",{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){$.on(this._element,"keydown.dismiss.bs.modal",(t=>{if("Escape"===t.key)return this._config.keyboard?(t.preventDefault(),void this.hide()):void this._triggerBackdropTransition()})),$.on(window,"resize.bs.modal",(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),$.on(this._element,"mousedown.dismiss.bs.modal",(t=>{t.target===t.currentTarget&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(Zt),this._resetAdjustments(),this._scrollBar.reset(),$.trigger(this._element,Gt)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if($.trigger(this._element,"hidePrevented.bs.modal").defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(ee)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(ee),this._queueCallback((()=>{this._element.classList.remove(ee),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=m()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=m()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=ne.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}$.on(document,"click.bs.modal.data-api",'[data-bs-toggle="modal"]',(function(t){const e=r(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),$.one(e,Jt,(t=>{t.defaultPrevented||$.one(e,Gt,(()=>{h(this)&&this.focus()}))}));const i=U.findOne(".modal.show");i&&ne.getInstance(i).hide(),ne.getOrCreateInstance(e).toggle(this)})),K(ne),b(ne);const oe="show",re="showing",ae="hiding",le=".offcanvas.show",ce="hidePrevented.bs.offcanvas",he="hidden.bs.offcanvas",de={backdrop:!0,keyboard:!0,scroll:!1},ue={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class _e extends V{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return de}static get DefaultType(){return ue}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||$.trigger(this._element,"show.bs.offcanvas",{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new Ht).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(re),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(oe),this._element.classList.remove(re),$.trigger(this._element,"shown.bs.offcanvas",{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&($.trigger(this._element,"hide.bs.offcanvas").defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(ae),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(oe,ae),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new Ht).reset(),$.trigger(this._element,he)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Vt({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():$.trigger(this._element,ce)}:null})}_initializeFocusTrap(){return new Ut({trapElement:this._element})}_addEventListeners(){$.on(this._element,"keydown.dismiss.bs.offcanvas",(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():$.trigger(this._element,ce))}))}static jQueryInterface(t){return this.each((function(){const e=_e.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}$.on(document,"click.bs.offcanvas.data-api",'[data-bs-toggle="offcanvas"]',(function(t){const e=r(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),d(this))return;$.one(e,he,(()=>{h(this)&&this.focus()}));const i=U.findOne(le);i&&i!==e&&_e.getInstance(i).hide(),_e.getOrCreateInstance(e).toggle(this)})),$.on(window,"load.bs.offcanvas.data-api",(()=>{for(const t of U.find(le))_e.getOrCreateInstance(t).show()})),$.on(window,"resize.bs.offcanvas",(()=>{for(const t of U.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&_e.getOrCreateInstance(t).hide()})),K(_e),b(_e);const ge=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),fe=/^(?:(?:https?|mailto|ftp|tel|file|sms):|[^#&/:?]*(?:[#/?]|$))/i,pe=/^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[\d+/a-z]+=*$/i,me=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!ge.has(i)||Boolean(fe.test(t.nodeValue)||pe.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},be={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},ve={allowList:be,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},ye={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},we={entry:"(string|element|function|null)",selector:"(string|element)"};class Ae extends R{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return ve}static get DefaultType(){return ye}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},we)}_setContent(t,e,i){const s=U.findOne(i,t);s&&((e=this._resolvePossibleFunction(e))?l(e)?this._putElementInTemplate(c(e),s):this._config.html?s.innerHTML=this._maybeSanitize(e):s.textContent=e:s.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const s=(new window.DOMParser).parseFromString(t,"text/html"),n=[].concat(...s.body.querySelectorAll("*"));for(const t of n){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const s=[].concat(...t.attributes),n=[].concat(e["*"]||[],e[i]||[]);for(const e of s)me(e,n)||t.removeAttribute(e.nodeName)}return s.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return"function"==typeof t?t(this):t}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Te=new Set(["sanitize","allowList","sanitizeFn"]),Ee="fade",Ce="show",ke=".modal",Le="hide.bs.modal",Oe="hover",Ie="focus",Se={AUTO:"auto",TOP:"top",RIGHT:m()?"left":"right",BOTTOM:"bottom",LEFT:m()?"right":"left"},De={allowList:be,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,0],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},Ne={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class Pe extends V{constructor(t,e){if(void 0===i)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=!1,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners()}static get Default(){return De}static get DefaultType(){return Ne}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(t){if(this._isEnabled){if(t){const e=this._initializeOnDelegatedTarget(t);return e._activeTrigger.click=!e._activeTrigger.click,void(e._isWithActiveTrigger()?e._enter():e._leave())}this._isShown()?this._leave():this._enter()}}dispose(){clearTimeout(this._timeout),$.off(this._element.closest(ke),Le,this._hideModalHandler),this.tip&&this.tip.remove(),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=$.trigger(this._element,this.constructor.eventName("show")),e=(u(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this.tip&&(this.tip.remove(),this.tip=null);const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:s}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(s.append(i),$.trigger(this._element,this.constructor.eventName("inserted"))),this._popper?this._popper.update():this._popper=this._createPopper(i),i.classList.add(Ce),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))$.on(t,"mouseover",_);this._queueCallback((()=>{const t=this._isHovered;this._isHovered=!1,$.trigger(this._element,this.constructor.eventName("shown")),t&&this._leave()}),this.tip,this._isAnimated())}hide(){if(!this._isShown())return;if($.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented)return;const t=this._getTipElement();if(t.classList.remove(Ce),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))$.off(t,"mouseover",_);this._activeTrigger.click=!1,this._activeTrigger.focus=!1,this._activeTrigger.hover=!1,this._isHovered=!1,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||t.remove(),this._element.removeAttribute("aria-describedby"),$.trigger(this._element,this.constructor.eventName("hidden")),this._disposePopper())}),this.tip,this._isAnimated())}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(Ee,Ce),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(Ee),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Ae({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._config.originalTitle}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(Ee)}_isShown(){return this.tip&&this.tip.classList.contains(Ce)}_createPopper(t){const e="function"==typeof this._config.placement?this._config.placement.call(this,t,this._element):this._config.placement,s=Se[e.toUpperCase()];return i.createPopper(this._element,t,this._getPopperConfig(s))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return"function"==typeof t?t.call(this._element):t}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,..."function"==typeof this._config.popperConfig?this._config.popperConfig(e):this._config.popperConfig}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)$.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>this.toggle(t)));else if("manual"!==e){const t=e===Oe?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===Oe?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");$.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?Ie:Oe]=!0,e._enter()})),$.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?Ie:Oe]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},$.on(this._element.closest(ke),Le,this._hideModalHandler),this._config.selector?this._config={...this._config,trigger:"manual",selector:""}:this._fixTitle()}_fixTitle(){const t=this._config.originalTitle;t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=W.getDataAttributes(this._element);for(const t of Object.keys(e))Te.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:c(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),t.originalTitle=this._element.getAttribute("title")||"","number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const e in this._config)this.constructor.Default[e]!==this._config[e]&&(t[e]=this._config[e]);return t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null)}static jQueryInterface(t){return this.each((function(){const e=Pe.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}b(Pe);const xe={...Pe.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},Me={...Pe.DefaultType,content:"(null|string|element|function)"};class je extends Pe{static get Default(){return xe}static get DefaultType(){return Me}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=je.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}b(je);const $e="click.bs.scrollspy",Fe="active",ze="[href]",He={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null},qe={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element"};class Be extends V{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return He}static get DefaultType(){return qe}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=c(t.target)||document.body,t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&($.off(this._config.target,$e),$.on(this._config.target,$e,ze,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,s=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:s,behavior:"smooth"});i.scrollTop=s}})))}_getNewObserver(){const t={root:this._rootElement,threshold:[.1,.5,1],rootMargin:this._getRootMargin()};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},s=(this._rootElement||document.documentElement).scrollTop,n=s>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=s;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(n&&t){if(i(o),!s)return}else n||t||i(o)}}_getRootMargin(){return this._config.offset?`${this._config.offset}px 0px -30%`:this._config.rootMargin}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=U.find(ze,this._config.target);for(const e of t){if(!e.hash||d(e))continue;const t=U.findOne(e.hash,this._element);h(t)&&(this._targetLinks.set(e.hash,e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(Fe),this._activateParents(t),$.trigger(this._element,"activate.bs.scrollspy",{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))U.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(Fe);else for(const e of U.parents(t,".nav, .list-group"))for(const t of U.prev(e,".nav-link, .nav-item > .nav-link, .list-group-item"))t.classList.add(Fe)}_clearActiveClass(t){t.classList.remove(Fe);const e=U.find("[href].active",t);for(const t of e)t.classList.remove(Fe)}static jQueryInterface(t){return this.each((function(){const e=Be.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}$.on(window,"load.bs.scrollspy.data-api",(()=>{for(const t of U.find('[data-bs-spy="scroll"]'))Be.getOrCreateInstance(t)})),b(Be);const We="ArrowLeft",Re="ArrowRight",Ve="ArrowUp",Ke="ArrowDown",Qe="active",Xe="fade",Ye="show",Ue='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Ge=`.nav-link:not(.dropdown-toggle), .list-group-item:not(.dropdown-toggle), [role="tab"]:not(.dropdown-toggle), ${Ue}`;class Je extends V{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),$.on(this._element,"keydown.bs.tab",(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?$.trigger(e,"hide.bs.tab",{relatedTarget:t}):null;$.trigger(t,"show.bs.tab",{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Qe),this._activate(r(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.focus(),t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),$.trigger(t,"shown.bs.tab",{relatedTarget:e})):t.classList.add(Ye)}),t,t.classList.contains(Xe)))}_deactivate(t,e){t&&(t.classList.remove(Qe),t.blur(),this._deactivate(r(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),$.trigger(t,"hidden.bs.tab",{relatedTarget:e})):t.classList.remove(Ye)}),t,t.classList.contains(Xe)))}_keydown(t){if(![We,Re,Ve,Ke].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=[Re,Ke].includes(t.key),i=w(this._getChildren().filter((t=>!d(t))),t.target,e,!0);i&&Je.getOrCreateInstance(i).show()}_getChildren(){return U.find(Ge,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=r(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`#${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const s=(t,s)=>{const n=U.findOne(t,i);n&&n.classList.toggle(s,e)};s(".dropdown-toggle",Qe),s(".dropdown-menu",Ye),s(".dropdown-item",Qe),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Qe)}_getInnerElement(t){return t.matches(Ge)?t:U.findOne(Ge,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Je.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}$.on(document,"click.bs.tab",Ue,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),d(this)||Je.getOrCreateInstance(this).show()})),$.on(window,"load.bs.tab",(()=>{for(const t of U.find('.active[data-bs-toggle="tab"], .active[data-bs-toggle="pill"], .active[data-bs-toggle="list"]'))Je.getOrCreateInstance(t)})),b(Je);const Ze="hide",ti="show",ei="showing",ii={animation:"boolean",autohide:"boolean",delay:"number"},si={animation:!0,autohide:!0,delay:5e3};class ni extends V{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return si}static get DefaultType(){return ii}static get NAME(){return"toast"}show(){$.trigger(this._element,"show.bs.toast").defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(Ze),g(this._element),this._element.classList.add(ti,ei),this._queueCallback((()=>{this._element.classList.remove(ei),$.trigger(this._element,"shown.bs.toast"),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&($.trigger(this._element,"hide.bs.toast").defaultPrevented||(this._element.classList.add(ei),this._queueCallback((()=>{this._element.classList.add(Ze),this._element.classList.remove(ei,ti),$.trigger(this._element,"hidden.bs.toast")}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(ti),super.dispose()}isShown(){return this._element.classList.contains(ti)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){$.on(this._element,"mouseover.bs.toast",(t=>this._onInteraction(t,!0))),$.on(this._element,"mouseout.bs.toast",(t=>this._onInteraction(t,!1))),$.on(this._element,"focusin.bs.toast",(t=>this._onInteraction(t,!0))),$.on(this._element,"focusout.bs.toast",(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ni.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return K(ni),b(ni),{Alert:Q,Button:Y,Carousel:ht,Collapse:mt,Dropdown:Mt,Modal:ne,Offcanvas:_e,Popover:je,ScrollSpy:Be,Tab:Je,Toast:ni,Tooltip:Pe}})); +//# sourceMappingURL=bootstrap.min.js.map \ No newline at end of file diff --git a/vendor/jquery/jquery.js b/vendor/jquery/jquery.js new file mode 100644 index 0000000..fd90fe8 --- /dev/null +++ b/vendor/jquery/jquery.js @@ -0,0 +1,10364 @@ +/*! + * jQuery JavaScript Library v3.3.1 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2018-01-20T17:24Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var document = window.document; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var concat = arr.concat; + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + return typeof obj === "function" && typeof obj.nodeType !== "number"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + + + + var preservedScriptAttributes = { + type: true, + src: true, + noModule: true + }; + + function DOMEval( code, doc, node ) { + doc = doc || document; + + var i, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + if ( node[ i ] ) { + script[ i ] = node[ i ]; + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.3.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + + if ( copyIsArray ) { + copyIsArray = false; + clone = src && Array.isArray( src ) ? src : []; + + } else { + clone = src && jQuery.isPlainObject( src ) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + + /* eslint-disable no-unused-vars */ + // See https://github.com/eslint/eslint/issues/6125 + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a global context + globalEval: function( code ) { + DOMEval( code ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // Support: Android <=4.0 only + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.3 + * https://sizzlejs.com/ + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: 2016-08-08 + */ +(function( window ) { + +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ({}).hasOwnProperty, + arr = [], + pop = arr.pop, + push_native = arr.push, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[i] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ), + + rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ), + funescape = function( _, escaped, escapedWhitespace ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + // Support: Firefox<24 + // Workaround erroneous numeric interpretation of +"0x" + return high !== high || escapedWhitespace ? + escaped : + high < 0 ? + // BMP codepoint + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + disabledAncestor = addCombinator( + function( elem ) { + return elem.disabled === true && ("form" in elem || "label" in elem); + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + (arr = slice.call( preferredDoc.childNodes )), + preferredDoc.childNodes + ); + // Support: Android<4.0 + // Detect silently failing push.apply + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + push_native.apply( target, slice.call(els) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + // Can't trust NodeList.length + while ( (target[j++] = els[i++]) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) { + + // ID selector + if ( (m = match[1]) ) { + + // Document context + if ( nodeType === 9 ) { + if ( (elem = context.getElementById( m )) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && (elem = newContext.getElementById( m )) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[2] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( (m = match[3]) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !compilerCache[ selector + " " ] && + (!rbuggyQSA || !rbuggyQSA.test( selector )) ) { + + if ( nodeType !== 1 ) { + newContext = context; + newSelector = selector; + + // qSA looks outside Element context, which is not what we want + // Thanks to Andrew Dupont for this workaround technique + // Support: IE <=8 + // Exclude object elements + } else if ( context.nodeName.toLowerCase() !== "object" ) { + + // Capture the context ID, setting it first if necessary + if ( (nid = context.getAttribute( "id" )) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", (nid = expando) ); + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[i] = "#" + nid + " " + toSelector( groups[i] ); + } + newSelector = groups.join( "," ); + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + } + + if ( newSelector ) { + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key + " " ] = value); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement("fieldset"); + + try { + return !!fn( el ); + } catch (e) { + return false; + } finally { + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split("|"), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[i] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( (cur = cur.nextSibling) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + disabledAncestor( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9-11, Edge + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + if ( preferredDoc !== document && + (subWindow = document.defaultView) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert(function( el ) { + el.className = "i"; + return !el.getAttribute("className"); + }); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert(function( el ) { + el.appendChild( document.createComment("") ); + return !el.getElementsByTagName("*").length; + }); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert(function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + }); + + // ID filter and find + if ( support.getById ) { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( (elem = elems[i++]) ) { + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find["TAG"] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( (elem = results[i++]) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( (support.qsa = rnative.test( document.querySelectorAll )) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( el ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll("[msallowcapture^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push("~="); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push(".#.+[+~]"); + } + }); + + assert(function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement("input"); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll("[name=d]").length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll(":enabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll(":disabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = rnative.test( (matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( el ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) { + + // Choose the first element that is related to our preferred document + if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) { + return -1; + } + if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + return a === document ? -1 : + b === document ? 1 : + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + if ( support.matchesSelector && documentIsHTML && + !compilerCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch (e) {} + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return (sel + "").replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( (elem = results[i++]) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + while ( (node = elem[i++]) ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[6] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[3] ) { + match[2] = match[4] || match[5] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { return true; } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + // Use previously-cached element index if available + if ( useCache ) { + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + // Don't keep the element (issue #299) + input[0] = null; + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifier + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( (tokens = []) ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + matched = match.shift(); + tokens.push({ + value: matched, + // Cast descendant combinators to space + type: match[0].replace( rtrim, " " ) + }); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + matched = match.shift(); + tokens.push({ + value: matched, + type: type, + matches: match + }); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[i].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {}); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( (oldCache = uniqueCache[ key ]) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return (newCache[ 2 ] = oldCache[ 2 ]); + } else { + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" }) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find["TAG"]( "*", outermost ), + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), + len = elems.length; + + if ( outermost ) { + outermostContext = context === document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + if ( !context && elem.ownerDocument !== document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( (matcher = elementMatchers[j++]) ) { + if ( matcher( elem, context || document, xml) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( (matcher = setMatchers[j++]) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( (selector = compiled.selector || selector) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) { + + context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split("").sort( sortOrder ).join("") === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert(function( el ) { + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement("fieldset") ) & 1; +}); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert(function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute("href") === "#" ; +}) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + }); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert(function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +}) ) { + addHandle( "value", function( elem, name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + }); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert(function( el ) { + return el.getAttribute("disabled") == null; +}) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + (val = elem.getAttributeNode( name )) && val.specified ? + val.value : + null; + } + }); +} + +return Sizzle; + +})( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +}; +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( nodeName( elem, "iframe" ) ) { + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the master Deferred + master = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + master.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( master.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return master.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), master.reject ); + } + + return master.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + jQuery.contains( elem.ownerDocument, elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + +var swap = function( elem, options, callback, args ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.apply( elem, args || [] ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]+)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // Support: IE <=9 only + option: [ 1, "" ], + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +// Support: IE <=9 only +wrapMap.optgroup = wrapMap.option; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, contains, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + contains = jQuery.contains( elem.ownerDocument, elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( contains ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; +} )(); +var documentElement = document.documentElement; + + + +var + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 only +// See #13393 for more info +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Don't attach events to noData or text/comment nodes (but allow plain objects) + if ( !elemData ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = {}; + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + // Make a writable jQuery.Event from the native event object + var event = jQuery.event.fix( nativeEvent ); + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + handlers = ( dataPriv.get( this, "events" ) || {} )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // Triggered event must either 1) have no namespace, or 2) have namespace(s) + // a subset or equal to those in the bound event (both can have no namespace). + if ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + focus: { + + // Fire native event if possible so blur/focus sequence is correct + trigger: function() { + if ( this !== safeActiveElement() && this.focus ) { + this.focus(); + return false; + } + }, + delegateType: "focusin" + }, + blur: { + trigger: function() { + if ( this === safeActiveElement() && this.blur ) { + this.blur(); + return false; + } + }, + delegateType: "focusout" + }, + click: { + + // For checkbox, fire native event so checked state will be right + trigger: function() { + if ( this.type === "checkbox" && this.click && nodeName( this, "input" ) ) { + this.click(); + return false; + } + }, + + // For cross-browser consistency, don't fire native .click() on links + _default: function( event ) { + return nodeName( event.target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + + which: function( event ) { + var button = event.button; + + // Add which for key events + if ( event.which == null && rkeyEvent.test( event.type ) ) { + return event.charCode != null ? event.charCode : event.keyCode; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) { + if ( button & 1 ) { + return 1; + } + + if ( button & 2 ) { + return 3; + } + + if ( button & 4 ) { + return 2; + } + + return 0; + } + + return event.which; + } +}, jQuery.event.addProp ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + /* eslint-disable max-len */ + + // See https://github.com/eslint/eslint/issues/3229 + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi, + + /* eslint-enable */ + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.access( src ); + pdataCur = dataPriv.set( dest, pdataOld ); + events = pdataOld.events; + + if ( events ) { + delete pdataCur.handle; + pdataCur.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = concat.apply( [], args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl ) { + jQuery._evalUrl( node.src ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), doc, node ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && jQuery.contains( node.ownerDocument, node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html.replace( rxhtmlTag, "<$1>" ); + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = jQuery.contains( elem.ownerDocument, elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + div.style.position = "absolute"; + scrollboxSizeVal = div.offsetWidth === 36 || "absolute"; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }, + + cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style; + +// Return a css property mapped to a potentially vendor prefixed property +function vendorPropName( name ) { + + // Shortcut for names that are not vendor prefixed + if ( name in emptyStyle ) { + return name; + } + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a property mapped along what jQuery.cssProps suggests or to +// a vendor prefixed property. +function finalPropName( name ) { + var ret = jQuery.cssProps[ name ]; + if ( !ret ) { + ret = jQuery.cssProps[ name ] = vendorPropName( name ) || name; + } + return ret; +} + +function setPositiveNumber( elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + ) ); + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + val = curCSS( elem, dimension, styles ), + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox; + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + // Check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = valueIsBorderBox && + ( support.boxSizingReliable() || val === elem.style[ dimension ] ); + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + if ( val === "auto" || + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) { + + val = elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ]; + + // offsetWidth/offsetHeight provide border-box values + valueIsBorderBox = true; + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + if ( type === "number" ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra && boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ); + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && support.scrollboxSize() === styles.position ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && + ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || + jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || {} )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = Date.now(); + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ) + .filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ) + .map( function( i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match == null ? null : match; + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + + +jQuery._evalUrl = function( url ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + "throws": true + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( "